6. What is true about Calcium (Ca)?

A. It is a very unreactive metal.

B. It is reactive and is found with nonmetals in nature.

C. naturally uncombined with other elements.

D.It is a very reactive nonmetal.

Answers

Answer 1

Answer:

C. naturally uncombined with other elements.

Explanation: Calcium is a chemical element with the symbol Ca and atomic number 20. As an alkaline earth metal, calcium is a reactive metal that forms a dark oxide-nitride layer when exposed to air.


Related Questions

Consider the reaction.

2Pb(s)+O2(g)⟶2PbO(s)

An excess of oxygen reacts with 451.4 g of lead, forming 386.5 g of lead(II) oxide. Calculate the percent yield of the reaction.

Answers

Answer:837.9

Explanation:add those 2 numbers

. Why does the element with the higher atomic number have a lower ionization energy than the element with the lower atomic number?

Answers

Answer:

first ionization energy is the amount of energy required to remove an electron from isolated gaseous atom

so when atomic no increase across aperiod the ionization energy become lower

it's my opinion am not sure ok

Determine the molar solubility for Cr(OH)3 Ksp = 6.3x10^-31 ....

a) Set up the ICE table Cr(OH)3 (s) <-> Cr^3+ (aq) + 3OH^- (aq)

b) Ksp expression

c) Determine molar solubility

Answers

The equilibrium constant shows the extent of dissolution of a substance in solution. The molar solubility of the compound here is 1.2 * 10^-8 M.

What is solubility product?

The solubility product is the equilibrium constant that shows the extent to which a substnace is dissolved in soution.

Now let us set up the ICE table as shown;

               Cr(OH)3 (s) <-> Cr^3+ (aq) + 3OH^- (aq)

I                                           0                 0

C                                          +x               +3x

E                                          x                   3x

Ksp = [Cr^3+] [OH^- ]^3

6.3x10^-31 = [x] [3x]^3

6.3x10^-31 = 27x^4

x = 4√6.3x10^-31 /27

x = 1.2 * 10^-8 M

Lear n more about solubility product: https://brainly.com/question/857770

what is the resonance structure of ch3​

Answers

Answer:

For the CH3- structure use the periodic table to find the total number of valence electrons for the CH3- molecule. Once we know how many valence electrons there are in CH3- we can distribute them around the central atom with the goal of filling the outer shells of each atom.

In the Lewis structure of CH3- structure there are a total of 14 valence electrons.

Also note that you should put the CH3- Lewis structure in brackets with as 1- on the outside to show that it is an ion with a negative one charge.

----- Steps to Write Lewis Structure for compounds like CH3- -----

1. Find the total valence electrons for the CH3- molecule.

2. Put the least electronegative atom in the center. Note: Hydrogen (H) always goes outside.

3. Put two electrons between atoms to form a chemical bond.

4. Complete octets on outside atoms.

5. If central atom does not have an octet, move electrons from outer atoms to form double or triple bonds.

Lewis Structures, also called Electron Dot Structures, are important to learn because they help us understand how atoms and electrons are arranged in a molecule. This can help us determine the molecular geometry, how the molecule might react with other molecules, and some of the physical properties of the molecule (like boiling point and surface tension).

Explanation:

CH3CNO can be represented by at least three different but valid Lewis structures called resonance forms, or resonance structures, shown below.

Describe how you could show by adding aqueous sodium hydroxide and aqueous ammonia that a solution contained zinc ions.

Answers

Answer:

Learning Task 3. Solving word problems involving multiplication of deci-

the

A cstep in solving word problems. Do these in your notebook. ),

1. A clerk is paid P 45.25 per hour for 40 hours a week, 1.50 times the

regular rate for overtime and double the rate for a holiday. How much

holiday?

2. fofkmputer programmer earns a regular hourly rate of P50.00. If he

worked 42.75 hours in a week, how much did he earn?

3. Arthur earns P1350.00 a day. He sets aside 0.10 of this for savings.

How much does he save in a month?

4. Mr. Fernandez has a monthly pay of P 5,450. The tax deducted from

year?

5. Dianne works 2.5 hours a day from Monday to Friday and 3.75 hours

his a

on Saturday. If he is paid P25.00 per hour, how much does he earn in

a

week?

Explanation:

Learning Task 3. Solving word problems involving multiplication of deci-

the

A cstep in solving word problems. Do these in your notebook. ),

1. A clerk is paid P 45.25 per hour for 40 hours a week, 1.50 times the

regular rate for overtime and double the rate for a holiday. How much

holiday?

2. fofkmputer programmer earns a regular hourly rate of P50.00. If he

worked 42.75 hours in a week, how much did he earn?

3. Arthur earns P1350.00 a day. He sets aside 0.10 of this for savings.

How much does he save in a month?

4. Mr. Fernandez has a monthly pay of P 5,450. The tax deducted from

year?

5. Dianne works 2.5 hours a day from Monday to Friday and 3.75 hours

his a

on Saturday. If he is paid P25.00 per hour, how much does he earn in

a

week?

Electronegativity is a chemical property which describes how well an atom can attract an electron to itself. Values for electronegativity run from 0 to 4. The difference in electronegativity (ΔEN) is used to predict whether a bond between atoms will be ionic or covalent. It can also be used to predict if the resulting molecule will be polar or nonpolar.

If a bond was made between the two atoms shown below, would the bond be (1) covalent, i.e. ΔEN = ≤ 0.4, (2) polar covalent i.e. ΔEN > 0.4 and ≤2.0, or (3) ionic, i.e. ΔEN > 2.0? Enter 1 for covalent, 2 for polar covalent, 3 for ionic.

protactinium, francium

Answers

#protactinium

It lies in 7th period having Z=91

The outer electronic configuration is 6d^17s^2

d-block element(transition)

So it will form polar covalent bond (2)

#Francium

Z=87

Outer electronic configuration 7s^1

s-block element

It will form ionic bond (3)

how many atoms of vanadium are in 1.28 grams of vanadium

Answers

The number of atoms in 1.28 grams of vanadium is 1.51×10²² atoms

Avogadro's hypothesis

From Avogadro's hypothesis,

1 mole of Vanadium = 6.02×10²³ atoms

But

1 mole of Vanadium = 51 g

Thus,

51 g of Vanadium = 6.02×10²³ atoms

How to determine the atoms in 1.28 g of Vanadium

51 g of Vanadium = 6.02×10²³ atoms

Therefore,

1.28 g of Vanadium = (1.28 × 6.02×10²³) / 51

1.28 g of Vanadium = 1.51×10²² atoms

Thus, 1.51×10²² atoms is present in 1.28 g of Vanadium

Learn more about Avogadro's number:

https://brainly.com/question/26141731

classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2

Answers

The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.

A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.

In the reaction;

Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)

We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.

Learn more: https://brainly.com/question/5624100

The conversion of acetyl chloride to methyl acetate occurs via the following two-step mechanism: Reaction sequence of acetyl chloride to methyl acetateAccess the text alternative for PROBLEMS Kinetics and Rate Laws 6.49. Add curved arrows to show the movement of the electrons in each step. Write the rate equation for this reaction, assuming the first step is rate-determining. If the concentration of were increased 10 times, what would happen to the rate of the reaction? If the concentrations of both and were increased 10 times, what would happen to the rate of the reaction? Classify the conversion of acetyl chloride to methyl acetate as an addition, elimination, or substitution.

Answers

If the concentration of acetyl chloride  is increased ten times the rate of reaction is increased ten times.

The conversion of acetyl chloride to methyl acetate is a substitution reaction. Recall that a substitution reaction is one in which a moiety in a molecule is replaced by another.

In this reaction, the CH3O- ion replaces the chloride ion. In the first step, the CH3O- ion attacks the substrate in a slow step. This creates a tetrahedral intermediate. Loss of the chloride ion yields the  methyl acetate product.

The rate determining step is the formation of the tetrahedral intermediate. Since the reaction is first order in the acetyl chloride, if its concentration is increased ten times the rate of reaction is increased ten times.

Learn more: https://brainly.com/question/5624100

Identify the labeled structures. A: B: B C: < A D: ✓ > E: D AVIS Det E с


please I need your help and fast so as soon as you seen this answer please I will list brainlyist ​

Answers

Answer:

ahhh i d kkkkk im so so so so sorry

Explanation:

Elements in the alkaline earth metal family of the periodic table
have
electronegativity values than elements in the
halogen family of the periodic table.

Answers

Answer:Lower

Explanation:

( just had the question on ck12.)

Elements in the alkaline earth metal family of the periodic table have lower electronegativity values than elements in the halogen family of the periodic table as they have less electrons in their valence shell.

What is periodic table?

Periodic table is a tabular arrangement of elements in the form of a table. In the periodic table, elements are arranged according to the modern periodic law which states that the properties of elements are a periodic function of their atomic numbers.

It is called as periodic because properties repeat after regular intervals of atomic numbers . It is a tabular arrangement consisting of seven horizontal rows called periods and eighteen vertical columns called groups.

Elements present in the same group have same number of valence electrons and hence have similar properties while elements present in the same period show gradual variation in properties due to addition of one electron for each successive element in a period.

Learn more about periodic table,here:

https://brainly.com/question/11155928

#SPJ2

Explain why the element of an atom doesn't change if you remove or add electrons or neutrons

Answers

Answer: Does not change.

Explanation:

The atomic number and the electrical charge of that atom would remain unchanged. Neutrons do not carry an electrical charge so adding or removing them from the nucleus does not change the electrical charge of the nucleus.

In which species does sulphur have the more negative oxidation number? Answers: A.  H2S B.  S8 (elemental form of sulphur) C.  H2SO3 D.  K2SO4

Answers

Answer:

H2S

Explanation:

the oxidation number of S is -2.

You and your family have just arrived in Water Cycle Land. You are going on a new ride called the Water Cycle. You sit in your seat and the ride begins. All of a sudden something goes wrong. Your body is turning into a water droplet! Think about what you have learned about the water cycle. Now tell a story about what happens to you as you travel through the water cycle. By the way, how do you get your body back to normal?

Answers

Answer: you dont drink water for years

Explanation: dont drink water for years on end

helpppppppppppppppppppppp

Answers

Answer:

The process in which plants release water through their leaves back into the air

Explanation

Answer:

The process in which plants release water through their leaves back into the air.

Hope this helps!

What is condensation

Answers

Condensation is the process where water vapor becomes liquid. It is the reverse of evaporation, where liquid water becomes a vapor.

Condensation happens one of two ways: Either the air is cooled to its dew point or it becomes so saturated with water vapor that it cannot hold any more water.

Which substances will make a salt when combined?

Vinegar and soda
Soda and wine
Detergent and ammonia
Fertilizer and vinegar

Answers

Answer:

vinegar and soda

Explanation:

Mixing baking soda (sodium bicarbonate) and vinegar (acetic acid) causes a chemical reaction that produces a salt (sodium acetate) and water, as well as carbon dioxide gas.

Answer:

Fertilizer and vinegar

Explanation:

Fertilizer is a base, and vinegar is an acid. Salt is made when you combine a base and an acid. Plus, I got a 100% on the test and this was my answer.

can anyone heelp me pls pls

Answers

Answer:

Lotion=liquid

suspension=semisolid

capusule=solid

Explanation:

Carbon has three isotopes: carbon-12, carbon 13, and carbon-14. If the average atomic mass on the
periodic table for carbon is 12.011 amu, which isotope is most abundant? Explain your answer using a complete sentence.

Answers

Answer

The most abundant carbon isotope is carbon-12

Explanation:

The relative atomic mass of carbon is 12.011, which is extremely close to 12.0. This means that the masses C-13, and C-14 are practically negligible when contributing to the relative atomic mass of carbon.

In fact, the C-12 isotope makes up 98.9% of carbon atoms, C-13 makes up 1.1% of carbon atoms, and C-14 makes up just a trace of carbon atoms as they are found in nature.

Calculate the pOH of an aqueous solution of .0.073 M LiOH

Answers

Considering the definition of pOH and strong base, the pOH of the aqueous solution is 1.14

The pOH (or potential OH) is a measure of the basicity or alkalinity of a solution and indicates the concentration of ion hydroxide (OH-).

pOH is expressed as the logarithm of the concentration of OH⁻ ions, with the sign changed:

pOH= - log [OH⁻]

On the other hand, a strong base is that base that in an aqueous solution completely dissociates between the cation and OH-.

LiOH is a strong base, so the concentration of the hydroxide will be equal to the concentration of OH-. This is:

[LiOH]= [OH-]= 0.073 M

Replacing in the definition of pOH:

pOH= -log (0.073 M)

pOH= 1.14

In summary, the pOH of the aqueous solution is 1.14

Learn more:

brainly.com/question/16032912?referrer=searchResults brainly.com/question/13557815?referrer=searchResults

the pH of soil X is 7.5 while that of soils Y is 4.5 which of the two coils should be treated with powered talked to adjust its PH​

Answers

Answer:

Soils Y

Explanation:

• The soils with lower pH are acidic so they react readily with powdered.

[tex].[/tex]

Answer:

SOIL Y

the soil with lower ph are acidic

Tính axit giảm dần của các chất C6H5 OH (1) ,p – CH3 OC6H4 OH (2), p-NO2C6H4OH (3) pCH3COC6H4OH (4), p-CH3C6H4 OH (5) là:

Answers

Answer:

di ko po Alam sorry

Explanation:

sorry sorry sorry sorry sorry

Acetone [(CH3)2C=O], a simple ketone is commonly used to make products like nail polish remover and paint remover. Draw a picture showing the orbitals involved in the and bonds including its lone pairs.​

Answers

Carbon and oxygen atoms in (CH3)2C=O form sigma and pi bonds. The pi bonds are formed using unhybridized p orbitals.

Acetone (CH3)2C=O contains the carbonyl group (C=O). Carbon is bonded to oxygen via a double bond as shown in the orbital structure. The carbon atom is also bonded to two methyl groups.

The central carbon  atom is sp2 hybridized as well as the oxygen atom in acetone. The pi bond is formed by the overlap of unhybridized p orbitals on both carbon and oxygen atoms. The sigma bonds are formed using the sp2 hybridized carbon atoms on carbon and oxygen.

Learn more: https://brainly.com/question/14569599

A student creates a sports drink by dissolving 5.0 g of powder in 250 mL of water. The green colour of the drink is due to the presence Green Dye X, which has a lambdamax of 630 nm. A calibration curve (absorbance versus concentration) at lambdamax is created for varying concentrations (mM) of Green Dye X which has the equation y = 26.4x. If 1.0 mL of the sports drink is diluted to 10. mL with water, then the absorbance is measured to be 0.450, what is the mass percent of Green Dye X in the drink powder if the molecular weight is 418.4 g mol-1?

Answers

The mass percent of Green Dye X in the drink powder if the molecular weight is 418.4 g/mol is 0.355%

Beer's law explains the relation between the concentration of a solution to its absorbance (A) by using the equation.

A = ∈×C×L

here:

∈ = molar absorptivityL = path length

Now from the calibration curve in the question, the plot between the absorbance and the concentration gives a straight line of y = mx.

Here

y = absorbance x = concentration

The equation of the calibration curve is given as:

y = 26.4x

i.e.

0.450 = 26.4x[tex]\mathbf{x = \dfrac{0.450}{26.4}}[/tex]x = 0.017 mM

If the sports drink was 10 times diluted while taking the absorption measurement. Then, the actual concentration of green dye in the sports drink is:

= 0.017 mM × 10

= 0.17 mM

The number of moles of green dye in 250 mL (i.e. 0.25 L) sports drink is estimated as:

= 0.17 mmol/L × 0.25 L

= 0.0425 mmol

However, the mass of the green dye present in the sports drink is

= 0.0425 mmol ×418.4 g/mol

= 17.782 mg

Finally, the mass percent of green dye in the drink powder is:

[tex]\mathbf{ = \dfrac{mass (dye)}{mass (powder)} \times 100\%}[/tex]

[tex]\mathbf{ = \dfrac{17.782 \ mg }{5.0 \ g} \times 100\%}[/tex]

[tex]\mathbf{ = \dfrac{17.782 \ mg }{5000 \ mg} \times 100\%}[/tex]

= 0.355 %

Learn more about mass percent here:

https://brainly.com/question/11890206?referrer=searchResults

How many molecules of carbon dioxide and how many molecules of water would be produced from 4 molecules of methane (CH4) reacting with 8 molecules of oxygen (O2)

Answers

Answer:

4

Explanation:

water would be produced from 4 molecules of methane (CH4) reacting with 8 molecules of oxygen (O2)

The products of the combustion of hydrocarbon are 4 molecules of carbon dioxide and 8 molecules of water.

What is the combustion reaction?

A combustion reaction can be described as a reaction that produces fire and takes place at a high temperature. It is an exothermic reaction as well as a redox reaction that usually takes place between a fuel and mostly oxygen gas.

Examples of Combustion Reactions such as during the combustion of 4 molecules of methane reacting with 8 molecules of oxygen gas to give carbon dioxide and two molecules of water.

[tex]4CH_4 + 8O_2\longrightarrow 8H_2O + 4CO_2[/tex]

Oxygen is the essential reactant for combustion because the combustion is not possible in the absence of oxygen. Complete combustion takes place when a fuel burns completely to produce heat with oxygen and carbon dioxide.

The burning of wood fuels in the presence of air is an example of combustion. The carbon present in wood reacts with oxygen gas in the air to liberate heat and form gaseous products.

Learn more about combustion reaction, here:

brainly.com/question/12172040

#SPJ2

What is the mass of some honey that has a volume of 120.8 fl oz and a density of 1.38 kg/L?

Answers

Answer:

166.704

Explanation:

Calculate the moles of calcium oxalate formed from 5 grams of potassium oxalate (molar mass 184.24 g/mol) the mole mole ratio from the balanced equation is 2.1 potassium oxalate to calcium oxalate

Answers

5 g of potassium oxalate react to produce 0.03 moles of calcium oxalate.

Calcium oxalate (CaC₂O₄) is obtained by the reaction of 5 g of potassium oxalate (K₂C₂O₄).

We can calculate the moles of CaC₂O₄ obtained considering the following relationships.

The molar mass of K₂C₂O₄ is 184.24 g/mol.The mole ratio of K₂C₂O₄ to CaC₂O₄ is 2:1.

[tex]5 g K_2C_2O_4 \times \frac{1molK_2C_2O_4}{184.24gK_2C_2O_4} \times \frac{1molCaC_2O_4}{2molK_2C_2O_4} = 0.03molCaC_2O_4[/tex]

5 g of potassium oxalate react to produce 0.03 moles of calcium oxalate.

Learn more: https://brainly.com/question/15288923

Which of the following observations indicates that atoms of all elements contain small, negatively charged particles?
Alpha particles are repelled by cathode rays of elements.
b.Cathode rays are deflected towards a positively charged rod.
c.A particular frequency of light is produced by a gas in an excited state.
d.Certain areas of the atom called orbitals contain all the charged particles

Answers

Answer:

cathode rays are deflected towards a positively charged rod

Explanation:

which of the two glasses the ingredients dissolved completely class/sand or sugar​

Answers

Answer:

sugar

Explanation:

sand will not dissolve in water because the bond in water isn't strong enough to dissolve it.

so sand is a big no.

so the answer is the other option: which is sugar.

What sign of chemical change occurs during chemiluminesence?
Production of heat
Production of a gas
Production of light
O Production of a solid (precipitation)

Answers

Answer:

Emission of Light

Explanation:

Chemiluminescence is the emission of light as the result of a chemical reaction, and not a property of a specific compound.

Dont know if you were asking for this but hope it helps

Other Questions
Solve for yA 3B 5C 2D 4 im cold #notgirlboss :^( BJU press Chapter 6: Adverbs 6.1 Practice B In the blank write the correct form of the adverb in parentheses.6) Many Scots ___ were forced to leave Scotland because of limited job opportunities. (unfortunately positive)7) Of the different languages in Scotland English is the ___ spoken. (often superlative)8) Some Scots speak Gaelic ___ than other Scots. (fluently comparative)9) Gaelic is a ___ spoken ancient Celtic language. (seldom positive)10) Many of the Scots speak Gaelic ___ than English. (well comparative) PLEASE HELP!! forma negativa el verbodo we come to school by bus Find (i) x ,y ,z and w (ii) x + y + z + wPlease lemme know with explanation Question 3 options: A school is preparing a trip for 400 students. The company who is providing the transportation has 10 buses of 50 seats each and 8 buses of 40 seats, but only has 9 drivers available. The rental cost for a large bus is $800 and $600 for the small bus. Calculate how many buses of each type should be used for the trip for the least possible cost. Let L 11 over 8 as decimal Describe how the observation toolform you chose is used. Why are observation and documentation importantparts of program management? How do you ensure that you are accuratelylobjectively observing and trackingeach child's developmental and learning progress?This should be one paragraph (300-500 words in length). This must be typed in 12 point font, spell-checked,written in full sentences, and grammatically correct. Jeffrey makes 3% commission onhis sales. If his sales total $1800this week, how much money will hemake? see if you can solve for yy-4=3 Medic gaming?Medic gaming.Medic gaming! There were lots of people at the fancy dress party, some of _______ had made great efforts with their costumes. ( relative clause ) A fair die is rolled 11 times. What is the probability of rolling a 4 on the die 4 times? Express your answer as a decimal rounded to 4 decimal places after the decimal point. Compute y using the function y= 5x^3 as x goes from -2 to 1.y =? Rosie Belin worked these total weekly hours in four weeks of work: 45, 38, 42, and 43. Her job pays $14 for each hour worked. What AVERAGE gross pay did she earn per week for these four weeks of work? Please help!!!!! answer options a) slope of Function B =2 x slope of Function Ab) slope of Function A = slope of Function Bc) slope of Function A =2 x slope of Function Bd) slope of Function B = - slope of Function A once you shout for help, what are the next steps for providing hands-only cpr? 3x-2y=42x+3y=7X=?Y=?Plz step by step what is the answer to 7 1/3 + 5 4/5 4y=49 solve the equation