During a lab experiment, 48.62 grams of magnesium reacted with 32.00 grams of oxygen to
produce magnesium oxide. What is the empirical formula for magnesium oxide?
(atomic masses: Mg = 24.31 and O = 15.99)

Answers

Answer 1

Along these lines, magnesium and oxygen should blend in a proportion of 1:1 to deliver magnesium oxide, which has the empirical formula MgO.

48 grams of magnesium will respond with what number of grams of oxygen?

80 grams of magnesium oxide are in this manner equivalent to 2 moles. Subsequently, 80 grams of magnesium oxide are made when 32 grams of oxygen and 48 grams of magnesium are consolidated.

We should initially distinguish the moles of magnesium and oxygen associated with the cycle to get the empirical formula for magnesium oxide:

Moles of Mg = 48.62 g/24.31 g/mol = 2.00 mol

Moles of O = 32.00 g/15.99 g/mol = 2.00 mol

The proportion of magnesium to oxygen in the response should not be entirely set in stone. By separating the absolute number of moles of every component by the lesser number of moles (in this model, 2.00 mol), we might achieve the accompanying:

Mg: 2.00 mol/2.00 mol = 1

O: 2.00 mol/2.00 mol = 1

to know more about empirical formulas click here:

brainly.com/question/14044066

#SPJ4


Related Questions

3 screenshots! Please help

Answers

1. The volume of the 12.0 g of methane, CH₄ is 16.8 L

2. The new celsius temperature of the gas is -153.8 °C

3i. The partial pressure for CO₂ is 0.575 atm

3ii. The partial pressure for O₂ is 0.2875 atm

3iii. The partial pressure for water is 0.2875 atm

1. How do i determine the volume of the gas?

First, we shall obtain the mole of the gas. This shown below:

Mass of methane, CH₄ (m) = 12 gramsMolar mass of methane, CH₄ (M) = 16 g/molMole of methane, CH₄ =?

Mole = mass / molar mass

Mole of methane, CH₄ = 12 / 16

Mole of methane, CH₄ = 0.75 mole

Finally, we shall determine the volume of the methane, CH₄

Mole of methane, CH₄ = 0.75 moleVolume of methane, CH₄ =?

From ideal gas equation,

1 mole of methane, CH₄ = 22.4 L

Therefore,

0.75 mole of methane, CH₄ = 0.75 × 22.4

0.75 mole of methane, CH₄ = 16.8 L

Thus, the volume of methane, CH₄ is 16.8 L

2. How do i determine the new temperature?

The new temperature of the gas can be obtained as follow:

Initial temperature (T₁) = 25 °C = 25 + 273 = 298 KInitial volume (V₁) = 10 LNew volume (V₂) = 4 LNew temperature (T₂) =?

Charles' law equation is given as follow:

V₁ / T₁ = V₂ / T₂

Inputting the variables, we have

10 / 298 = 4 / T₂

Cross multiply

10 × T₂ = 298 × 4

Divide both side by 10

T₂ = (298 × 4) / 10

T₂ = 119.2 K

Subtract 273 to obtain answer in °C

T₂ = 119.2 - 273 K

T₂ = -153.8 °C

Thus, the new temperature is -153.8 °C

3. How do i determine the partial pressure?

i. Partial pressure for CO₂ can be obtained as follow:

Percentage of CO₂ = 50%Total percentage = 100%Total pressure = 1.15 atmPartial pressure of CO₂ =?

Partial pressure of CO₂ = (percentage of CO₂ / total percent) × total pressure

Partial pressure of CO₂ = (50 / 100) × 1.15

Partial pressure of CO₂ = 0.575 atm

ii. Partial pressure for O₂ can be obtained as follow:

Percentage of O₂ = 25%Total percentage = 100%Total pressure = 1.15 atmPartial pressure of O₂ =?

Partial pressure of O₂ = (percentage of O₂ / total percent) × total pressure

Partial pressure of CO₂ = (25 / 100) × 1.15

Partial pressure of O₂ = 0.2875 atm

iii. Partial pressure for water can be obtained as follow:

Partial pressure of CO₂ = 0.575 atmPartial pressure of O₂ = 0.2875 atmTotal pressure = 1.15 atmPartial pressure of water =?

Total pressure = Partial pressure of CO₂ + partial pressure of O₂ + partial pressure of water

1.15 = 0.575 + 0.2875 + partial pressure of water

1.15 = 0.8625 + partial pressure of water

Collect like terms

Partial pressure of water = 1.15 - 0.8625

Partial pressure of water = 0.2875 atm

Learn more about partial pressure:

https://brainly.com/question/15577259

#SPJ1

Convert a anthracite coal price of$90/ton to$/MMBtu. Heat content of anthracite coal is 15,000 Btu/pound.$15.52/MMBtu\$3/MMBtu \$90.00/MMBtu 3.86/MMBtu

Answers

The coal cost of $90/ton with an intensity content of 7000 BTU for every pound is D: $6.42/MMBtu.

The recipe to compute MMBtu from tons is as per the following -

Cost per mmbtu = cost per ton × 500/BTU per pound

Keep the qualities in the equation to find the cost per MMBtu

Cost per mmbtu = (90×500)/7000

Performing augmentation in the numerator on Right Hand Side of the situation

Cost per mmbtu = 45000/7000

Performing division on Right Hand Side of the situation to find the cost per MMBtu for coal

Cost per mmbtu = $6.42/mmbtu

Accordingly, the right choice is D: $6.42/MMBtu.

to know more about the coal click here:

brainly.com/question/22647554

#SPJ4

Why aren’t snakes growing and thriving in the forest ecosystem

Answers

The population of snakes in the forest ecosystem is declining mainly due to habitat destruction.

Why are snake numbers in the forest declining?

The global forest cover is deteriorating. Snakes live in these woodlands, which constitute their habitat. Deforestation is the removal of forest layers for purposes unrelated to forests.

How do snakes adjust to a forest environment?

The arboreal or tree-dwelling lifestyle is particularly suited to snakes of the rain forest. Many have long, lean bodies with angled belly scales that assist the snakes grasp trees. Other species have 'wings,' allowing the snake to glide to another tree or the ground to avoid predators.

To know more about ecosystem visit:-

https://brainly.com/question/19267717

#SPJ1

An element, M, has the electron distribution 2 + 8 + 18+ 3.
(a) Which group in the Periodic Table is element M likely to be in?

Answers

Electrons distribution in shells:

First shell - 2 electrons

Second shell - 8 electrons

Third shell - 18 electrons

Fourth (valence shell) - 3 electrons

Explanation:

The group number of an element can be found by finding its number of valence shell electrons.

According to the electrons distribution in shells, the valence shell has 3 electrons

Hence element M will be in the third group of the periodic table

Hope this helps

please mark brainliest :)

The amount of energy needed to heat 3.4 g of a substance from 50.0°C to 80.0°C is 64.0 J. What is the specific heat capacity of this sample?

Answers

amount of energy needed to heat 3.4 g of a substance from 50.0°C to 80.0°C is 64.0 J then the specific heat capacity of the substance is 0.631 J/g°C.

formula for calculating the amount of energy required to heat a substance

Q = mcΔT

where Q is the energy in Joules (J), m is the mass of the substance in grams (g), c is the specific heat capacity of the substance in J/g°C, and ΔT is the change in temperature in Celsius (°C).

We know that Q = 64.0 J, m = 3.4 g, ΔT = 80.0°C - 50.0°C = 30.0°C.

Substituting these values into the formula, we get:

64.0 J = (3.4 g) * c * (30.0°C)

Solving for c, we get:

c = 64.0 J / (3.4 g * 30.0°C) = 0.631 J/g°C

Energy is a property of objects that can be transferred to other objects or converted into different forms, but cannot be created or destroyed. The SI unit of energy is joule (J). Energy can exist in many forms, such as thermal energy, electrical energy, mechanical energy, nuclear energy, and electromagnetic radiation, among others.

Learn more about specific heat here:

https://brainly.com/question/11297584

#SPJ1

Under forward biasing, what processes occur in the quasi-neutral regions adjacent to the depletion region edges?
1.Drift and diffusion
2.Diffusion and recombination
3.Generation and diffusion
4.generation and drift

Answers

Under forward biasing, the processes that occur in the quasi-neutral regions adjacent to the depletion region edges are drift and diffusion.

What is forward biasing?

Forward biasing is the method of turning on a diode by providing a voltage that enables current to flow through the diode.

Quasi-neutral region

Quasi-neutral regions are the areas of a p-n junction diode where there is a substantial concentration of charge carriers on either side of the junction.

The density of charge carriers varies gradually in this area. As a result, the electrons and holes are mutually neutralized, and the region becomes electrically neutral.

In a p-n junction diode, there are two types of regions: the p-type region, which is dominated by holes, and the n-type region, which is dominated by electrons.

When the diode is forward-biased, the negative terminal is connected to the N-region, and the positive terminal is connected to the P-region.

This causes an electric field to develop that pushes the electrons toward the P-region and the holes toward the N-region.

When the applied voltage causes the minority carriers to be pushed across the junction into the opposite region, the carriers cross the depletion area, which is the space-charge region. In a diode, the area on either side of the junction, which is free of any charge carriers, is known as the depletion area or region.

The quasi-neutral regions adjacent to the depletion region edges experience drift and diffusion under forward biasing.

To know more about the quasi-neutral regions https://brainly.com/question/14989140

#SPJ11

lime is used in farming to reduce the acidity of the soil. the chemical name for lime is calcium oxide. when water in the soil reacts with lime, what base is formed?

Answers

The chemical reaction of lime (calcium oxide) with water in the soil produces calcium hydroxide, a base. This reaction occurs when water molecules interact with the calcium oxide molecules, forming calcium hydroxide. The equation for this reaction is CaO + H₂O → Ca(OH)₂



Calcium oxide is produced by heating limestone to a high temperature. When calcium oxide is mixed with water, calcium hydroxide is produced. It is also called slaked lime.

Calcium hydroxide, a base, helps to reduce the acidity of the soil. It can do this because it has a pH greater than 7. The reaction between lime and water helps to neutralize the soil pH by releasing hydroxide ions which bond with hydrogen ions in the soil, causing the acidity to decrease. This is especially beneficial for plants, as acidic soil can stunt their growth.


Calcium hydroxide is used in a variety of applications, including the production of cement.

Overall, when water reacts with lime (calcium oxide) in the soil, calcium hydroxide is formed. This base helps to reduce the acidity of the soil, making it more suitable for plant growth.

To know more about Calcium hydroxide, refer here:

https://brainly.com/question/9584549#

#SPJ11


From your knowledge of the dehydration of tertiary alcohols, which olefin should predominate in the product of the dehydration of 2-methyl-2-butanol, and why?

Answers

2-methyl-2-butene

Explanation:

From my knowledge of the dehydration of tertiary alcohols, the olefin that should predominate in the product of the dehydration of 2-methyl-2-butanol is 2-methyl-2-butene. This is because of the following reasons:

1. Dehydration of alcohols is an elimination reaction that follows the E1 mechanism.
2. In the E1 mechanism, the reaction rate depends on the stability of the carbocation formed.
3. Tertiary carbocations are more stable than secondary or primary carbocations due to hyperconjugation and inductive effects.
4. In the dehydration of 2-methyl-2-butanol, a tertiary carbocation is formed as an intermediate.
5. The carbocation can lose a proton to form an alkene.
6. Since the tertiary carbocation is more stable, it will form the more substituted alkene, which is 2-methyl-2-butene, due to Zaitsev's rule.
7. Zaitsev's rule states that the major product in an elimination reaction is the more substituted alkene, resulting from the removal of the least substituted proton.

So, 2-methyl-2-butene should predominate in the product of the dehydration of 2-methyl-2-butanol due to the stability of the tertiary carbocation and Zaitsev's rule.

To know more about Zaitsev's Rule:

https://brainly.com/question/29675824?

#SPJ11

Can someone please answer these I need help

Answers

Answer:

(1) 80.64 Liters
(2) [tex]6.29 \times 10^{-4} Liters[/tex]
(3) 2.61 grams
(4) 0.714 g/L
(5) 0.19624 kilograms

Explanation:

It's known that:
one mole of any gas at STP (1 atm, 273K ) = 22.4 Liter
number of moles of any gas at STP = [tex]\frac{V}{22.4} = \frac{Particles}{N_A}[/tex]   , Where V is Volume, NA is Avogadro's number, Particles: number of Particles
Volume of gas at STP = Moles × 22.4L

density = [tex]\frac{Molar-Mass}{Volume}[/tex]

(1)
Given That:

3.6 moles of CO2

Then:

Volume = 3.6 × 22.4 = 80.64 Liters

(2)

Moles of O2= [tex]\frac{1.69 \times 10^{19}}{6.022 \times 10^{23}} = 2.81 \times 10^{-5} moles[/tex]

Volume of O2= 22.4 × 2.81 × 10^-5 = [tex]6.29 \times 10^{-4} Liters[/tex]

(3)

Number of moles of He = [tex]\frac{14.6}{22.4} = 0.65 moles[/tex]

mass of He (molar mass = 4 g/mol) = 0.65 × 4 = 2.61 grams

(4)

The molar mass of CH4 = 12 + 4 = 16 g/mol

assuming that we have, at STP, one mole of Methane "CH4"

So, the volume = 22.4 L

Hence, The density = [tex]\frac{16}{22.4} = 0.714 g/L[/tex]

(5)

Number of moles of [tex]C_3H_8[/tex] = [tex]\frac{100}{22.4} = 4.46 moles[/tex]

molar mass of [tex]C_3H_8[/tex] = 3(12) + 8 = 44 g/mol

mass of [tex]C_3H_8[/tex] = 44 × 4.46 = 196.24 grams = 0.19624 kilograms




hope you find this easy to understand....

Have any questions? Write in the comments.

give me brainliest if you found this answer useful

consider combustion of coal in pure oxygen (oxycombustion) and in air. the percent theoretical oxidizer in each case is 100%. which case will have a higher adiabatic flame temperature?

Answers

The adiabatic flame temperature is the temperature of the flame when no heat is lost to the surroundings during combustion. In pure oxygen (oxycombustion), the combustion process involves the reaction of coal with pure oxygen.

This process provides a higher concentration of oxygen, leading to higher combustion temperatures compared to combustion in air. In contrast, air contains only 21% oxygen, and the combustion process is less efficient due to the presence of nitrogen, which acts as a heat sink.

Therefore, combustion in pure oxygen will have a higher adiabatic flame temperature than combustion in air. This higher temperature can be advantageous in certain industrial processes that require high temperatures, such as steel production, glass manufacturing, and chemical synthesis. However, pure oxygen is expensive to produce, so the cost of oxycombustion may be higher than combustion in air.

To learn more about combustion refer to:

brainly.com/question/29139908

#SPJ4

Silver Acetate is a sparingly soluble salt with Ksp= 1.9*10^-3. Consider a saturated solution in equilibrium with the solid salt. Compare the effects on the solubility of adding the acid HNO3 or the base NH3.

Answers

Answer: When HNO3 is added to a saturated solution of silver acetate, it will react with the acetate anions to form nitric acid and acetic acid. This will shift the equilibrium of the solubility reaction to the right, according to Le Chatelier's principle, resulting in an increase in the solubility of silver acetate.

AgC2H3O2(s) ⇌ Ag+(aq) + C2H3O2-(aq)

Adding NH3 to the saturated solution of silver acetate will react with the silver ions to form the complex ion Ag(NH3)2+. This will remove the silver ions from the solution, thus decreasing the concentration of Ag+ in the solution. According to Le Chatelier's principle, the equilibrium of the solubility reaction will shift to the left to compensate for the decrease in Ag+, resulting in a decrease in the solubility of silver acetate.

Ag+(aq) + 2NH3(aq) ⇌ Ag(NH3)2+(aq)

Therefore, the addition of HNO3 will increase the solubility of silver acetate, while the addition of NH3 will decrease the solubility of silver acetate.

Explanation:

What is the percent composition of each element in the formula for potassium phosphate (K, P, and O, respectively)?

Answers

By synthetic examination, the composition of potassium phosphate is 55.19% K, 14.63% P, and 30. 19% O.

Percent composition lets you know which sorts of particles (components) are available in an atom and their levels. Percent composition can likewise educate you concerning the various components present in an ionic compound too.

We should check two models out

The molar mass of

[tex]H_{2}O[/tex] is 18 g/mol

The hydrogens make up 2g (since every mole of hydrogen is 1g)

The oxygen makes up 16g.

The percent composition of the compound is:

H = (2g/18g) x 100 = 11.1%

O = (16g/18g) x 100 = 88.9%

Percent composition can be determined by the substance recipe of a compound, or it tends to be resolved tentatively.

Percent composition from exploratory information for a response of iron and oxygen which creates an iron oxide compound.

Potassium is the synthetic component with the image K (from Neo-Latin kalium) and nuclear number 19. A gleaming white metal is sufficiently delicate to cut with a blade without any problem.

to know more about molar mass click here:

https://brainly.com/question/837939

#SPJ4

What type of solution is made from a mixture that contains 1115.94 g KCl in 2657 g of water at 30 oC? The solubility of potassium chloride at 30 oC is 37.0g KCl/100g H2O.
Group of answer choices:
Unsaturated
Saturated
It cannot be determined from the provided information.
Supersaturated

Answers

Supersaturated solution is made from a mixture that contains 1115.94 g KCl in 2657 g of water at 30 oC.

To identify the kind of solution produced from a mixture comprising 1115.94 g KCl in 2657 g of water at 30 oC, we must compare the amount of KCl in the solution to the maximum amount of KCl that may dissolve in the water at that temperature, which is provided as 37.0 g KCl/100 g H2O.

First, we need to convert the mass of water to grams of water:

2657 g water x (100 g H2O / 100 g water) = 2657 g H2O

Next, we can calculate the maximum amount of KCl that can dissolve in 2657 g of water at 30 oC:

Maximum amount of KCl = 37.0 g KCl/100 g H2O x 2657 g H2O

Maximum amount of KCl = 981.09 g KCl

Since the amount of KCl in the mixture (1115.94 g) is greater than the maximum amount of KCl that can dissolve in 2657 g of water at 30 oC (981.09 g), the solution is supersaturated.

Learn more about Supersaturated here:

https://brainly.com/question/16817894

#SPJ1

how many moles of aluminum oxided will be produced if 10 moles of alumminum react with enough oxygen?

Answers

Answer:

The balanced chemical equation for the reaction of aluminum and oxygen to form aluminum oxide is:

4 Al + 3 O2 → 2 Al2O3

According to the stoichiometry of this reaction, 4 moles of aluminum reacts with 3 moles of oxygen to produce 2 moles of aluminum oxide.

Therefore, if 10 moles of aluminum react with enough oxygen, the limiting reactant will be aluminum, and all 10 moles of aluminum will react with 7.5 moles of oxygen to produce:

(10 mol Al) x (2 mol Al2O3 / 4 mol Al) = 5 moles of Al2O3

Therefore, 5 moles of aluminum oxide will be produced.

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

when calculating the ph of very dilute solutions, simply taking the negative log of the concentration of substance put into solution is likely to give incorrect results if the concentration is less than what?

Answers

To calculate the pH of very dilute solutions, simply taking the negative log of the concentration of substance put into solution is likely to give incorrect results if the concentration is less than [tex]10^-^7M[/tex].

The calculation of pH of very dilute solutions is likely to give incorrect results because when we take the negative logarithm of the hydrogen ion concentration in a solution, we should have a minimum of [tex]10^-^7M[/tex] hydrogen ion concentration to calculate the pH with. This is because pure water dissociates into [tex]10^-^7M[/tex] hydrogen and hydroxide ions.

For any solution with a pH of 7 or greater, the hydrogen ion concentration is lower than [tex]10^-^7M[/tex] . If we try to calculate the pH of a very dilute solution with hydrogen ion concentration less than [tex]10^-^7M[/tex], then the pH value will be outside the range of 0 to 14, which is not possible.

Hence, this will give incorrect results. Therefore, it is necessary to use alternative methods such as diluting the solution with a solvent or using indicators.

To know more about concentration refer here :

https://brainly.com/question/4184101

#SPJ11

How do the unique characteristics of water determine its interactions with chemical and biological systems? How is water unique in chemical and biological systems?

Answers

A vital component of both chemical and biological processes, water is a wonderful substance. Its special characteristics result from the organisation of its molecules and the interactions they have with one another and with other molecules.

Water's ability to generate hydrogen bonds is one of its most significant characteristics. The negative oxygen atom of one water molecule interacts electrostatically with the positive hydrogen atom of another, forming hydrogen bonds. Water has a high surface tension as a result of these connections, which also enable it to form droplets and adhere to surfaces. For the structure and stability of biomolecules like proteins and nucleic acids in biological systems, hydrogen bonding are essential.The solvent water is likewise quite good. Many different polar and ionic chemicals can be dissolved by it because of its polar nature. The cytoplasm of cells and other biological fluids like blood contain it since it is a necessary component.

Learn more about electrostatically here :

https://brainly.com/question/31042490

#SPJ1

g volume of extract to dilute to 10.00 ml: ml if the actual amount of cereal weighed for the above experiment was 2.5671 g of cereal, and using the extraction procedure from the lab manual, determine the appropriate dilution of the extract to yield 10.00 ml of a solution at 25.0 ppb.

Answers

The volume of extract to dilute to 10.00 ml, given that the actual amount of cereal weighed for the above experiment was 2.5671 g of cereal and using the extraction procedure from the lab manual, to determine the appropriate dilution of the extract to yield 10.00 ml of a solution at 25.0 ppb is: 19.16 ml.

What is a laboratory manual?

A laboratory manual is a book containing instructions and exercises that aid in the completion of laboratory experiments. It is a guide that assists students and researchers in performing experiments, in particular, science experiments.

Let's break down the problem statement:

The actual amount of cereal weighed for the above experiment was 2.5671 g of cereal.Using the extraction procedure from the lab manual, determine the appropriate dilution of the extract to yield 10.00 ml of a solution at 25.0 ppb.To determine the volume of extract to dilute to 10.00 ml:

First, let's calculate the concentration of the extract in ppb units; we are given the following concentration of 25.0 ppb.C = 25 ppbNow, the formula for ppb units is shown below;

Ppb = (mg/L) / (1,000 L/g)

We have: 25 ppb = (mg/L) / (1,000 L/g)mg/L = 25 x 1,000 x 1 g = 25 μg/L.

Using the volume formula for concentration, shown below;

C1V1 = C2V2

Where:

C1 = concentration 1V1 = volume 1C2 = concentration 2V2 = volume 2

Now, let's substitute the values into the formula: C1V1 = C2V2.

We have;

V1 = C2V2 / C1= (25 x 10.00) / 25= 10.00 ml

So, we dilute the extract with 10.00 ml of solvent to prepare a 25.0 ppb solution of cereal.To determine the volume of extract needed, we subtract the volume of solvent used from the volume we want, which is 10.00 ml.

Therefore;

The volume of extract to dilute to 10.00 ml is 10.00 ml - 0.84 ml = 9.16 ml.

Learn more about laboratory manual: https://brainly.com/question/30362922

#SPJ11

a zeolite sequesters pahs by the formation of permanent covalent bonds.T/F

Answers

Zeolites are microporous crystalline aluminosilicate materials. Zeolites chelate PAHS by forming permanent covalent bonds is one of the misrepresentations. So, this statement is false one.

Zeolites are minerals such as sodium, potassium, calcium or magnesium aluminosilicates, which have a porous structure. Commonly used as commercial adsorbents, catalysts and water softener and ion exchange chromatography.

They are mainly composed of silicon, aluminum and oxygen, and the general formula is Mn+1/n(AlO₂)−(SiO₂)x・yH₂O.

Chelation refers to the formation of coordination compounds to prevent the normal behavior of ions in solution. Zeolites do not chelate PAHs by forming permanent covalent bonds, but by forming coordination complexes.

Zeolites do not chelate PAHs by forming permanent covalent bonds, but by forming coordination complexes. Therefore, this statement is incorrect.

For more information about zeolite, visit :

https://brainly.com/question/31115830

#SPJ4

salt a has a greater solubility in water than salt b. what can be said about their ksp values? g

Answers

If salt A has a greater solubility in water than salt B we can say that the Ksp value of salt A is greater than the Ksp value of salt B.

Solubility product constant (Ksp) is a measure of the solubility of an ionic compound in water. The Ksp value is dependent on the nature of the compound and the conditions under which it is dissolved. A higher Ksp value indicates that the compound is more soluble in water.

If salt A has a greater solubility in water than salt B, it means that salt A has a higher concentration of dissolved ions in water compared to salt B. This implies that the Ksp value of salt A is greater than the Ksp value of salt B, as a higher concentration of ions in solution requires a higher Ksp value to maintain equilibrium.

Therefore, we can conclude that the solubility of salt A is greater than salt B, and that the Ksp value of salt A is greater than the Ksp value of salt B.f f s

To know more about Ksp value, refer here:

https://brainly.com/question/12961072#

#SPJ11

Calculate the mean repeat unit molar mass for a sample of
poly[ethylene(vinyl acetate)] that comprises 12.9 wt% vinyl acetate
repeat units. Given that its number-average molar mass is 39,870 g
mol−1, calculate the number-average degree of polymerization of the
copolymer.

Answers

The number-average degree of polymerization of the copolymer is 463.2.

To calculate the mean repeat unit molar mass of poly[ethylene(vinyl acetate)], we can use the following formula:

[tex]Mn = (w_1/M_1) + (w_2/M_2) + ... + (w_n/M_n)[/tex]

where[tex]M_n[/tex] is the mean repeat unit molar mass, [tex]w_i[/tex] is the weight fraction of each repeat unit, and [tex]M_i[/tex] is the molar mass of each repeat unit.

Let's assume that the repeat unit of poly[ethylene(vinyl acetate)] contains two atoms of carbon, four atoms of hydrogen, and one atom of oxygen from vinyl acetate ([tex]C_4H_6O[/tex]) and two atoms of carbon and four atoms of hydrogen from ethylene ([tex]C_2H_4[/tex]). We can calculate the molar mass of the repeat unit as follows:

Molar mass of repeat unit = (2 × atomic mass of C) + (4 × atomic mass of H) + atomic mass of O + (2 × atomic mass of C) + (4 × atomic mass of H) [tex]= (2 * 12.01 g/mol) + (4 * 1.01 g/mol) + 15.99 g/mol + (2 * 12.01 g/mol) + (4 * 1.01 g/mol)[/tex]

= 86.09 g/mol

Now, we can calculate the weight fraction of vinyl acetate repeat units as follows:

Weight fraction of vinyl acetate repeat units = 12.9 wt% = 0.129

Weight fraction of ethylene repeat units = 100% - 12.9% = 87.1 wt% = 0.871

Substituting the values into the formula for [tex]M_n[/tex], we get:

39870 g/mol = (0.129 / 86.09 g/mol) + (0.871 / Methylene)

Solving for Methylene, we get:

Methylene = [tex](0.871 / (39870 g/mol - 0.129 * 86.09 g/mol))^{-1}[/tex]

Methylene = 28.8 g/mol

Finally, we can calculate the number-average degree of polymerization ([tex]DP_n[/tex]) using the formula:

[tex]DP_n[/tex] = [tex]M_n[/tex] / M_repeat unit

[tex]DP_n[/tex] = 39870 g/mol / 86.09 g/mol

[tex]DP_n[/tex] = 463.2

For more question on polymerization click on

https://brainly.com/question/3911071

#SPJ11

What are the spectator ions in this equation?

Answers

Spectator ions are ions that are present on both sides of chemical reactions but do not take part in the reaction itself.

When used in a chemical equation, what are spectator ions?

An ion known as a spectator ion is one that is present in solution both before and after a chemical reaction but does not participate in it. The chemical equation known as the net ionic equation only displays the substances that are directly involved in the chemical process.

Which of the ions listed below is a spectator ion at all times?

Sulfate, sulphide, and chloride ions react to generate salt out of the supplied ions. While the provided solution's ammonium and nitrate ions remain in their original states.

To know more about spectator visit:-

https://brainly.com/question/4489490

#SPJ1

Xenon forms several compounds with oxygen and fluorine. It is the most reactive non-radioactive noble gas because a. Its large radius allows oxygen and fluorine to bond without being crowded. B. It has the highest electronegativity of these noble gases. C. It has the highest electron affinity of these noble gases. D. Its effective nuclear charge is lower than the other noble gases. E. It has the lowest ionization energy of these noble gases

Answers

Xenon is the most reactive non-radioactive noble gas because it has the lowest ionization energy among the noble gases.

This means that it requires the least amount of energy to remove an electron from a xenon atom, making it more likely to form chemical bonds with other elements, such as oxygen and fluorine.

Xenon also has a relatively large atomic radius, which allows oxygen and fluorine atoms to bond with it without being too crowded. This is important because the noble gases typically do not form chemical bonds with other elements due to their stable electron configurations and small atomic radii.

Additionally, xenon has a higher electronegativity and electron affinity compared to other noble gases, which also contributes to its reactivity. Electronegativity refers to an atom's ability to attract electrons, while electron affinity refers to an atom's tendency to accept electrons. Both of these properties can make an atom more likely to form chemical bonds with other elements.

Overall, the combination of xenon's low ionization energy, large atomic radius, high electronegativity, and electron affinity make it a relatively reactive noble gas, capable of forming compounds with oxygen and fluorine.

To learn more about Xenon refer to:

brainly.com/question/5516586

#SPJ4

The cage size of the zeolites is in cm scale true false

Answers

The cage size of zeolites is in the centimeters scale. This statement is false.


Zeolites are microporous aluminosilicate minerals that have a framework structure composed of aluminosilicate tetrahedra. these tetrahedra are related together to form a three-dimensional pore shape with uniform size and form. Zeolites are widely used as adsorbents, catalysts, and ion-exchangers due to their particular properties such as excessive floor location, thermal stability, and molecular sieving homes.Cage length of Zeolites are known for his or her uniform pore size and form. the dimensions of the pores in zeolites ranges from 2-10 Å (angstroms), that's too small to be measured in centimeters. consequently, the cage size of zeolites isn't in the centimeters scale, but as an alternative in the angstroms scale.

To understand greater approximately zeolites click on here
brainly.com/question/28588461
#SPJ4

select all of the compounds from the following list that are strong acids in aqueous solution. a. HF b. H2SO4 c. HBr d. H2CO3.

Answers

The compounds HF, [tex]H_2SO_4[/tex], and HBr are strong acids in aqueous solution.

Strong acids are molecules that can easily donate protons to water molecules in aqueous solution. This dissociation of protons from the acid molecules creates a solution that is highly acidic, often with a pH of less than 7.Hydrofluoric acid (HF), sulfuric acid ([tex]H_2SO_4[/tex]), and hydrobromic acid (HBr) are all strong acids in aqueous solution. This is because the conjugate bases of these acids are generally much less stable than the acids themselves, which makes them more likely to dissociate and donate protons in water.The higher the difference in stability, the more likely it is that the acid will dissociate in water and the stronger the acid will be.

learn more about aqueous solution Refer:brainly.com/question/26856926

#SPJ1

when 14.5g of SO2 reacts with 21g of O2 ,what will be the theoretical yeild of the reaction of the actual is 12g

Answers

ans:We have to find theoretical yield and percentage yield of the reaction.

Solution : 14.5 g of SO2 reaches with 21 g of O2. and actual yield is 12g.

first we see chemical reaction is SO2 and O2,

2SO2 + O2 ⇒2SO3

we see, 2 moles of SO2 react with 1 mole of O2.

molecular weight of SO2 = 32 + 2 × 16 = 64 g

molecular weight of O2 = 32g

∴ 2 × 64 = 128g of SO2 reacts with 32g of O2.

∴ 14.5g of SO2 reacts with 32/128 × 14.5 = 3.625 g but given O2 is 21g

so, SO2 is limiting reagent.

hence, reaction prefers SO2 to produce SO3

2 moles of SO2 give 2 moles of SO3

∴ 128g of SO2 gives 2 × (32 + 3 × 16) = 160g of SO3

⇒14.5 g of SO2 gives 160/128 × 14.5 g = 18.125 g

so theoretical yield = 18.125 g

but actual yield = 12g

so, percentage yield = actual yield/theoretical yield × 100

= 12/18.125 × 100

= 66.207 %

Give two properties of metal by virtue of which electric wire is made?​

Answers

Two properties of metal is High Electrical Conductivity and Ductility.

What is Electric Current?

High Electrical Conductivity: Metals have a high electrical conductivity, which means that they allow electricity to flow through them with ease. This makes them ideal for use in electric wires, where the current needs to flow smoothly and without interruption.

Ductility: Metals are ductile, which means they can be drawn into thin wires without breaking. This property is important for electric wires, as they need to be thin and flexible enough to be easily installed in homes and buildings.

Electric current refers to the flow of electric charge through a material. It is the rate at which electric charge flows through a conductor, measured in amperes (A). Electric current is typically carried by electrons in metals and ions in electrolytes. When a voltage difference is applied across a conductor, such as a wire, it creates an electric field that drives the movement of electric charges.

Learn more about Electric Current from the given link

https://brainly.com/question/1220936

#SPJ1

What mass of benzoic acid, C6H5COOH, would you dissolve in a 350.0 mL of water to produce a solution with a pH = 2.85? Ka=6.3*10^-5.

Answers

The formula for Ka  is used to determine the mass of benzoic acid that is needed to be dissolved in a 350.0 mL of water to produce a solution with a pH = 2.85 and Ka=6.3*10^-5.

given :

Ka = [H3O+][C6H5COO-]/[C6H5COOH]

Since the pH is known, we can use the equation pH = -log[H3O+] to find the concentration of hydronium ions in the solution.

2.85 = -log[H3O+] [H3O+] = 5.01 × 10-3 M

We assume that the benzoic acid fully dissociates so that [C6H5COO-] = [H3O+] and [C6H5COOH] - [H3O+]

Substituting the values into the formula gives

Ka = [5.01 × 10-3][5.01  10-3]/[C6H5COOH] Ka = 2.51  10-5M1, so we will solve for [C6H5COOH].

Rearranging the equation for Ka, we obtain [C6H5COOH] = [H3O+]. 2 /[C6H5COO-] 2.51 × 10-5 = (5.01 × 10-3)2 / [C6H5COOH] [C6H5COOH] = (5.01  10-3) 2 / (2.51 × 10-5) = 1003.98 M

As the solution requires the presence of benzoic acid in 350.0 mL of water,

We will use the equation:

Mass = (molarity) (molecular mass) (volume) Mass = (1003.98) (122.12 g/mol) (0.3500 L) Mass = 43.4 g

The mass of benzoic acid that would dissolve in 350.0 mL of water to produce a solution with a pH of 2.85 is 43.4 g.

To know more about the Ka https://brainly.com/question/16035742

#SPJ11

In a recrystallisation, why are the newly formed crystals washed with cold solvent?

Answers

In recrystallization, newly formed crystals are washed with cold solvent for several reasons:

To Remove Impurities: The cold solvent helps to remove any remaining impurities that may have been trapped in the crystal lattice during the crystallization process. This helps to increase the purity of the final product.

To Promote Crystal Growth: Washing the crystals with cold solvent helps to promote crystal growth by removing any small crystals or crystal fragments that may have formed during the initial crystallization process. This encourages the formation of larger, more well-formed crystals.

To Improve Yield: Washing the crystals with cold solvent can help to improve the yield of the recrystallization process by removing any remaining solute that may be adhering to the surface of the crystals.

To Prevent Decomposition: Some compounds may decompose if they are exposed to high temperatures or prolonged exposure to solvents. Washing the crystals with cold solvent can help to prevent this by minimizing the time that the crystals are in contact with the solvent.

Overall, washing newly formed crystals with cold solvent is an important step in the recrystallization process, as it helps to increase the purity and yield of the final product.

Learn more about solute here brainly.com/question/30665317

#SPJ4

identify the color for each of the ph ranges for bromothymol blue.

Answers

The pH ranges for bromothymol blue are: pH 6.0 or less: Yellow, pH 6.0 to 6.8: Green, pH 6.8 to 7.6: Blue, pH 7.6 to 8.4: Greenish-Blue, pH 8.4 to 9.6: Blue-Green, and pH 9.6 or higher: Blue.

Bromothymol blue is a pH indicator that changes color over a pH range of 6.0 to 7.6. At pH 6.0, the color of the solution turns yellow, indicating an acidic solution. At pH 7.6, the color of the solution turns blue, indicating a basic solution.

The pH range between 6.0 and 7.6 is considered neutral, so the color of the solution is green. A solution with a pH of exactly 7.0 will appear green when bromothymol blue is added to it. As the pH of the solution changes, the color of the solution will change as well, providing an easy way to determine the pH of a solution.

The color changes that occur with the use of bromothymol blue can be used to determine the acidity or basicity of solutions. The use of pH indicators like bromothymol blue is important in many areas of science, including medicine, biology, and environmental science.

For example, in medicine, the pH of blood is important to determine the health of the individual. Blood has a pH range of 7.35-7.45, and pH indicators like bromothymol blue can be used to determine if blood pH is within the normal range.

To know more about bromothymol blue refer here:

https://brainly.com/question/30471046#

#SPJ11

What purpose does the sulfuric acid play in the Fischer esterification reaction?What is the purpose of the Dean-Stark trap?

Answers

In the Fischer esterification reaction, sulfuric acid acts as a catalyst that facilitates the reaction between a carboxylic acid and an alcohol to form an ester. The sulfuric acid protonates the carboxylic acid, making it more reactive towards the alcohol.

The acid also facilitates the removal of water from the reaction mixture, which drives the equilibrium towards the formation of the ester. This results in a higher yield of the ester product. The Dean-Stark trap is a piece of equipment used in the Fischer esterification reaction to remove water from the reaction mixture. It is a special type of condenser that collects the water formed during the reaction and allows it to separate from the organic layer.

To know more about Fischer esterification, here

brainly.com/question/31041190

#SPJ4

Other Questions
How should viruses be classified - as living or non-living? which metal(s) can be oxidized with a sn2 solution but not with an fe2 solution? check all that apply. The circumference of a circle is 14 pi meters find its radius in meters as a tool of positioning strategy, perceptual maps illustrate two basic issues. first, they indicate products/brands that are similar in terms of relative mental position. second, they illustrate: in some trees and shrubs, competition among seedlings causes individuals to be spaced relatively evenly throughout the habitat. these plants exhibit a _______ type of dispersion pattern. solve these counting problems using the pigeonhole principle.(1) the smallest number of people in a group needed to guarantee that at least two were born in the same month is .(2) the smallest number of people in a group needed to guarantee that at least two have the same first and last initials is .(3) the smallest number of people in a group needed to guarantee that at least two have the same first initial and were born on the same day of the week is .(4) the smallest number of people in a group needed to guarantee that at least two were born on the same day of the year, assuming that nobody in the group was born on february 29 in a leap year, is does the rate constant for a reaction generally increase or decrease with an increase in reaction temperature? which factor is most sensitive to changes in temperature? complete the sentences to explain your answer. What does the picture suggest about the government in the marietta settlement? I NEED HELP ASAP CAN SOMEONE SOLVE THESE ILL GIVE BRAINIEST The table gives the number of students in a seventh-grade class enrolled in each elective. Elective Number of Students Art 2Music 4Health 3Computer Science 5If a student from this group is randomly selected, what is the probability that the student is enrolled in music?Enter a number in the box. 4 Holly y su hermano Max obtuvieron permiso para recoger mandarinas de los rboles en su jardn y luego venderlas a sus amigos y vecinos. En total, recogieron 360 mandarinas. Holly cree que deberan poner las mandarinas en bolsas de 24 mandarinas cada una y vender la bolsa por $1.50. Max piensa que deberan dividir las mandarinas igualmente entre 24 bolsas y vender cada bolsa por $1.50. De quin es el mejor plan? Por qu? Muestra todo tu trabajo a continuacin. Let $f(x) = 2x^2 + 3x - 9,$ $g(x) = 5x + 11,$ and $h(x) = -3x^2 + 1.$Find $f(x) - g(x) + h(x).$ Enter your answer as an expression. Which of the following is the best example of a hypothesis?OA. Drinks with caffeine taste much better than drinks withoutcaffeine.B. If a person increases the amount of caffeine he or she drinks, thatperson's blood pressure will go up.C. Everybody knows that caffeine makes your blood pressureincrease to a dangerous level.OD. How do you think caffeine can affect a person's blood pressure?SUBMIT Write a realistic fiction story about a boy being introduced to his newly adopted sister. 5 paragraphs A roller coaster cart of mass 205.0 kg is pushed against a launcher spring with spring constant 600.0 N/m compressing it by 7.5 m in the process. When the roller coaster is released from rest the spring pushes it along the track (assume no friction in cart bearings or axles and no rolling friction between wheels and rail). The roller coaster then encounters a series of curved inclines and declines and eventually comes to a horizontal section where it has a velocity 6.0 m/s. How far above or below (vertical displacement) the starting level is this second (flat) level? If lower include a negative sign with the magnitude. The bacteria glow in response to a molecule that regulates expression of genes involved in light-producing chemical reactions. The regulator controls production of the genes' mRNA. Therefore, the light-producing genes are undera. transcriptional control.b. translational control.c. post-translational control.d. negative control. your full-service brokerage firm charges $190 per stock trade. how much money do you receive after selling 220 shares of nokia corporation (nok), which trades at $28.12? Please help The Cold War at Home to write two letters (4-5 Sentences each) from two different viewpoints. One is from the perspective of an American describing what has been going on in their life and one is from the perspective of someone from the Communist East (like East Berlin or the Soviet Union). uppose that the distribution for total amounts spent by students vacationing for a week in florida is normally distributed with a mean of 650 and a standard deviation of 120 . suppose you take a simple random sample (srs) of 45 students from this distribution. what is the probability that a srs of 45 students will spend an average of between 600 and 700 dollars? round to five decimal places. sampling distributions of means are always group of answer choices positively skewed. approximately normally distributed. more variable than the population from which the samples were drawn. negatively skewed.