Find all unknown measures in the triangle

Find All Unknown Measures In The Triangle

Answers

Answer 1

The value of angle B is 68 degrees and the length of the segments b is 27.81 and c is 11.28.

What is Law of sines?

A triangle's sides and angles are related by the Law of Sines, a trigonometric formula. It specifically specifies that for all three sides and angles of the triangle, the ratio of the length of one side to the sine of the angle opposite that side is the same. This may be expressed as the following equation:

sin A/a = sin B/b = sin C/c

where a, b, and c are the lengths of the sides that are on each side of the triangle's three angles, A, B, and C.

For the give triangle we can use the Law of sines to find the missing values.

The law of sine is given as:

sin A/a = sin B/b = sin C/c

Given A = 90 degrees and C = 22 degrees,

sin 90 / 30 = sin 22 / c

c = 30 sin 22 / sin 90

c = 30 (0.37) / 1

c = 11.28

Now, Using the sum of triangles:

90 + 22 + B = 180

112 + b = 180

B = 68

Now,

sin A/a = sin B/b

Sin 90 / 30 = sin (68) / b

b = 30 sin (68)  sin 90

b = 27.81

Hence, the value of angle B is 68 degrees and the length of the segments b is 27.81 and c is 11.28.

Learn more about law of sines here:

https://brainly.com/question/17289163

#SPJ1


Related Questions

Statistics QUESTION can someone help

Answers

Answer:

Class Midpoint

Step-by-step explanation:

36.5 is the the class midpoint for ages 35-38. To obtain the class midpoint, you find the averages of the upper and lower class limit for a specific class. In this case, (35+38)/2 = 36.5

five positive consecutive integers starting with a have an arithmetic mean of b. what is the arithmetic mean of 5 consecutive integers that start with b? (a) a 3 (b) a 4 (c) a 5 (d) a 6 (e) a 7

Answers

the arithmetic mean of the five consecutive integers starting with "b" is (a+4), which is option (c).

Let's call the five consecutive integers starting with "a" as a, a+1, a+2, a+3, and a+4.

The arithmetic mean of these five integers can be calculated as (a + (a+1) + (a+2) + (a+3) + (a+4))/5 = b. Simplifying this expression, we get:

5a + 10 = 5b +

a + 2 = b

So, the arithmetic mean of the five consecutive integers starting with "b" would be:

(b + (b+1) + (b+2) + (b+3) + (b+4))/5

= (5b + 10)/5 (since the integers are consecutive, we can express them in terms of b)

= b + 2

 

Substituting b = a + 2 (from the above equation), we get:

b + 2 = a + 4

Therefore, the arithmetic mean of the five consecutive integers starting with "b" is (a+4), which is option (c).

In other words, if the arithmetic mean of five consecutive integers starting with "a" is "b", then the arithmetic mean of five consecutive integers starting with "b" is two more than the last integer of the five consecutive integers starting with "a".

To know more about arithmetic mean   click here:

brainly.com/question/24995114

#SPJ4

PLEASE HELP ME ASNWER THIS DISCUSSION QUESTIONS!! 50 POINTS!!!!

Answers

Step-by-step explanation:

The statement does not make sense. A triangle cannot have two right angles as the sum of the three angles in a triangle is always 180 degrees. Two right angles would add up to 180 degrees, leaving no room for the third angle.

To determine the number of plants needed, first find the perimeter of the square flower bed by multiplying the length of one side by 4 (since there are four sides in a square). 8 x 4 = 32 feet. Then convert the spacing of 8 inches to feet by dividing by 12 (since there are 12 inches in a foot). 8 / 12 = 0.67 feet. Finally, divide the perimeter of the flower bed by the spacing of the plants to get the total number of plants needed. 32 / 0.67 = 47.76. Round up to the nearest whole number to get the final answer of 48 plants.

A square is a type of rectangle because it has four right angles and opposite sides that are parallel and congruent. A square is a type of rhombus because it has four sides of equal length. A square is a type of parallelogram because it has two pairs of opposite parallel sides. A square is a type of quadrilateral because it has four sides. A square is a type of polygon because it is a closed shape with three or more sides.

A veterinarian needs a mixture that contains 10% of a certain medication to treat an injured bird. How many milliliters of a 14% solution should be mixed with 8 mL of a 7% solution to obtain a solution that is 10% medication?

Answers

We need to add 6 mL of the 14% solution to the 8 mL of the 7% solution to obtain a 10% medication solution.

What is an equation?

An equation is a mathematical statement that indicates that two expressions are equal. It consists of two sides separated by an equal sign (=). The expressions on both sides of the equal sign can contain numbers, variables, and mathematical operations such as addition, subtraction, multiplication, and division. Equations are used to describe relationships between different variables, to solve problems, and to make predictions.

Let's call the number of milliliters of the 14% solution we need to add "x".

First, let's figure out how much medication is in the 8 mL of the 7% solution. Since the solution is 7%, we know that 7% of the solution is medication. We can convert that to milliliters by multiplying by the total volume of the solution:

0.07 x 8 mL = 0.56 mL of medication in the 7% solution

Next, let's figure out how much medication we want in the final solution. We want a 10% solution, so we want 10% of the total volume to be medication. We can write that as:

0.10 (x + 8 mL) = 0.1x + 0.8 mL

Now we can set up an equation based on the amount of medication in the 14% solution we add and the amount of medication in the final solution:

0.14x + 0.56 mL = 0.1x + 0.8 mL

Simplifying the equation, we get:

0.04x = 0.24 mL

Dividing both sides by 0.04, we get:

x = 6 mL

To know more about variables, visit:

https://brainly.com/question/17344045

#SPJ1

Somebody can help me with this?

Answers

We can conclude after answering the presented question that x = $2.00 equation  (price of a queso pizza rebanada) y = $1.25 (price of a pie and championes pizza rebanada)

What is equation?

An equation in mathematics is a statement that states the equality of two expressions. An equation is made up of two sides that are separated by an algebraic equation (=). For example, the argument "2x + 3 = 9" asserts that the phrase "2x + 3" equals the number "9". The purpose of equation solving is to determine the value or readings of the variable(s) that will allow the equation to be true. Equations can be simple or complicated, regular or nonlinear, and include one or more elements. In the calculation "x2 + 2x - 3 = 0," for example, the variable x is raised to the second power. Lines are utilised in many different areas of mathematics, such as algebra, calculus, and geometry.

The two variables are the price of a rebanada de pizza de queso and the price of a rebanada de pizza de pia y championes.

It is x the price of a rebanada de pizza de queso and y the price of a rebanada de pizza de pia y championes.

We have the following equation system:

3x + 4y + 12.50 = 12.50 (costo de las 7 rebanadas de pizza) (costo de las 7 rebanadas de pizza)

3x + 2y = 8.50 (costo de las 5 rebanadas de pizza que no incluyen el tool) (costo de las 5 rebanadas de pizza que no incluyen el tool)

When we solve the equation system, we get:

x = $2.00 (price of a queso pizza rebanada) y = $1.25 (price of a pie and championes pizza rebanada)

To know more about equation visit:

https://brainly.com/question/649785

#SPJ1

The table and corresponding frequency polygon show information about the heights of members of a swimming club. What fraction of members were between 150 and 160 cm tall? Frequency < Back to task น 151 10- 5- 0+ 120 130 140 150 Height (cm) Search 160 Watch video 170 Height (cm) Midpoint 120< x≤130 125 130< x≤140 135 140< x≤150 145 150 160 155 160 < x≤160 165 Answer >​

Answers

To find the fraction of members between 150 and 160 cm tall, we need to look at the portion of the frequency polygon that corresponds to this height range.

First, we can calculate the total frequency of members between 150 and 160 cm by adding up the frequencies for the "150 < x ≤ 160" class and the "160 < x ≤ 170" class, which gives:

Total frequency = 5 + 0 = 5

Next, we can calculate the total frequency of all members by adding up all the frequencies, which gives:

Total frequency = 10 + 5 + 0 + 1 = 16

Therefore, the fraction of members between 150 and 160 cm tall is:

Fraction = Total frequency between 150 and 160 cm / Total frequency of all members

= 5 / 16

= 0.3125

So, approximately 31.25% of the members were between 150 and 160 cm tall.

Final answer:

The fraction of members between 150-160cm is found by dividing the frequency of the 150-160cm height segment by the total number of club members.

Explanation:

In order to find out the fraction of members who were between 150 and 160 cm tall, we first need to focus on the corresponding frequency value for the height segment - 150< x ≤160 in the table. This value gives us the count of people who stand within these heights. Simultaneously, we need the total number of club members, which can be derived by adding all the frequency values together.

Once we have these two values, the fraction of members is calculated by dividing the frequency of the 150-160 height segment by the total frequency (number of club members).

Please note that this fraction will be a 'raw' one, and you may need to simplify it to its smallest terms to make it more understandable.

Learn more about Fraction Calculation here:

https://brainly.com/question/33261284

#SPJ3

The figure is a model of water tank made up of a cylinder and a hemisphere. height 8 m and diameter 6 m .What is the total cost of fulfill the water in the given water tank at the rate of 25 paisa per liter and coloring the tank at the rate Rs.50 per square meter?)​

Answers

Answer:

I don't know what I am so sorry of computer science ranking it was my father is the first t e and video editing software for product of a number of times I am using simple terms of.

Step-by-step explanation:

NBG the main function performance multiplication ❌❌✖️of computer is used in planes and engineer salary is Atlantic chatter in short note of computer is the first man made calculating pH balance of computer is referred to earn foreign currency of computer is the first.bcdujvfyhcdybcMake it shortAn expression equivalent to 5(Z+2)5(Z+2)Make it shortAn expression equivalent to 5(Z+2)5(Z+2)Make it shortAn expression equivalent to 5(Z+2)5(Z+2)Make it short5(Z+2)Make it shortAn expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)Make it short5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)5(Z+2)An expression equivalent to 5(Z+2)5(Z+2)5(Z+2)An expression equivalent to 5(Z+2)An expression equivalent to 5(Z+2)cfgjmbvdzbcs of computer your favourite game of thrones on water into direct express debit card ♦️ of the products produced by

Three animals left 24 tracks in the mud. Half the tracks were made by either a dog or a fox. A deer made 4 tracks fewer than the dog and 4 tracks more than the fox. How many tracks did each animal leave?

Answers

The deer made 8 tracks, the fox made 4 tracks, and the dog made 12 tracks.

How to find the number of tracks each animal made

Let's start by defining variables for the number of tracks made by each animal.

Let:

d be the number of tracks made by the deer,

f be the number of tracks made by the fox, and

x be the number of tracks made by the dog

From the problem, we know that:

d + f + x = 24 ......(1)

We also know that:

d = x - 4   .......(2)

d = f + 4   ..........(3)

from this we can rightfully assume that the dog made half the tracks hence

x = 12 tracks

d = 12 - 4 = 8

solving for f

d = f + 4

f = d - 4 = 8 - 4 = 4

we can therefore say that the dog made 12 tracks, the deer made 8 tracks while the fox made 4 tracks

Learn more about word problems at:

https://brainly.com/question/13818690

#SPJ1

©2023 Edmentum All rights reserved, (-2,2) (3,-1) (4,2) (4, -2) the coordinates of D' if polygon ABCD rotates 90° counterclockwise to create A'B'C'D' the coordinates of C" if polygon ABCD rotates 90° clockwise to create A"B"C"D" the coordinates of A" if X polygon ABCD rotates 180° clockwise to create ABCD the coordinates of B" if X polygon ABCD rotates 270° counterclockwise to create A"B"C"D" last two i got wrong info from here....showing in pictures ​

Answers

The coordinates after each rotation are given as follows:

D' after a 90º counterclockwise rotation: (-2,2).C' after a 90º clockwise rotation: (3,-1).B' after a 270º clockwise rotation: (4,2).A' after a 180º rotation: (4,-2).

What are the rotation rules?

The function rule for the five more known rotation rules are given as follows:

90° clockwise rotation: (x,y) -> (y,-x)90° counterclockwise rotation: (x,y) -> (-y,x)180° clockwise and counterclockwise rotation: (x, y) -> (-x,-y)270° clockwise rotation: (x,y) -> (-y,x)270° counterclockwise rotation: (x,y) -> (y,-x).

More can be learned about rotation rules at brainly.com/question/17042921

#SPJ1

Data from an important new study showed that out of 100,000 people a total r? 8,700 reported that they could wiggle their ears and their nose at the same time. What would you say is the probability of a person having this skill?

Answers

The probability of a person having this skill is estimated to be 87/1000 or 0.087.

What does a probability means?

Probability is a branch of mathematics that deals with determining the likelihood of an event occurring. The probability of an event occurring is equal to the number of favorable events divided by the total number of events. Probability has a value between 0 and 1, with 0 denoting uncertainty and 1 denoting certainty.

Based on the given conditions, we will formulate for 8,700/100,000 to get the probability of a person having this skill to wiggle their ears and their nose at the same time.

Let is cross out the common factor. Now we will have [tex]87/1000[/tex]. Therefore, the probability of a person having this skill is estimated to be [tex]87/1000[/tex] or [tex]0.087[/tex].

Read more about probability

brainly.com/question/24756209

#SPJ1

2x³y, 8x²y², 17xy³

Need help solving

Answers

The cοndensed οr cοmbined fοrm is thus: 2x³y + 8x²y2 + 17xy³ = (2x²)xy + (8x)xy + (17xy²) = (2x2)xy + (8x)xy + (17xy²).

what is expressiοns ?

An expressiοn in mathematics is a set οf digits, symbοls, and οperatοrs that depicts a quantity οr a relatiοnship between twο quantities. Expressiοns can be straightfοrward, using a single number οr variable, οr cοmplicated, including a variety οf phrases and prοcedures. Expressiοns include things like "3 + 5" and "2x - 4", fοr instance.

The first phrase is straightfοrward and represents the additiοn οf twο numbers, whereas the secοnd expressiοn is mοre intricate and includes a variable, multiplicatiοn, and subtractiοn.

As the expressiοns yοu prοvided lack an equal sign and hence are nοt equatiοns, it is unclear what yοu mean when yοu say that yοu are "sοlving" the prοblem.

Hοwever if yοu wish tο cοmbine οr simplify these expressiοns, yοu can utilize the factοring apprοach.

We can factοr it οut because xy is a cοmmοn factοr thrοughοut the expressiοns:

8x²y² = (8x)xy, while 17xy³ = (17)xy²

We can nοw see that each expressiοn's remaining factοrs are (2x²), (8x), and (17), respectively.

Since these factοrs dο nοt share any cοmmοn factοrs, further simplificatiοn is nοt pοssible. In terms οf the cοmmοn factοr xy.

The cοndensed οr cοmbined fοrm is thus: 2x³y + 8x²y² + 17xy³ = (2x²)xy + (8x)xy + (17xy2) = (2x²)xy + (8x)xy + (17xy2).

To know more about expressions visit :-

brainly.com/question/14083225

#SPJ1

Complete Question

Write this expression  2x³y, 8x²y², 17xy³  in combined form

Triangle is reflected across the y-axis and then dilated by a factor of 1/2 centered at the origin. Which statement correctly describes the resulting image, triangle ? Image of right triangle ABC in a graph with vertices A (minus 4, minus 2), B (4, minus 2), and C (4, 4) A. Both the reflection and dilation preserve the side lengths and angles of triangle . B. Neither the reflection nor the dilation preserves the side lengths and angles of triangle . C. The reflection preserves the side lengths and angles of triangle . The dilation preserves angles but not side lengths. D. The dilation preserves the side lengths and angles of triangle . The reflection does not preserve side lengths and angles.

Answers

The dilatiοn preserves the side lengths and angles οf triangle. The reflectiοn dοes nοt preserve side lengths and angles.

What Is dilatiοn?

A geοmetrical adjustment that changes an οbject's size is dilatiοn. In mοre detail, dilatiοn entails extending οr cοntracting an item by increasing each pοint's distance frοm a fixed center pοint by a predetermined amοunt, knοwn as the scale factοr.

Let's start by applying the reflectiοn alοng the y-axis. All οf the vertices will have their x-cοοrdinates negated as a result, but their y-cοοrdinates will remain unchanged.

After reflectiοn, pοint A (-4, -2) will appear as A'. (4, -2). In the same way, B (-4, -2) will becοme B' (-4, -2), and C (4, -4) will change intο C'. (-4, 4).

Applying a dilatatiοn by a factοr οf 1/2 with the οrigin as the center will cοme next. This will result in a halving οf all distances frοm the οrigin.

After dilatiοn, pοint A' (4, -2)'s image will be A'' (2, -1), B' (-4, -2) will change tο B'' (-2, -1), and C' (-4, -4) will becοme C''. (-2, 2).

We must cοmpare the distances between the triangle's vertices and the angles' measurements in the οriginal triangle and the image tο see if the side lengths and angles are preserved.

The distance between pοints A and B is 8, but the distance between  A'' and B'' is 4, as we can see. Similarly, the separatiοn between B and C is 6, whereas between B'' and C'' is 3. The dilatiοn dοes nοt preserve the triangle's side lengths as a result.

Nevertheless, it is clear that the angles between the sides were kept because the transfοrmatiοn invοlved bοth a reflectiοn and a dilatatiοn, bοth οf which prοtect angles.

Therefοre the cοrrect οptiοn is D. The dilatiοn preserves the side lengths and angles οf the triangle, while the reflectiοn dοes nοt preserve side lengths and angles.

To learn more about dilation from the given link

https://brainly.com/question/29811168

#SPJ1

i need help with ......

A fair coin is tossed 27 times. What is the probability that at most 24 heads occur?
a) 0.000022
b) 0.000003
c) 0.000025
d) 0.999997
e) 0.999975

Answers

Using binomial probability and cumulative distribution function, the probability of having 24 heads is 0.000022

What is the probability that at most 24 heads occur?

This problem can be solved using the binomial distribution. Let X be the number of heads that occur in 27 tosses of the fair coin. Then X follows a binomial distribution with parameters n = 27 and p = 0.5.

We want to find the probability that at most 24 heads occur, which is equivalent to finding the probability that X is less than or equal to 24. We can use the cumulative distribution function (CDF) of the binomial distribution to calculate this probability:

[tex]P(X \leq 24) = \sum_{k=0}^{24} {27 \choose k} (0.5)^{27}[/tex]

We can use a calculator or software to evaluate this sum, or we can use the complement rule to find the probability of the complement event (i.e., 25 or more heads) and subtract from 1:

[tex]P(X \leq 24) = 1 - P(X \geq 25) = 1 - \sum_{k=25}^{27} {27 \choose k} (0.5)^{27}[/tex]

Using a calculator or software, we find that the probability is approximately 0.000022, which corresponds to answer choice (a).

Therefore, the answer is (a) 0.000022.

Learn more on binomial probability here;

https://brainly.com/question/15246027

#SPJ1

What is the local extrema/ absolute of the polynomial 10x^5 + 22x^4 + 20x^3 -0x^2 + 6?

Answers

o find the local extrema of the polynomial, we first take the derivative of the polynomial and set it equal to zero:

f(x) = 10x^5 + 22x^4 + 20x^3 - 0x^2 + 6

f'(x) = 50x^4 + 88x^3 + 60x^2

Setting f'(x) = 0, we can factor out a 2x^2 from the expression to get:

f'(x) = 2x^2(25x^2 + 44x + 30) = 0

Using the quadratic formula to solve for x, we get:

x = (-44 ± sqrt(44^2 - 4(25)(30))) / (2(25))

x = (-44 ± sqrt(784)) / 50

x = (-44 ± 28) / 50

x = -0.32 or -0.56

This figure is made up of a rectangle and parallelogram. What is the area of this figure? Enter your answer in the box. Do not round any side lengths. units² Coordinate plane with axes labeled x and y. A closed figure is formed by a parallelogram and rectangle. The vertices are negative 10 comma 2, negative 7 comma 3, negative 1 comma 3, 1 comma negative 3, negative 2 comma negative 4, and negative 4 comma 2.

Answers

Answer:

To find the area of the figure, we need to find the area of the rectangle and the area of the parallelogram, and then add them together.

First, we need to identify which sides of the figure belong to the rectangle and which sides belong to the parallelogram. Looking at the coordinates of the vertices, we can see that the vertices (-10,2), (-7,3), (-1,3), and (1,-3) form a parallelogram, while the vertices (-7,3), (-2,-4), and (-4,2) form a rectangle.

To find the area of the parallelogram, we can use the formula:

Area = base × height

where the base is the length of one of the sides of the parallelogram, and the height is the perpendicular distance between the base and the opposite side. We can choose any side of the parallelogram as the base, but it is usually easiest to choose the side that is perpendicular to the x-axis, since its length is simply the difference between the x-coordinates of the two endpoints.

Using the coordinates (-10,2) and (-7,3) as the endpoints of the base, we find that the length of the base is:

|-7 - (-10)| = 3

To find the height, we need to find the perpendicular distance between the base and the opposite side of the parallelogram. We can do this by drawing a vertical line from one endpoint of the base to the opposite side, and then measuring the length of this line. We can see that the line from (-10,2) to (-1,3) is perpendicular to the base, so its length is the height of the parallelogram:

|-1 - (-10)| = 9

Therefore, the area of the parallelogram is:

Area = base × height = 3 × 9 = 27

To find the area of the rectangle, we simply need to multiply the length and width of the rectangle. We can see that the length is the distance between (-7,3) and (-4,2):

|-4 - (-7)| = 3

and the width is the distance between (-7,3) and (-2,-4):

|(-2) - (-7)| = 5

Therefore, the area of the rectangle is:

Area = length × width = 3 × 5 = 15

Finally, we can find the area of the whole figure by adding the area of the rectangle and the area of the parallelogram:

Area of figure = Area of rectangle + Area of parallelogram

= 15 + 27

= 42

Therefore, the area of the figure is 42 square units.

11) Cans of tuna cost $1.69 for 5 1/2
oz. At that rate, how much would 22 oz of tuna cost?

Answers

Answer: 4 cans of tuna

Step-by-step explanation:

5 1/2 x 4 = 22

Answer:

To find which tuna is a better deal, divide the cost by the number of ounces of tuna you are getting to get the cost per ounce.

$0.90/5  = $0.18 per ounce

$2.40/12 = $0.20 per ounce

Since the 5-ounce can of tuna has a cheaper unit rate price, meaning you are getting a better value, makes this the best option. I hope this was helpful and have a great day! :)

Step-by-step explanation:

Consider the line y = 5x - 3 Find the equation of the line that is parallel to this line and passes through the point (- 8, 2) Find the equation of the line that is perpendicular to this line and passes through the point (- 8, 2) Note that the ALEKS graphing calculator may be helpful in checking your answer

Answers

Answer:

First, we know the slopes of perpendicular lines are negative reciprocals of each other.  So, the negative reciprocal of -1 is 1.  This is the slope of our new line.  From here, we can use this new slope along with our given point to find the y-intercept (b) of our new equation:

y = mx + b

-4 = 1(-2) + b

-4 = -2 + b

-2 = b

The y-intercept of our new line is (0,-2).  Now, we can write our equation of the new line:

y = x - 2

Find the equation of the line that has a slope of -8 and a y-intercept of 2.

Answers

Answer: y= -8x +2

Step-by-step explanation:

y = mx + b

M is the slope

B is the y intercept

Lin’s father is paying for a 23.89$ meal. He has a 18% off coupon for the meal. After the discount, a 7% sales tax is applied. What does Lin’s father pay for the meal?
Help ASAP

Answers

Answer:

what you would do is 23.89x18%=4.3 so you do 23.89-4.3=19.59 then you do 19.59x7%=1.37 then you do 19.59+1.37=20.96 so 20.96 is your answer.

Step-by-step explanation:

Answer: To calculate the final price that Lin's father pays for the meal, we need to apply the discount first and then add the sales tax.

Discount = 18% of $23.89

= 0.18 x $23.89

= $4.30

The discounted price of the meal is therefore:

$23.89 - $4.30 = $19.59

Next, we need to add the sales tax of 7%:

Sales Tax = 7% of $19.59

= 0.07 x $19.59

= $1.37

Therefore, the final price that Lin's father pays for the meal is:

$19.59 + $1.37 = $20.96

So, Lin's father pays $20.96 for the meal after applying the discount and sales tax.

Step-by-step explanation:

100pts for who ever answers question(all 3)

Answers

Answer:a=9  b=27.5  c=41.25

Step-by-step explanation:

the internet

the value of a home appreciates about 2.1% annually how much will a $150,000 home be worth in 15 years?

Answers

Answer: 625.528.618,26

Step-by-step explanation: The answer will be in the pictures

The highway fuel economy of a 2016 lexus Rx 350 fwd 6-cylinder 3.5l automatic 5-speed using premium fuel is a normally distributed random variable with a mean of u=20.50mpg and a standard deviation of a=1.25mpg
Answer BOTH A and B URGENT

Answers

The standard error of the mean is 0.3125 mpg.

The sample mean will fall within the interval (19.9859, 20.0141)

What is a decimal?

A decimal is a number system that uses the base ten, which means it uses ten digits (0,1,2,3,4,5,6,7,8,9) to represent all numbers. Each digit in a decimal number represents a power of ten. For example, in the number 123.45, the digit "1" represents 1 x 10², the digit "2" represents 2 x 10¹, the digit "3" represents 3 x 10⁰, the digit "4" represents 4 x 10⁻¹, and the digit "5" represents 5 x 10⁻².

(a) The standard error of the mean (SE) can be calculated using the formula:

SE = s / √(n)

where s is the sample standard deviation, n is the sample size, and √ represents the square root. In this case, n = 16 and s = a = 1.25 mpg. Substituting these values, we get:

SE = 1.25 / √(16)

  = 0.3125

Rounding to 4 decimal places, the standard error of the mean is 0.3125 mpg.

(b) To find the interval within which we would expect the sample mean to fall with 90% probability, we need to use a confidence interval. Since the sample size is large enough (n >= 30) and the population standard deviation is known, we can use the z-distribution to construct a confidence interval. The z-value for a 90% confidence level is 1.645 (found using a standard normal distribution table or calculator).

The 90% confidence interval for the sample mean can be calculated using the formula:

CI = Xbar ± z*(SE)

where Xbar is the sample mean, z is the z-value for the desired confidence level, and SE is the standard error of the mean.

Substituting the given values, we get:

CI = 20.5 ± 1.645*(0.3125)

  = 20.5 ± 0.5141

Rounding to 4 decimal places, the 90% confidence interval for the sample mean is:

CI = (19.9859, 20.0141)

Therefore, we would expect the sample mean to fall within the interval (19.9859, 20.0141)

To know more about decimals, visit:

https://brainly.com/question/30958821

#SPJ1

Question 5: Let U= (a, b, c, d, e, f, g, h) A=(a, b, c, e, h} B= {c, e, g), and C = {a, c, d, g, e} Find each set. a) B' b) AN B' c) (A/B) d) BU (CNA)​

Answers

a) B', complement of B =  {a, b, d, f, h}

b) AN B', A intersection B' =  {b, h}

c) (A/B), or A - B = {a, b, h}

d) BU (CNA)​, B union (C intersection A) = {a, b, c, d, e, g, h}

Set problem

a) The complement of B, denoted B', consists of all elements in U that are not in B. Thus, we have:

B' = {a, b, d, f, h}

b) A intersection B' consists of all elements that are in A but not in B. From the given sets, we have:

B' = {a, b, d, f, h}

A = {a, b, c, e, h}

Thus, A intersection B' = {b, h}

c) A/B, also denoted A - B, consists of all elements in A that are not in B. From the given sets, we have:

A = {a, b, c, e, h}

B = {c, e, g}

Thus, A/B = {a, b, h}

d) CNA is the union of C and A. From the given sets, we have:

A = {a, b, c, e, h}

C = {a, c, d, g, e}

Thus, A union C = {a, b, c, d, e, g, h}.

Finally, BU(A union C) is the union of B with A union C. From the given sets, we have:

B = {c, e, g}

A union C = {a, b, c, d, e, g, h}

Thus, BU(A union C) = {a, b, c, d, e, g, h}

More on set of elements can be found here: https://brainly.com/question/28647493

#SPJ1

A scatter plot is given below. Determine which of the following are appropriate trend lines for the scatter plot


n
ty

Answers

The appropriate trend lines for the scatter plot include the following: B. scatter plot B.

What are the characteristics of a line of best fit?

In Mathematics and Statistics, there are different characteristics that are used for determining the line of best fit on a scatter plot and these include the following:

The line should be very close to the data points as much as possible.The number of data points that are above the line should be equal to the number of data points that are below the line.

By critically observing the scatter plot using the aforementioned characteristics, we can reasonably infer and logically deduce that scatter plot B represent the line of best fit (trend line) because it is in a linear pattern, with equal number of data points on both sides of the line.

Read more on line of best fit here: brainly.com/question/12284501

#SPJ1

please help asap I need the work for this too

Answers

Answer:

Step-by-step explanation:

cos

cos^-1(26/52)=?

?=30

Drag the tiles to the correct boxes to complete the pairs. Match the one-to-one functions with their inverse functions.

Answers

Using calculus, we can find the functions of the inverse functions as follows:

a. f(x) = x/5.

b. f(x) = ∛ 2x

c. f(x) = x - 10

d. f(x) = 2x/3 - 17

What do you mean by calculus?

One of the most crucial areas of mathematics that addresses ongoing change is known as calculus. Calculus is primarily built on the two ideas of derivatives and integrals. A function's integral measures the area under its curve, whereas a function's derivative measures its rate of change.

Whereas the integral adds together a function's discrete values over a range of values, the derivative explains the function at a particular point.

Here in the question,

The inverse of the functions is:

f(x) = x/5.

f(x) = ∛ 2x

f(x) = x - 10

f(x) = 2x/3 - 17

To know more about calculus, visit:

https://brainly.com/question/30903977

#SPJ1

Find the measure of X

Answers

Answer:

≈25,99

Step-by-step explanation:

Use trigonometry:

sin (38∘) = 16 / x

x = 16 / sin (38∘) ≈ 25,99

Justin wants to join a health club. He is considering Let′s Get Moving, which charges a one-time initiation fee of $210 plus a $35 monthly membership fee. He is also considering Fitness for Life, which charges $50 per month with no initiation fee.

Answers

After answering the prοvided questiοn, we can state that Befοre making equatiοn a decisiοn, it is alsο impοrtant tο cοnsider οther factοrs such as the lοcatiοn, facilities, and services prοvided by each health club.

What is equatiοn?  

In mathematics, an equatiοn is a prοclamatiοn stating the justice οr twο phrases. An equatiοn is made up οf twο sides that are separated by an algebraic equatiοn (=). Fοr example, the argument "2x + 3 = 9" asserts that the statement "2x + 3" equals the value "9". The gοal οf equatiοn sοlving is tο determine the value οr values οf the variable in the mοdel) that will allοw the equatiοn tο be true. Equatiοns can be simple οr cοmplex, regular οr nοnlinear, and include οne οr mοre factοrs. In the equatiοn fοr "x² + 2x - 3 = 0," example, the variable x is raised tο the secοnd pοwer. Lines are used in many mathematical areas, including algebra, mathematics, οr geοmetry.

We can create a table tο calculate the tοtal cοsts οver different time periοds tο cοmpare the cοsts οf jοining Let's Get Mοving versus Fitness fοr Life:

Membership Length Let's Get Mοving Fitness fοr Life

1 mοnth                                    $245             $50

6 mοnths                                 $455              $300

1 year                                       $630              $600

2 years                                    $1,290            $1,200

Accοrding tο this table, if Justin plans tο jοin fοr a shοrt periοd οf time, such as a mοnth οr six mοnths, Fitness fοr Life is a better οptiοn because it has a lοwer tοtal cοst. If Justin intends tο jοin fοr a lοnger periοd οf time, such as a year οr twο years, Let's Get Mοving may be a better οptiοn because the οne-time initiatiοn fee is spread οut οver time.

Befοre making a decisiοn, it is alsο impοrtant tο cοnsider οther factοrs such as the lοcatiοn, facilities, and services prοvided by each health club.

To know more about equation visit:

brainly.com/question/649785

#SPJ1

Manisha buys a television set with 13% VAT after allowing her 15% discount for 9605. what was the actual price of television set and amount of VAT?​

Answers

The actual price of the television set is 9225.6 and the amount of VAT is 1061.35

What is discount?

Discount is a percentage deducted from the the actual selling price of a product. The discount given is 15% of the selling price 9605.

Therefore, discount = 15/100 × 9605

= 1440.75

Therefore the price of the television= 9605 - 1440.75

= 8164.25

After the discount the, VAT of 13 % is added

= 8164.25 × 13/100

= 1061.35

The new price of the television set = 8164.25 + 1061.35

= 9225.6

therefore the actual price of the television set is 9225.6 and the VAT is 1061.35

learn more about discount from

https://brainly.com/question/1548141

#SPJ1

can someone help me out, thanks

Answers

Answer:

[tex]16 {cm}^{3} [/tex]

Step-by-step explanation:

First, we can find the volume of tank A:

[tex]v(a) = 20 \times 24 \times 20 = 9600[/tex]

Now, let's write an equation for tank B's volume:

[tex]9600 = 600 \times h(b)[/tex]

[tex]h(b) = \frac{9600}{600} = 16[/tex]

Other Questions
the passage data regarding the thermal stability and enzyme activity of mkr681h is most consistent with what conclusion regarding the role of arg681 in cct? QuestionThe colours of red litmus paper in acidic, neutral, and basic solutions are:Ared, orange and blue respectivelyBblue, violet and red respectivelyCred, colourless and blue respectivelyDred, red and blue respectivelyHard 4.5 Draw a diagram representing the scenario and find the requested value. A man is standing 270 feet from the base of a statue. If he man looks up at an angle of 34 degrees to see the top of the statue, how tall is the statuePlease round to the nearest whole foot. chris rents a booth at a flea market at a cost of $75 for one day. at the flea market chris sells picture frames each of which costs him $6.00. if chris sells each picture frame for $13, how many picture frames must he sell to make a profit of at least $200 for that day? which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles. A frog is riding on the top of a cylindrical piece of wood floating in still water. Half of the wood, with a diameter of 4 cm and length 20 cm, is immersed in water. The density of water is 1 gm/cc. a) What is the mass of the wood along with the frog? b) After the frog slowly goes into the water only one third of the wood remains immersed in water. Calculate the mass of the frog. c) Calculate x, the distance between the water level and the center of the circular end of the wooden piece. d) Briefly describe the motion of the wood after the instance the frog moves into the water. Give a rough sketch of x as a function of time. an unknown gas effuses through an opening at a rate 3.16 time slower than nenon gas. estimate the mola mass of this unknown gas. Tom is making birdhouses to sell at a farmers market each birdhouse requires 4.5 feet of wood planks to build and he sells them for $19.75 each if he has no more than 80 feet of planks to make birdhouses how much money can Tom earn at the farmers market. Show your work I know the answer but not the work. Simplify to create an equivalent expression2(-2-4p) + 2(-2p-1) How high would a 8 kg mass need to be lifted to have a potential energy of 400 J? Cmo presentars el escenario y los personajes de tu fbula? a car loan is taken for $23,000 to be paid back in 6 years, with monthly payments of $564. what nominal annual interest rate is being charged in this loan? what is the solubility of strontium sulfate, srso4, in 0.36 m sodium sulfate, na2so4 solution? What must be the mass of a chunck of aluminum that takes 8550 J of engery ti be heated from 50 C to 72 C the layer of cells that selectively allows water and other materials through to the vascular tissue is known as the