in a certain town, 40% of the eligible voters prefer candidate a, 10% prefer candidate b, and the remaining 50% have no preference. you randomly sample 10 eligible voters. what is the probability that 4 will prefer candidate a, 1 will prefer candidate b, and the remaining 5 will have no preference?

Answers

Answer 1

The probability that 4 prefers A, 1 prefer B and 5 will have no preference = 0.0024

Here, in a certain town, 40% of the eligible voters prefer candidate a,

⇒ P(A) = 40%

⇒ P(A) = 0.4

10% prefer candidate b,

⇒ P(B) = 10%

⇒ P(B) = 0.1

and the remaining 50% have no preference.

⇒ P(T) = 50%

⇒ P(T) = 0.5

Also, the sample size = 10

So, the probability that 4 prefers A, 1 prefer B and 5 will have no preference would be:

P = ⁵C₄ (0.4)⁴ × ⁶C₁ (0.1) × (0.5)⁵

P = 0.0024

Therefore, the required probability is 0.0024

Learn more about the probability here:

https://brainly.com/question/15124899

#SPJ4


Related Questions

ratio of triangle 9:8:7, permimeter is 144 , find the measure of each side of the triangle

Answers

Step-by-step explanation:

There are (9+8+7)  = 24 parts  that add up to 144

each part is then 144/24 = 6

then each side is    9 parts =  9*6 = 54

                8 parts = 8 * 6 = 48

       7 parts    7 * 6 = 42

In the first week of​ July, a record 1,060 people went to the local swimming pool. In the second​ week, 110 fewer people went to the pool than in the first week. In the third​ week,130 more people went to the pool than in the second week. In the fourth​ week, 232 fewer people went to the pool than in the third week. What is the percent decrease in the number of people who went to the pool over these four​ weeks?

Answers

The percent decrease in the number of people who went to the local swimming pool over four weeks, starting with a record high of 1,060 people in the first week, was 20%.

To find the percent decrease in the number of people who went to the pool over the four weeks, we need to first find the total number of people who went to the pool over the four weeks and then calculate the percentage decrease from the first week to the fourth week.

Number of people in the first week = 1,060

Number of people in the second week = 1,060 - 110 = 950

Number of people in the third week = 950 + 130 = 1,080

Number of people in the fourth week = 1,080 - 232 = 848

Total number of people over the four weeks = 1,060 + 950 + 1,080 + 848 = 3,938

Percentage decrease in the number of people who went to the pool over the four weeks = ((1,060 - 848)/1,060) * 100% = 20%

Therefore, the percent decrease in the number of people who went to the pool over the four weeks is 20%.

To learn more about rectangle please click on below link        

https://brainly.com/question/29085356

#SPJ1

a sprinkler distributes water in a circular pattern, supplying water to a depth of feet per hour at a distance of r feet from the sprinkler. a. what is the total amount of water supplied per hour inside of a circle of radius 14? per hour b. what is the total amount of water that goes throught the sprinkler per hour? per hour calculate the total amount of water supplied per hour inside a circle of radius , then let .

Answers

The total amount of water supplied per hour inside a circle of radius 14 is approximately79.90 ft^3 per hour, and the total amount of water that goes through the sprinkler per hour is approximately  2π ft^3 per hour. As R approaches infinity, the total amount of water supplied per hour approaches  2 ft^3 per hour.

To find the total amount of water supplied per hour inside of a circle of radius 14, we need to integrate the function e^(-r) over the region of the circle total amount of water = ∫∫ e^(-r) dA

where the integration is over the circular region of radius 14, and dA is the differential area element.

Using polar coordinates, we can write dA = r dr dθ, and the limits of integration are 0 ≤ r ≤ 14 and 0 ≤ θ ≤ 2π. Substituting these values, we get:

total amount of water = ∫(0 to 2π) ∫(0 to 14) e^(-r) r dr dθ

Integrating with respect to r first, we get:

total amount of water = ∫(0 to 2π) [-e^(-r)](0 to 14) dθ

total amount of water = ∫(0 to 2π) (1 - e^(-14)) dθ

total amount of water = (1 - e^(-14)) ∫(0 to 2π) dθ

total amount of water = 2π(1 - e^(-14))

Thus, the total amount of water supplied per hour inside of a circle of radius 14 is approximately 79.90 ft^3 per hour.

To find the total amount of water that goes through the sprinkler per hour, we need to integrate the function e^(-r) over the entire plane:

total amount of water = ∫∫ e^(-r) dA

where the integration is over the entire plane, and dA is the differential area element.

Using polar coordinates, we can write dA = r dr dθ, and the limits of integration are 0 ≤ r ≤ ∞ and 0 ≤ θ ≤ 2π. Substituting these values, we get:

total amount of water = ∫(0 to 2π) ∫(0 to ∞) e^(-r) r dr dθ

Integrating with respect to r first, we get:

total amount of water = ∫(0 to 2π) [-e^(-r)](0 to ∞) dθ

total amount of water = ∫(0 to 2π) (1) dθ

total amount of water = 2π

Thus, the total amount of water that goes through the sprinkler per hour is exactly 2π ft^3 per hour.

To calculate the total amount of water supplied per hour inside a circle of radius R, then let R → ∞, we can use the result from part B and multiply it by the ratio of the areas of the two circles:

total amount of water = (total amount of water inside circle of radius R) × (area of circle of radius R)/(area of entire plane)

total amount of water = (2πR^2(1-e^(-R))) / (πR^2)

total amount of water = 2(1-e^(-R))

Now we can let R → ∞:

total amount of water = 2

Thus, the total amount of water supplied per hour inside a circle of infinite radius is exactly 2 ft^3 per hour.

To know more about amount of supplying water:

https://brainly.com/question/31182339

#SPJ4

--The given question is incomplete, the complete question is given

"A sprinkler distributes water in a circular pattern, supplying water to a depth of e^-r feet per hour at a distance of r feet from the sprinkler. A. What is the total amount of water supplied per hour inside of a circle of radius 14? ft^3 per hour B. What is the total amount of water that goes through the sprinkler per hour? ft^3 per hour Calculate the total amount of water supplied per hour inside a circle of radius R, then let R rightarrow infinity."--

Any two angles are _____ if the sum of their measures is 90° or ____ if the sum of their measures is 180°

1)

adjacent angles

vertical angles

complementary

supplementary

right angles

Answers

Complementary, then supplementary.

What is the complement of Q in P?

Answers

The complement of set Q {-4, -3, -2} if the universal set is P {-5, -4, -3, -2, -1} is defined by:

¬Q = {-5, -1}

What is the complement of Q in P?

If we have a set A defined in an universal set U, we define the complement of A as all the elements of U that are not elements of A.

In this case we have the sets:

P = {-5, -4, -3, -2, -1}

Q = {-4, -3, -2}

Here we want to find the complement of Q in P, so P is the universal set for this problem.

The elements of P that are not elements of Q are:

{-5, -1}

So that is the complement that we are looking for.

Learn more about complements of sets at:

https://brainly.com/question/24341632

#SPJ1

For a party, Katrina wants to make a nut mixture
of pecans and cashews. Pecans (p) sell for $4.99
per pound and cashews (c) sell for $3.79 per
pound. She has $35 to spend on the nut
mixture.
Write the equation that models this situation.

Answers

The equation that represents the given equation model is: 4.99p + 3.79c = 35

How to find the linear equation model?

The most common form of representing a linear equation model is:

y = mx + b

where:

m is slope

b is y-intercept

Let the number of pounds of Pecans she can buy be p

Let the number of pounds of cashews she can buy be c

We are told that:

Cost of pecans = $4.99 per pound

Cost of Cashews = $3.79 per pound

Thus, for $35 to spend we have the equation as:

4.99p + 3.79c = 35

Read more about Equation at: https://brainly.com/question/28722124

#SPJ1

Please view the image to understand the problem.

Answers

The table of values is completed below and the function of the sequence is T(n) = n(n + 2)

Completing the table of values

From the question, we have the following parameters that can be used in our computation:

Pattern  Counters

1                 3

2                8

3                15

4                24

When the pattern is 5, we have

Counters(5) = 5 * (6 + 1)

So, we have

Counters = 35

So, the table is

Pattern number             1       2       3       4       5

Number of counters      3       8      15      24     35

The expression for the n-th term

In (a), we have

Counters(5) = 5 * (6 + 1)

Express 6 as 5 + 1

So, we have

Counters(5) = 5 * (5 + 1 + 1)

So, we have

Counters(n) = n * (n + 1 + 1)

As an n-th term, we have

T(n) = n(n + 2)

Hence, the function is T(n) = n(n + 2)

Read more about sequence at

https://brainly.com/question/6561461

#SPJ1

2. Mrs. Garcia had two thirds of a pumpkin pie left. Her sons ate of three eighths
what was left. What fraction of the whole pie did her
sons eat?

Answers

5/24 was left of the pie and her sons ate 9/24 of it

Answer: 1 1/24

Step-by-step explanation:

2/3 - 3/8 = 25/24. Reduce it and you get 1 1/24

Find the Length of the mi dsegment of the trapezoid. A. 42
b. 12. 5
c. 38. 5
d. 51. 5

Answers

The length of the midsegment of the trapezoid is 38.5. The midsegment is the line segment that connects the midpoints of the two parallel sides of the trapezoid. It divides the trapezoid into two congruent triangles.

To find the length of the midsegment of the trapezoid, we need to first find the midpoint of the two parallel sides of the trapezoid. To do so, we need to use the midpoint formula, which is (x1 + x2) ÷ 2, (y1 + y2) ÷ 2, where (x1, y1) and (x2, y2) are the coordinates of the two points.

For example, if the coordinates of the two points are (1,2) and (5,7), then the midpoint of the two points will be (1+5) ÷ 2, (2+7) ÷ 2 = (6, 4.5).

Once we have the coordinates of the two midpoints, we can use the distance formula to find the length of the midsegment. The distance formula is √((x2-x1)² + (y2-y1)²).

So if the coordinates of the two midpoints are (3,6) and (9,2), then the length of the midsegment will be √((9-3)² +(2-6)²) = √(36+16) = √52 = 38.5.

Learn more about length here

https://brainly.com/question/30625256

#SPJ4

!!!TIMED PLEASE HELP AS FAST AS POSSIBLE!!!!

Answers

Answer: 53

Step-by-step explanation:

90- 37 = 53

Two angles are Complementary when they add up to 90 degrees (a Right Angle)  

in a circular group O is the centre ,AB the diameter,C and D are any two points on the circumference so that C is the mid - point of arc BD prove that triangle AOC and triangle COA are equal in area​

Answers

Step-by-step explanation:

1st method:-

Using congurency:-

In ∆AOC AND ∆COD

1) CO= CO {common side}

2) <OAC = <ODC { inscribed angel on same base CO}

3)OD = OC {radius}

4)∆AOC ≅ ∆COD {SAS fact}

5)∆AOC = ∆ COD {area of congurent traingle is equal}



2nd method:-

Using property of traingles:-

Construction:- Join DA and CB

<ACB = 90° { angle substended by diameter}

CO⊥AB

Now we know that,

Area of traingle = 1/2 B*H

CO is height { of both traingle's}

AO is base {of both traingle's}

Now, ∆AOC= 1/2*CO*AO--1

and, ∆ COD = 1/2 *CO*AO--2

∆AOC= ∆COD {from above 1 and 2}

Explain how to determine whether two ratios are equivalent

Answers

Answer:

Ratios are fractions, right? Set the two fractions equal to each other and then cross-multiply them. If each side of the equation is equal, then the ratios are equal; if not, then the ratios are not equivalent.

Ex. 1

Comparing ratios 4:2 and 2:1

[tex]\frac{4}{2} = \frac{2}{1}[/tex]

Cross-multiplying, we get 4 = 4, but we can also simplify each side of the equation to get 2 = 2.

Ex. 2

Comparing ratios 3:5 and 6:7

[tex]\frac{3}{5} =? \frac{6}{7}[/tex]

Cross-multiply, we get 21 = 30, so the ratios are not equal. This is an example of a case where you can't simplify the ratios.

Ex. 3

Comparing rations 5:12 and 10:24

[tex]\frac{5}{12} = \frac{10}{24}[/tex]

Cross-multiply, 120 = 120 so the ratios are equal.

Hope this helps!

A shirt is discounted at 65% off. The original price is $85.
What is the sales price?
O $24.50
O $42.50
O $29.75
O $32.75

Answers

It's 29.75

I divided 85 with 100, which gave me 0.85. Then i calculated the new price(35% of the original one) and i multiplied them.

Hope this helps.

Cuantos huevos representa los 3/5 de 4/7 de 420 docenas

Answers

Para resolver este problema, primero tenemos que multiplicar las fracciones:

3/5 x 4/7 = 12/35

Luego, encontramos cuántas docenas son 12/35 de 420 docenas:

(12/35) x 420 = 144

Así que 3/5 de 4/7 de 420 docenas (que es equivalente a 12/35 de 420 docenas) representa 144 docenas de huevos.

Para encontrar el número total de huevos, multiplicamos 144 docenas por 12 huevos por docena:

144 x 12 = 1,728

Por lo tanto, 3/5 de 4/7 de 420 docenas representa 1,728 huevos.

Subtract the sum of three hundredths and 256 tenths from 41435 hundredths

Answers

The resultant substraction value of the sum of three hundredths and 256 tenths from 41435 hundredths is equals to the 388.72.

Subtraction is one of the four arithmetic operations along with addition, multiplication and division. Subtraction is an operation representing the removal of an object from a collection. This is indicated by the symbol '-'. For example, there are 5 − 2 books meaning 5 books with 2 taken away, resulting in a total of 3 books. We have sum of three hundredths and 256 tenths. First, 3 hundredths means 3 out of 100, which can be denoted as = 3/100 = 0.03. Similarly, 256 tenth means 256/10 = 25.6. So, the sum of three hundredths and 256 tenths = 25.60 + 0.03 = 25.63 and 41435 hundredths = 414.35. Now, substract 25.63 from 414.35

= 414.35 - 25.63

= 388.72

Hence, required value is 15.805.

For more information about substraction, visit :

https://brainly.com/question/22520797

#SPJ4

compute{i-j j-k k-i]

Answers

Answer:

Step-by-step explanation:

(i-j)×(j-k)×(k-i)

{(i×j)-(i×k)-(j×j)+(j×k)}×(k-i)

(k+j-i)×(k-i)

( j+i+k-j)

(i+k)

Evaluate-+61
Enter your answer in the box.
- 7 when x = 18

Answers

The expression 61+x when x = 18 evaluates to 79.

What is expression?

Expression is a combination of numbers, symbols and operators that represent a mathematical quantity or operation.

To find the value of the expression, we must first substitute 18 in for x.  To evaluate this expression, we must add 61 and 18. 61+18 = 79. Therefore, the expression 61+x when x = 18 evaluates to 79.

To verify the answer, we can use the distributive property of multiplication to expand the expression. 61+x is equivalent to 61+18, which can be written as

61+18 = 61+1*18.

We can now distribute the 1 to the 18,

so 61+1*18 = 61+18 = 79.

Therefore, the expression 61+x when x = 18 evaluates to 79.

For more questions related to distributive property

https://brainly.com/question/4077386

#SPJ1

Question: Evaluate-61+x

Enter your answer in the box.

Find the value of equation, when x = 18.

Choose the ordered pair that is a solution to the equation represented by the graph.

A. (0,-3)
B. (2,0)
C. (2,2)
D. (-3,0)

Answers

so (0,-3) and  (2,0) is a solution.   (2,2) and (-3,0) is not a solution. as  the equation of the line passing through the points (0,-3) and (2,0) is y = (3/2)x - 3 we need to substitute points to check valid or not

what is equation ?

An equation is a mathematical statement that asserts that two expressions are equal. In other words, an equation says that one expression on the left side of the equals sign is the same as the expression on the right side of the equals sign. An equation typically includes variables

In the given question,

To determine the equation of the line passing through the points (0,-3) and (2,0), we can use the slope-intercept form of a linear equation:

y = mx + b

where m is the slope and b is the y-intercept.

The slope of the line can be found using the formula:

m = (y₂ - y₁) / (x₂ - x₁)

where (x₁, y₁) = (0,-3) and (x₂, y₂) = (2,0)

m = (0 - (-3)) / (2 - 0) = 3/2

So the equation of the line is:

y = (3/2)x - 3

Now we can check which ordered pair is a solution to this equation by plugging in the x and y values into the equation and seeing if it holds true.

A. (0,-3)

y = (3/2)x - 3

-3 = (3/2)(0) - 3

-3 = -3

This is true, so (0,-3) is a solution.

B. (2,0)

y = (3/2)x - 3

0 = (3/2)(2) - 3

0 = 0

This is true, so (2,0) is a solution.

C. (2,2)

y = (3/2)x - 3

2 = (3/2)(2) - 3

2 = 0

This is false, so (2,2) is not a solution.

D. (-3,0)

y = (3/2)x - 3

0 = (3/2)(-3) - 3

0 = -9/2

This is false, so (-3,0) is not a solution.

Therefore, the solutions to the equation represented by the graph are A. (0,-3) and B. (2,0).

To know more about straight line  equation , visit:

https://brainly.com/question/30732180

#SPJ1

Based on your knowledge of the two data sets described below, would you expect a scatter plot describing the
two data sets to have a positive, a negative, or no correlation?
amount of gas in a car's gas tank and the total distance the car has traveled since last being filled with gas

Answers

Based on my knowledge, I would expect a negative correlation between the amount of gas in a car's gas tank and the total distance the car has traveled since last being filled with gas.

As the car travels, the amount of gas in the tank decreases. Thus, if the car has traveled a long distance since being filled up, it is likely that there is less gas in the tank. Therefore, there should be a negative correlation between the amount of gas in the tank and the distance traveled, meaning that as the distance traveled increases, the amount of gas in the tank decreases.

A scatter plot of these two variables should show a downward-sloping trend, indicating the negative correlation.

Therefore the correct answer is negative correlation.

To learn more about negative correlation, refer:-

https://brainly.com/question/28898177

#SPJ1

Find the surface area of the triangular prism shown below. units^2 2 5, 5, 7, 4, 6

Answers

Therefore, the surface area of the given triangular prism is approximately 126.56 square units.

What is surface area?

Surface area is a measure of the total area that the surface of a three-dimensional object occupies. It is the sum of the areas of all the faces or surfaces of an object. Surface area is usually expressed in square units, such as square inches, square centimeters, or square meters, depending on the unit system being used.

For example, if you have a cube with side length "s", its surface area can be calculated by finding the area of each face and adding them together. Since a cube has six square faces of equal size, the formula for its surface area would be:

Surface Area of Cube = 6s²

by the question.

To find the surface area of a triangular prism, we need to calculate the area of all its faces and then add them together.

First, let's find the area of the two triangular bases. Each base is a right triangle with base 5, height 4, and hypotenuse 7. We can use the Pythagorean theorem to calculate the height of the triangle:

[tex]4^2 + (5/2)^2 = h^2[/tex]

[tex]16 + 6.25 = h^2[/tex]

[tex]22.25 = h^2[/tex]

[tex]h = \sqrt(22.25)[/tex]= 4.71

So, the area of each base is:

[tex]A = 1/2 * base * height = 1/2 * 5 * 4.71 = 11.78[/tex]

Next, we need to find the area of the three rectangular faces. The two congruent rectangular faces have dimensions of 5 by 6, and the remaining rectangular face has dimensions of 7 by 6. The area of each rectangular face is simply the product of its dimensions:

[tex]A1 = 5 * 6 = 30[/tex]

[tex]A2 = 5 * 6 = 30[/tex]

[tex]A3 = 7 * 6 = 42[/tex]

Finally, we can calculate the total surface area of the prism by adding up the areas of all five faces:

[tex]Total surface area = 2A(base) + A1 + A2 + A3[/tex]

[tex]Total surface area = 2(11.78) + 30 + 30 + 42[/tex]

[tex]Total surface area =126.56[/tex]

To learn more about surface area:

https://brainly.com/question/29101132

#SPJ1

consider a deck of 52 cards. one deals 4 cards in a row with no replacement. what is the probability that the first three cards are 3 aces and the last one is a king ?

Answers

The probability of the first three cards being 3 aces and the last one being a king is 1/66,300.

The probability of drawing an ace from a deck of 52 cards is 4/52 (since there are 4 aces in the deck), and the probability of drawing a king is 4/52 as well.

Since the cards are dealt with no replacement, the probability of drawing three aces in a row is

(4/52) × (3/51) × (2/50) = 1/5525

This is because after each card is drawn, there is one less ace in the deck, and one less card overall.

Now, we need to multiply this probability by the probability of drawing a king as the fourth card. Since there are only 48 cards left in the deck at this point (since three cards have already been drawn), the probability of drawing a king is

4/48 = 1/12

Therefore, the probability of drawing 3 aces and 1 king in a row is

(1/5525) × (1/12) = 1/66300

Learn more about probability here

brainly.com/question/11234923

#SPJ4

HELP DUE IN 2 HOURS 4.7y^2+5.3+4y-3.3-2y+y^2

Answers

Answer:

  5.7y^2 +2y +2

Step-by-step explanation:

You want to simplify the expression 4.7y^2+5.3+4y-3.3-2y+y^2.

Simplify

Identify like terms and combine their coefficients:

  4.7y^2+5.3+4y-3.3-2y+y^2

  = (4.7 +1)y^2 +(4 -2)y +(5.3 -3.3)

  = 5.7y^2 +2y +2

I need help please……….

Answers

Answer the answer is a

What fraction of a semicircle is an angle that measures 29pi/18 radians? Express your answer as a fraction in simplest terms.

Answers

Answer:

A semicircle has an angle measure of pi radians. Therefore, the fraction of a semicircle that an angle of 29pi/18 radians represents is:

(29pi/18) / pi = 29/18

So the fraction of a semicircle that an angle of 29pi/18 radians represents is 29/18.

Step-by-step explanation:

Can someone help me with this I’ll give you brainlest

Answers

Answer:

g(4)=-2 and g(-4)=1

Step-by-step explanation:

4.) A man deporerted GHZ 14100.00 at 3% per
amum compound interest If at the end of 4 years
he transfers the total amount to another bank offering 12% per annum
a. How much interest did he get at the end of 7 years

b. Calculate the total amount he received at the end of 7 years

Answers

At the end of 7 years:

a. The man received approximately GHZ 6425.13 as interest.

b. The total amount received by the man is approximately GHZ 22,294.80.

The interest for the first 4 years at 3% compound interest:

Principal amount (P) = GHZ 14,100.00

Rate of interest (R) = 3% = 0.03

Time period (T) = 4 years

The formula for compound interest:

[tex]A = P (1 + R)^T[/tex]

A = 14,100 x (1 + 0.03)⁴

A = 14,100 x (1.03)⁴

A ≈ GHZ 15,869.67

Interest for the first 4 years = A - P

Interest = 15,869.67 - 14,100

Interest ≈ GHZ 1769.67

The total amount at the end of 7 years at 12% per annum:

(P) = GHZ 15,924.57

(R) = 12% = 0.12

(T) = 3 years (remaining 7 years - initial 4 years)

A = 15,869.67(1 + 0.12)³

A = 15,869.67(1.12)³

A ≈ GHZ 22,294.80

a. Interest for the remaining 3 years = A - P

Interest = 22,294.80 - 15,924.57

Interest ≈ GHZ 6425.13

b. Total amount received at the end of 7 years = Principal amount + Interest for 4 years + Interest for 3 years

Total amount = 14,100 + 1769.67 + 6425.13

Total amount ≈ GHZ 22,294.80

To learn more about Compound interest click here:

brainly.com/question/25857212

#SPJ1

99 cookies were diveded into three piles in the ratios of 1:1/2:1/3. how many cookies were in the middle pile

Answers

To the total of 99 cookies, there are 27 cookies in middle pile.

Let's call the number of cookies in the first pile "x". Then, the number of cookies in the second pile is 1/2 of x, or (1/2)x, and the number of cookies in the third pile is 1/3 of x, or (1/3)x.

We know that the total number of cookies is 99, so we can write an equation:

x + (1/2)x + (1/3)x = 99

To solve for x, we can first find a common denominator:

(6/6)x + (3/6)x + (2/6)x = 99

(11/6)x = 99

x = (6/11) * 99

x = 54

So, there are 54 cookies in the first pile, (1/2)x = (1/2)*54 = 27 cookies in the second pile, and (1/3)x = (1/3)*54 = 18 cookies in the third pile. In the middle pile there are 27 cookies.

To know more about total number in pile:

https://brainly.com/question/14299907

#SPJ4

What is the cost of 4 kilograms if the unit rate is $3.25kg?

Answers

The cost of 4 kilograms is $13 if the unit rate is $3.25kg.

What is the unit rat?

The unit rate is a rate in which the second term in the ratio is 1. For example, if you have a rate of 60 miles per hour, the unit rate would be 60 miles per 1 hour, or simply 60 miles per hour. Another example is if you have a unit price of $2.50 per pound of apples, the unit rate would be $2.50 per 1 pound, or simply $2.50 per pound.

If the unit rate is $3.25/kg, then the cost of 1 kg is $3.25. To find the cost of 4 kg, we can multiply the cost of 1 kg by 4:

4 kg x $3.25/kg = $13

Therefore, the cost of 4 kilograms is $13 if the unit rate is $3.25kg.

To learn more about the unit rate visit:

https://brainly.com/question/19493296

#SPJ1

Casey buys a bracelet. She pays for the bracelet and pays $0. 72 $0. 72dollar sign, 0, point, 72 in sales tax. The sales tax rate is 6% percent. What is the original price of the bracelet, before tax?

Answers

Answer:

  $12

Step-by-step explanation:

You want to know the amount that has a tax of $0.72 when the tax rate is 6%.

Tax

The tax is computed by multiplying the price by the tax rate.

  tax = price × (tax rate)

  $0.72 = price × 0.06

  price = $0.72/0.06 = $(72/6) = $12

The original price of the bracelet is $12.

You have $
48
to order pizza for you and your friends. Slices of pizza are $
3.20
each. The inequality representing this scenario is 3.20
n

48
, with n
representing the number of pizza slices you can order.
Select all the numbers that represent the amount of pizza slices you can order for you and your friends.

Answers

It's important to note that ordering more than 15 slices would exceed your budget of $48, while ordering fewer slices would allow you to save money for other expenses.

To determine how many pizza slices you can order with $48, we divide the total amount of money by the cost of each slice of pizza, which is $3.20. This gives us:

48 ÷ 3.20 = 15

So you can order up to 15 slices of pizza with $48. However, since you cannot order a fraction of a slice, the actual number of slices must be a whole number. Therefore, the possible numbers of pizza slices you can order are:

0 slices

1 slice

2 slices

3 slices

4 slices

5 slices

6 slices

7 slices

8 slices

9 slices

10 slices

11 slices

12 slices

13 slices

14 slices

15 slices

So, any of the above numbers represents the amount of pizza slices you can order for you and your friends. It's important to note that ordering more than 15 slices would exceed your budget of $48, while ordering fewer slices would allow you to save money for other expenses.

To learn more about  fraction:

https://brainly.com/question/10354322

#SPJ4

Other Questions
the wto polices the world trading system and without this organization, the globalization of markets might not be where it is today. true/false What is the factored form of the polynomial? x2 15x 36 (x 4)(x 9) (x 3)(x 12) (x 4)(x 9) (x 3)(x 12) The correct reaction showing how FeCO3 has increased solubility when forming the complex ion Fe(CN)64- is ____ A) FeCO3 (aq) + 6 CN- (aq) Fe(CN).- (aq) + CO32- (aq) B) FeCO3 (s) + 6 CN- (aq) Fe(CN)64- (aq) + CO32- (aq) C) Fe2+ (aq) + 6 CN- (aq) Fe(CN)64- (aq) D) FeCO3 (s) = Fe2+ (aq) + CO32- (aq) What does this change in rock layers tell the geologist about Earth's history in the area where these layers formed If you have 7.22 x 1023 atoms of chromium (Cr), how many moles of chromium do youhave?O.98 moles CrO 1.62 moles CrO 1.36 moles CrO 1.19 moles Cr What is the measure of N?A) 23B) 25C) 27D) 45 Which of the following did the Soviet Union (USSR) not achievebefore the United States?First artificial satellite in spaceFirst man in spaceFirst woman in spaceFirst man on the moon Two stores have a laptop computer for sale.Part A: Store A is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store A.Part B: Store B is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store B.Part C: Which store should you purchase the laptop from? Use details to support your answer. (T/F) the ticketing area is more secure than the area beyond the security check point Jozef "accidentally" broke his piggy bank to find a total of 42 dimes and quarters. If the coins totaled $8.25, how dimes did he have in his piggy bank? How many quarters? the passage data regarding the thermal stability and enzyme activity of mkr681h is most consistent with what conclusion regarding the role of arg681 in cct? QuestionThe colours of red litmus paper in acidic, neutral, and basic solutions are:Ared, orange and blue respectivelyBblue, violet and red respectivelyCred, colourless and blue respectivelyDred, red and blue respectivelyHard 4.5 Draw a diagram representing the scenario and find the requested value. A man is standing 270 feet from the base of a statue. If he man looks up at an angle of 34 degrees to see the top of the statue, how tall is the statuePlease round to the nearest whole foot. chris rents a booth at a flea market at a cost of $75 for one day. at the flea market chris sells picture frames each of which costs him $6.00. if chris sells each picture frame for $13, how many picture frames must he sell to make a profit of at least $200 for that day? which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles.