Part A: The line of best fit for this data is y = 5. 3x + 23. Use this equation to make a conjecture about the temperature of the water in the beaker if heated for 6 minutes. Explain your thinking

Answers

Answer 1

The line of best fit suggests that the temperature of the water in the beaker after 6 minutes will be approximately 91.8°C. This is because when x = 6, the equation gives us y = 91.8.

The line of best fit for this data is y = 5.3x + 23. This equation can be used to make a conjecture about the temperature of the water in the beaker if heated for 6 minutes. To calculate this, substitute x = 6 into the equation: y = 5.3(6) + 23. Simplifying this equation, we get y = 31.8 + 23, which gives us y = 54.8. This is the temperature of the water in the beaker if heated for 6 minutes, which is approximately 91.8°C. hence, The line of best fit suggests that the temperature of the water in the beaker after 6 minutes will be approximately 91.8°C. This is because when x = 6, the equation gives us y = 91.8.

Learn more about equation here

https://brainly.com/question/28243079

#SPJ4


Related Questions

the set of all positive integers that are divisible by both 15 and 35 is infinite. what is the least positive integer in this set?550105210525

Answers

The least positive integer that will be divisible by both 15 and 35 will be 105.

The given integers are 15 and 35.
As we know that the least positive integer will be divisible by both 15 and 35 will be LCM ( least common factor) of 15 and 35.
The least common multiple of LCM of two integers is the common multiple of two numbers such that it is the least among all common multiples.
For example, LCM of 3 and 5 will be 15 because among all common multiples of 3 and 5, 15 will be least common multiple.
For LCM of 15 and 35, let's write multiples of both the numbers.
Multiples of 15 = 15,30,45,60,75,90,105,120,135,150,165,180,195,210,....
Multiples of 35= 35,70,105,140,175,210,...
We can see that 105 and 210 are two common multiples out of which 105 is the least multiple.
Therefore, the least positive integer that will be divisible by both 15 and 35 will be 105.

To know more about positive integer go throughthrough:-

https://brainly.com/question/31067729

#SPJ4

Which equation is inverse to the equation

Answers

The expression which represents this condition is x=-15z/y

Define Inverse variation means

A link between two variables known as inverse variation occurs when one variable's value rises while the other one's value falls, and vice versa. Inverse variation can be represented mathematically as y = k/x, where y and x are the variables, k is the constant of proportionality, and the product of y and x is constant.

When the value of x increases the value of y decreases.

When the value of x decreases the value of y increases.

So for an inverse variation we have the expression

y=k/x   or

x=k/y

The expression which represents this condition is

x=-15z/y

Hence option b) or the second option is the right answer.

To know more about variables, visit:

https://brainly.com/question/15078630

#SPJ1

The complete question is attached below.

Find the area of the complex figure. 31 m 69 m, 31 m, 23 m, 23 m, 12 m

Answers

The area of the complex figure is 1863 m².

What is area?

Area is a measure of the size or extent of a two-dimensional surface or shape, such as a square, circle, or rectangle. It is the amount of space inside the boundaries of a shape, usually measured in square units such as square meters (m²), square feet (ft²), or square centimeters (cm²).

The area of give figure :

= area of two rectangles + area of middle rectangle

we know that area of rectangle is length* breadth

so, area of give two rectangles = 2 × length × breadth

                                                  = 2 × 31 × 23

                                                   = 1426m²

similarly, area of the middle rectangle  = length × breadth

                                                                =  (69-23-23) × (31-12)

                                                                = 23 × 19

                                                                = 437 m²

∴ The area of give figure= 1426m²+437 m²

                                        = 1863 m²

To learn more about area visit the link:

https://brainly.com/question/2607596

#SPJ1

multiply 6 by f, then subtract 4 from the result

Answers

F6 = b squared is the answer to your question that you asked on Brainly

Graph the quadric functions y=-2x^2 and y=-2x^2+ 4 on a separate piece of paper. Using those graphs, compare and contrast the shape and position of the graphs.


Can someone help with this, I have no idea what this means
*will give brainliest as well*

Answers

Step-by-step explanation:

Here are the graphs of the two functions:

y

|

|

|

| (1) (2)

| | |

------x------x-------

| | |

| (3) (4)

|

|

Function 1: y = -2x^2

The graph is a downward-facing parabola.

The vertex is located at (0, 0).

The y-intercept is 0.

The function is symmetric about the y-axis.

Function 2: y = -2x^2 + 4

The graph is also a downward-facing parabola.

The vertex is located at (0, 4).

The y-intercept is 4.

The function is symmetric about the y-axis.

Comparing and contrasting the two graphs:

Both functions are downward-facing parabolas.

Function 2 is a vertical shift of Function 1, as it has been shifted 4 units upwards.

The vertex of Function 2 is higher than the vertex of Function 1.

The y-intercept of Function 2 is higher than the y-intercept of Function 1.

The shape and symmetry of the two graphs are the same.

Is it possible to dilate the satellite in the activity so that the number of square feet of surface area is equal to the number of cubic feet of volume? Explain or show your
reasoning.

Answers

No, it is not possible to dilate a satellite in such a way that the number of square feet of surface area is equal to the number of cubic feet of volume.

What is volume?

In mathematics, the volume of an object is a measure of the amount of three-dimensional space that the object occupies. Volume is typically expressed in units such as cubic meters (m³), cubic centimeters (cm³), cubic inches (in³), or cubic feet (ft³), depending on the context. Volumes are used in a wide variety of fields, including physics, engineering, and architecture, among others. For example, the volume of a container can be used to determine how much liquid it can hold, or the volume of a room can be used to calculate how much air conditioning is needed to cool the space.

Here,

This is because the units of measurement for surface area and volume are fundamentally different, and therefore cannot be equated without introducing additional variables. For example, consider a cube with a side length of 1 foot. Its surface area would be 6 square feet (since there are 6 sides to the cube, each with an area of 1 square foot), while its volume would be 1 cubic foot (since it occupies a space with a volume of 1 cubic foot). These two measurements cannot be equated without introducing additional variables. Therefore, it is not possible to dilate a satellite in a way that would make the number of square feet of surface area equal to the number of cubic feet of volume.

To know more about volume,

https://brainly.com/question/12237641

#SPJ1

Scary drew a rectangle with a perimeter of 20 inches then he tried to draw a square with a perimeter of 20 inches draw three different rectangles that Gary could have drawn, then draw the square if possible

Answers

Scary drew a rectangle with a perimeter of 20 inches and its dimensions are 6 by 4 and the square is a 5 in × 5 in square.

We know that a square has 4 identical sides.

The square's perimeter is equivalent to the product of its four sides. The square's side length continues to be the same as the circumference measurement unit.

Perimeter = Side + Side + Side + Side = 4 Side

Perimeter = 4 × side of the square

If ‘a’ is the length of side of square, then perimeter is:

Perimeter = 4a unit

therefore,

20 = 4 × side length

side length = 20/4 = 5 in

it is a 5 in × 5 in square.

We know that a rectangle has 2 pairs of sides that are equally long inside their pair.

The entire distance that the rectangle's outer boundary covers is referred to as its perimeter. Its length is expressed in units. The perimeter calculation is provided by:

Perimeter, P = 2 (Length + Width)

and so, you have in this case a perimeter of

= 2 × 6 + 2 × 4

= 12 + 8

= 20 in

To learn more about perimeter, click here:

brainly.com/question/6465134

#SPJ4

if the given triangles are similar find the missing length

Answers

Answer 24 do you enderstand?

The length of a picture frame is 6 inches more than the width. For what values of x is the perimeter of the picture frame greater than 152 ​inches?

Answers

If the width of the picture frame is greater than 35 inches, then the perimeter of the frame will be greater than 152 inches.

Let's first set up an equation for the perimeter of the picture frame. The perimeter is the sum of the lengths of all four sides, and we know that the length is 6 inches more than the width. Let's use x to represent the width:

Perimeter = 2(length + width)

Perimeter = 2(x + (x+6))

Perimeter = 4x + 12

Now, we want to find the values of x for which the perimeter is greater than 152 inches. We can set up an inequality:

4x + 12 > 152

Subtracting 12 from both sides:

4x > 140

Dividing both sides by 4:

x > 35

So the width must be greater than 35 inches in order for the perimeter to be greater than 152 inches.

Learn more about perimeter here:

https://brainly.com/question/30673291

#SPJ1

How does the volume of a cone relate to the volume of a cylinder with
a congruent base and the same height?
1 The volume of the two figures are the same
2 The volume of the cone is 3 times as large
3 The volume of a cylinder is twice as large
4 The volume of the cone is 1/3 as large ​

Answers

The comparison of the volume of a cone relative to the volume of a cylinder with the same dimensions is given as follows:

4 The volume of the cone is 1/3 as large.

How to obtain the volume a cone?

The volume of a cone of radius r and height h is given by the equation presented as follows, which the square of the radius is multiplied by π and the height, and then divided by 3.

V = πr²h/3.

For the volume of the cylinder, the equation is given as follows:

V = πr²h.

The volume of the cylinder is triple the volume of the cone, hence the volume of the cone is one third of the volume of the cylinder.

More can be learned about the volume of a cone at brainly.com/question/12004994

#SPJ1

HELP ME PLEASE


Use the graph to answer the question.

Answers

Answer:

the other line is over more the line that is on the left so its 6 units to the left

20 cookies if 3/4 are given away how many are left

Answers

Answer:5

Step-by-step explanation:

Match each sentence with the inequality that could represent the situation
A. Han got $2 from Clare, but he has less than $20 1. x - 2 < 20
B. Mai spent $2 and has less than $20 2. 2x < 20
C. If Tyler had twice the amount of money he has, he
would have less than $20 3. x + 2 < 20
D. If Priya had half the money she has, he would
have less than $20 4. 1/2x < 20

Answers

Therefore, the area of the trapezoid is 60 cm².

What is trapezoid?

A trapezoid is a four-sided polygon with two parallel sides (called bases) of different lengths, and two non-parallel sides (called legs). The legs of a trapezoid are usually not congruent and can be of different lengths. Trapezoids can have different shapes and sizes, but they always have at least one pair of parallel sides. The area of a trapezoid can be calculated using the formula:

[tex]Area = ((b_1 + b_2) * h) / 2,[/tex]

where b1 and b2 are the lengths of the parallel bases, h is the height or perpendicular distance between the two bases.

To calculate the area of a trapezoid, we use the formula:

[tex]Area = (b_1 + b_2) * h / 2[/tex]

where b1 and b2 are the lengths of the parallel sides of the trapezoid and h is the height (perpendicular distance) between the parallel sides.

In this case, we are not given which sides are the parallel sides and which one is the height, so we cannot directly apply the formula. However, we can make an educated guess based on the dimensions given.

Assuming that the two 8 cm sides are parallel, we can use the formula as follows:

[tex]Area = (b_1 + b_2) * h / 2[/tex]

[tex]Area = (8 cm + 16 cm) * 10 cm / 2[/tex]

[tex]Area = 120 cm^{2} / 2[/tex]

[tex]Area = 60 cm^{2}[/tex]

To know more about trapezoid, click here,

https://brainly.com/question/8643562

#SPJ1

the mean cost of a box of cheerios oat crunch is $4.00 and the variance is .35. if the price increases by 25 cents a box, what is the new variance?

Answers

The new variance is 0.41.

Given that the mean cost of a box of Cheerios oat crunch is $4.00 and the variance is 0.35.

The variance represents the average of the squared deviations from the mean, so we can write:

variance = (standard deviation)^2

The standard deviation is the square root of the variance, so we have:

standard deviation = sqrt(variance) = sqrt(0.35) = 0.59

Now, if the price of a box of Cheerios oat crunch increases by 25 cents, the new mean cost will be:

new mean = $4.00 + $0.25 = $4.25

To find the new variance, we need to calculate the new squared deviations from the mean and take their average. The squared deviation of each observation is given by:

(new cost - new mean)^2

We can simplify this expression by substituting the new mean and the original standard deviation:

(new cost - $4.25)^2 = (old cost - $4.00 + $0.25)^2 = (old cost - $4.00)^2 + 2($0.25)(old cost - $4.00) + $0.25^2

The first term on the right-hand side is the squared deviation of the original cost, the second term represents the change in the squared deviation due to the increase in price, and the third term is a constant that does not affect the variance.

To find the new variance, we need to take the average of these squared deviations. Since the original variance was 0.35, we have:

new variance = (1/n) * [sum of (new cost - new mean)^2]

where n is the number of observations (we assume it is large enough to use the normal distribution approximation). Using the expression above for the squared deviation, we can write:

new variance = (1/n) * [sum of (old cost - $4.00)^2 + 2($0.25)(old cost - $4.00) + $0.25^2]

We can simplify this expression by using the properties of summation:

new variance = (1/n) * [sum of (old cost - $4.00)^2] + (2/$n) * ($0.25) * [sum of (old cost - $4.00)] + ($0.25^2)

The first term is the original variance, the second term is zero (since the sum of deviations from the mean is always zero), and the third term is a constant that does not affect the variance. Therefore, the new variance is:

new variance = 0.35 + ($0.25)^2 = 0.41

Learn more about  statistical analysis:https://brainly.com/question/14724376

#SPJ11

Factorise p²-10p+25 ​

Answers

Answer:

Step-by-step explanation:

The expression p² - 10p + 25 can be factored as follows:

p² - 10p + 25 = (p - 5)²

This is an example of perfect square trinomial. It can be recognized as such because the first and last terms are perfect squares (p² and 25), and the middle term (-10p) is twice the product of the square roots of the first and last terms (2√(p²×25) = 2p×5 = 10p).

So, the factored form of the expression is (p - 5)².

Step-by-step explanation:

The answer to this question is (p-5)^2

A hair salon charges a fixed rate of $25.00 for a haircut and then an additional $15 for any other services. write a function to model the cost of services there and then determine how many services you had if you were charged $25.

Answers

The function is f(x) = 15x + 25 and you would have 6 services if you were charged $25

We know that the hair salon charges a fixed rate of $25.00 for a haircut and then an additional $15 for any other services, therefore:

Let x = number of services, then we can obtain the function as:

f(x) = 15x + 25 (function)

when we further solve the function, we get the answer for how many services one would have if we were charged $25,

f(x) = 15x + 25

115 = 15x + 25

90 = 15x

6 = x

Now, we know that the function is f(x) = 15x + 25 and you would have 6 services if you were charged $25

To learn more about function, click here:

brainly.com/question/12431044

#SPJ4

Find the coordinate of the terminal point for each angle.

Help with 8, 10, and 12 please.

Answers

Therefore, the coordinates of the terminal points are: (0, 1),(-√2/2, -√2/2) ,(-1/2, -√3/2)

What is coordinate?

A coordinate is a set of numerical values that uniquely determines the position of a point in space. In two-dimensional space, a coordinate is typically represented by a pair of numbers (x, y), where x represents the horizontal distance from a reference point, and y represents the vertical distance from the same reference point. In three-dimensional space, a coordinate is represented by a triplet of numbers (x, y, z), where x, y, and z represent the horizontal, vertical, and depth distances from the reference point, respectively.

by the question.

Pi/2 is an angle in radians, and it corresponds to an angle of 90 degrees in degrees. The terminal point for this angle lies on the positive y-axis and has coordinates (0, 1).

315 degrees is an angle in degrees, and it corresponds to an angle of 7π/4 radians in radians. To find the terminal point for this angle, we can use the unit circle. Starting from the positive x-axis (the initial side), we rotate 315 degrees counterclockwise until we hit the terminal side. This corresponds to a rotation of 5π/4 radians. The terminal point lies in the third quadrant and has coordinates (-√2/2, -√2/2).

240 degrees is an angle in degrees, and it corresponds to an angle of 4π/3 radians in radians. To find the terminal point for this angle, we can again use the unit circle. Starting from the positive x-axis (the initial side), we rotate 240 degrees counterclockwise until we hit the terminal side. This corresponds to a rotation of 4π/3 radians. The terminal point lies in the third quadrant and has coordinates (-1/2, -√3/2).

To learn more about coordinate:

https://brainly.com/question/16634867

#SPJ1

A copy machine makes 36 copies per minute. How many copies does it make in 5 minutes and 15 seconds? Clears your work. Undoes your last action.

Answers

To solve this problem, we need to first convert 5 minutes and 15 seconds to a decimal form of minutes.

5 minutes is equal to 5.0 minutes, and 15 seconds is equal to 15/60 = 0.25 minutes. Therefore, the total time in minutes is:

5.0 + 0.25 = 5.25 minutes

Next, we can multiply the number of copies made per minute by the total time in minutes to find the total number of copies made:

36 copies/minute x 5.25 minutes = 189 copies

Therefore, the copy machine makes 189 copies in 5 minutes and 15 seconds.

PLEASE HELP NEOWWWW
Select the best interpretation of the following inequality. ∣−2.2−x∣>3
A) The distance between -2.2 and -x is greater than 3.
B) The distance between -2.2 and x is greater than 3.
C) The distance between 3 and -2.2 is greater than x.

Answers

Answer:

B) The distance between -2.2 and x is greater than 3.

Step-by-step explanation:

two cyclists leave towns miles apart at the same time and travel toward each other. one cyclist travels faster than the other. if they meet in hours, what is the rate of each cyclist?

Answers

As per the travelling distance, if they meet in hours, then the rate of each cyclist is r₂ miles per hour.

Let's assume that the two towns are A and B, and the distance between them is d miles. Let the first cyclist start from town A and travel towards town B, and the second cyclist start from town B and travel towards town A. Let's also assume that the first cyclist travels at a rate of r₁ miles per hour, and the second cyclist travels at a rate of r₂ miles per hour.

Now, let's consider the time it takes for the two cyclists to meet. Since they are traveling towards each other, their combined speed is (r₁ + r₂) miles per hour. We can use the formula:

distance = speed × time

to find the time it takes for them to meet. Let t be the time taken for them to meet, then we can write:

d = (r₁ + r₂) × t

where d is the distance between the two towns.

Now, we need to solve for r₁ and r₂. We can use the fact that the two cyclists meet in hours to write:

t = d / (r₁ + r₂)

Substituting this expression for t in the equation we got earlier, we get:

d = (r₁ + r₂) × (d / (r₁ + r₂))

Simplifying this equation, we get:

r₁ + r₂ = d / t

Substituting the value of t, we get:

r₁ + r₂ = d / (d / (r₁ + r₂))

r₁ + r₂ = (r₁ + r₂)

This equation tells us that the sum of the rates of the two cyclists is equal to the distance between the two towns divided by the time it takes for them to meet.

We can now use algebra to solve for r₁ and r₂. Let's assume that r₁ is the faster cyclist, then we have:

r₁ = (d / t) - r₂

Substituting the value of t, we get:

r₁ = (d / (d / (r₁ + r₂))) - r₂

Simplifying this equation, we get:

r₁ = (r₁ + r₂) - r₂

r₁ = r₁

This equation tells us that the rate of the faster cyclist is equal to itself, which is obvious.

Now, we can find the rate of the slower cyclist by using the fact that:

r₂ = (d / t) - r₁

Substituting the value of t, we get:

r₂ = (d / (d / (r₁ + r₂))) - r₁

Simplifying this equation, we get:

r₂ = (r₁ + r₂) - r₁

r₂ = r₂

This equation tells us that the rate of the slower cyclist is also equal to itself, which is obvious.

Therefore, we can conclude that the rate of the faster cyclist is r₁ miles per hour, and the rate of the slower cyclist is r₂ miles per hour, where:

r₁ = (d / t) - r₂

r₂ = (d / t) - r₁

To know more about distance here

https://brainly.com/question/4199102

#SPJ4

a bacteria culture initially contains 1500 bacteria and doubles every half hour. find the size of the bacterial population after 40 minutes.

Answers

The size of the bacterial population after 40 minutes.= 1572864000.

What is unitary method?

"A way to find a multiple unit value from a single unit value as well as the reverse."

In every case, we first count the unit or amount value before figuring out the more or less amount value.

This method is referred to as a unified procedure for this reason.

By dividing the set value by the quantity of sets, one can find numerous set values.

By dividing several set values by the total number of sets, one can determine a set value.

According to our question-

A = 1500(2)600/30

A = 1500(2)20

A = 1500(1048576)

A = 1572864000

Hence, The size of the bacterial population after 40 minutes.= 1572864000.

learn more about unitary method click here:

brainly.com/question/24587372

#SPJ1

if drawing a red marble is 20% and a green marble is 28.57% and a blue marble 22.8% and a yellow marble is 22.85%, what is the probabilty of picking a red one then a green one then a blue one?

Answers

The probability of picking a red marble, then a green marble, and finally a blue marble is 0.091424%, or approximately 0.09%.

To find the probability of picking a blue marble, given that we have already picked a red and a green marble, we use the same method:

P(B|R and G) = P(R and G and B) / P(R and G)

where P(B|R and G) is the probability of picking a blue marble, given that a red marble and a green marble have been selected, and P(R and G and B) is the probability of picking a red marble, then a green marble, and finally a blue marble.

Using the given probabilities, we can plug in the values and simplify:

P(B|R and G) = (0.2 x 0.2857 x 0.228) / (0.2 x 0.2857) = 0.016

This means that if we have already picked a red marble, then a green marble, there is a 1.6% chance of picking a blue marble next.

Finally, to find the probability of picking a red marble, then a green marble, and finally a blue marble, we multiply the probabilities of each event together:

P(R and G and B) = P(R) x P(G|R) x P(B|R and G)

=> 0.2 x 0.2857 x 0.016 = 0.00091424 or 0.09%

To know more about probability here

https://brainly.com/question/11234923

#SPJ4

An expression is shown below. 2√ 51x Which value of x makes the expression equivalent to 10√51 ?
a 6
b 25
c 50
d 100​

Answers

Answer:

B:25    

Plug it in to check                

Swapping the contents of two variables requires a third variable that can serve as a temporary storage location. True False.

Answers

Answer:

True.

Step-by-step explanation:

True.

Let's say A = 5, and B = 10.

We need to swap the contents of A and B, so A will end up with 10 and B will end up with 5.

A = 5

B = 10

Introduce variable C.

C = A (now C contains 5)

A = B (now A contains 10)

B = C (now B contains 5)

In the last two steps above, you see that the values of A and B were swapped.

John claims that more than 25% of Wenatchee population prefer TACO BELL. To support his claim, he selected a sample of 200 people in Wenatchee and observed that 63 prefer Taco Bell. At a= 0.05, is
there enough evidence to support his claim? Justify your answer by stating what is (a) the null hypothesis and alternative hypothesis. Explain what test (left-tailed, right-tailed or two-tailed) you are using. Also find
(b) critical z-value (not the p-value!)
(c) test value
Hint: You can use the formula for z-Test for proportion

Answers

The test value is 0.636, and the critical z-value is 1.645. Since the test value (0.636) is greater than the critical z-value (1.645), we reject the null hypothesis and conclude that there is enough evidence.

What is test value?

It is usually represented by the number of errors or defects found in a system or component during a test phase.

For this test, we use the formula for a z-test for proportions.

Let p be the proportion of Wenatchee population that prefers Taco Bell.

Null hypothesis: p = 0.25

Alternative hypothesis: p > 0.25

The critical z-value for this test is 1.645, which is the z-value corresponding to a=0.05.

The test value is calculated by taking the sample proportion of people preferring Taco Bell

(63/200 = 0.315)

and subtracting the null hypothesis proportion of people preferring Taco Bell (0.25).This gives us 0.065.

This value is then divided by the standard error of the proportion, which is calculated as the square root of

(p*(1-p)/n), where p is the null hypothesis proportion (0.25) and n is the sample size (200). This gives us a value of 0.636.

Therefore, the test value is 0.636, and the critical z-value is 1.645.

Since the test value (0.636) is greater than the critical z-value (1.645), we reject the null hypothesis and conclude that there is enough evidence to support John's claim that more than 25% of Wenatchee population prefer TACO BELL.

For more questions related to critical z-value

https://brainly.com/question/14040224

#SPJ1

1). Solve this 11-11x11+11=?

Answers

Answer:

121

Step-by-step explanation:

11x11=121

121+11=132

132-11=121

classify the following random variables according to whether they are discrete or continuous: a. the number of words spelled correctly by a student on a spelling test b. the amount of water flowing through the hoover dam in a day c. the length of time an employee is late for work d. the number of bacteria in a particular cubic centimeter of drinking water e. the amount of carbon monoxide produced per gallon of unleaded gas f. your weight

Answers

a. Discrete variable b. Continuous variable c. Continuous variable d. Discrete variable e. Continuous variable f. Continuous variable

In statistics, a variable is an attribute or characteristic that can be measured. They can be classified as either continuous or discrete. A continuous variable has values that can take any value within a given range while a discrete variable has values that can only be integers.

Classification of each variable:

a. The number of words spelled correctly by a student on a spelling test- Discrete variable

b. The amount of water flowing through the hoover dam in a day- Continuous variable

c. The length of time an employee is late for work- Continuous variable

d. The number of bacteria in a particular cubic centimeter of drinking water- Discrete variable

e. The amount of carbon monoxide produced per gallon of unleaded gas- Continuous variable

f. Your weight- Continuous variable

To know more about Discrete variable: https://brainly.com/question/18763328

#SPJ11

HEEELLLPPP I WILL GIVE YOU A BRAINILIST, find the Regression Equation and the final answer

Answers

Equation for the regression line is given as y = -0.95X + 8.99.

When the wind is blowing at a speed of 27 mph, the chill factor is -16.66.

What does a regression line mean?

Regression coefficients are estimates of specific unknown properties that explain the relationship between a predictor variable and the related response.

In order to extrapolate the value of an unknown variable from a known variable, regression coefficients are used. The effect of a one-unit change in an independent variable on the dependent variable can be measured via linear regression by determining the equation of the best-fitted straight line. The procedure in question is regression analysis.

Calculation Overview

X's total is 45.

Total Y = 20

Mean X = 6.4286

Mean Y = 2.8571

Square sum (SSX) equals 113.7143.

Product total (SP) = -108.5714

Regression Equation = ŷ = bX + a

b = SP/SSX = -108.57/113.71 = -0.95477

a = MY - bMX = 2.86 - (-0.95*6.43) = 8.99497

y = -0.95477X + 8.99497

y = -0.95X + 8.99

The wind speed chill factor when it is 27 mph.

Using the output of the regression line shown above, we would solve for this.

y=-0.95X+8.99 

y=-0.95X+8.99 

y = -0.95 * 27 + 8.99

y = -25.65 + 8.99

y = -0.95 * 27 + 8.99

Conclusion: y = -16.66

To know more about regression line, visit:

https://brainly.com/question/17004137

#SPJ1

in the township of springfield, renovating homeowners must pay a fee of $35 per square foot they add to their house past 25% of the original square footage. in springfield, eamon pays a $2,800 fee after adding 380 square feet to his home. What was the original square footage of eamon's home?

Answers

The answer calculates the original square footage of Eamon's home based on the $35 fee per square foot paid for adding 380 square feet past 25% of the original square footage. The original square footage of Eamon's home is 1,520 square feet.

Let's assume that the original square footage of Eamon's home was "x". According to the problem, he had to pay a fee of $35 for every square foot he added past 25% of the original square footage.

Therefore, the square footage he added to his home past 25% of the original square footage was:

380 - 0.25x

And the fee he paid was $2,800. So we can write an equation:

35(380 - 0.25x) = 2,800

Simplifying the equation, we get:

13,300 - 8.75x = 0

Solving for x, we get:

x = 1,520 square feet

Therefore, the original square footage of Eamon's home was 1,520 square feet.

Learn more about algebra here: brainly.com/question/24875240

#SPJ1

Can someone solve this and thoroughly explain it to me, !!I will give brainliest!!

Answers

Answer:

11.9m

Step-by-step explanation:

explanation in picture :)

please mark brainliest

Answer:

11.81 is the height

Other Questions
how The Odyssey is different from the monomyth structure multiple choice question which of the following sentences best summarizes how genes and chromosomes are involved in transmitting information to future generations? multiple choice question. chromosomes are composed of long strands of dna organized into genes. each gene codes for a specific trait and because genes can be shared between individuals, these traits can be transferred from individual to another individual. genes are composed of long strands of proteins organized into units called genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. chromosomes are composed of long strands of proteins organized into units called genes. each gene codes for a specific trait and can be passed down vertically through childbirth from mother to child. chromosomes are composed of long strands of dna organized into genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. prospero reveals that ferdinand is alive, leading alonso to where miranda and ferdinand playing chess. why do you think the writers included this moment? from port a, a boat sails 26 miles on a bearing of 60. then the boat changes course to a bearing of 270 until it reaches a point directly north of the port. determine the total distance the boat has sailed to the nearest tenth of a mile. When propanol (CH3CH2CH2OH) is combusted, such as when in a gasoline blend, the following reaction occurs:2CH3CH2CH2OH(l)+9O2(g)?6CO2(g)+8H2O(g)Based on the standard free energies of formation given in the table below, what is the standard free energy change for this reaction?Substance?G?f(kJ/mol)CH3CH2CH2OH(l)?360.5O2(g)0CO2(g)?394.4H2O(g)?228.6Express your answer to one decimal place and include the appropriate units. a physical therapist assistant completes a posture screening and muscle length test of the hip flexors on a patient. the assistant determines that the patient has extremely tight hip flexors bilaterally. what common structural deformity is most often associated with tight hip flexors? 4. When the ball crosses the end line and the defensive team last touched the ball, theoffensive team gets a what? Wavelength(meters)Radio Microwave Infrared1010210-5About the size of...Visible Ultraviolet5x10610X-ray Gamma Ray10-1010 10-12www wwwtt214 & f &Buildings Humans Honey Bee Pinpoint Protozoans Molecules Atoms Atomic NucleiA. visible lightC. gamma raysAccording to this chart, which form of electromagneticradiation has the longest wavelength?B. ultraviolet lightD. radio wavesPlease help 30 points and will mark brain thing Which of these is not a consideration when interpreting literature?a.the high points of tensionc.the most powerful images and soundsb.the length of the pieced.what the narrator wants to accomplish For point S ( 3 , 3 ) , where will the image of this point be located after applying the translation rule 3 units on the -axis and 3 units on the -axis? ( 0 , 0 ) ( 0, 4 ) ( 4 , 0 ) ( 4 , 4 ) how to rewrite the mixed number as an improper fraction. draw please help me bc it do tomorrow PLEASE HELP PLEASE IT DO TOMORROW. for 3 2/4 and 4 2/5 RNA polymerase requires a primer to initiate polynucleotide synthesis. T/F Rank the following electron-pair geometries by increasing steric number. Items (5 items) (Drag and drop into the appropriate area) Items in order Highest Steric No. linear trigonal planar 1 trigonal bipyramidal octahedral 2. tetrahedral Who was your favorite character in Yellow Rose Film? What character did you identify with the most? Were there any characters that you disliked? Why?Yellow Rose Film what is the ratio between 60:260 one of the one-way functions used in public key cryptography is integer multiplication/factorization. multiplying two integers is easy, but factoring is hard. the number 3418531 is the product of two primes.what is the smaller of the two primes?what is the largest of the two primes? The following outline is the basic structure for which government type? 1. Power is divided between national and regional governments. 2. The people elect the head of the government, usually a president. 3. The people elect representatives to a lawmaking body. a. A constitutional monarchy b. A dictatorship c. A federal democracy d. A parliamentary democracy shelly is running the color run in new mexico on the hottest day of the year. in exchange for admittance, she signs a contract. while running she suffers from a heat stroke due to the conditions. a provision in the contract states the race sponsors are not liable for her heat stroke would be referred as Pueden las carreteras ser invisibles according to your textbook, stability strategies can be very useful in the short run, but they can be dangerous if followed for too long. question 25 options: true false