PLEASE HELP? The standard form for the function is: P(x)=-5x^+120x-315.
Rewrite the function in vertex form.​​

Answers

Answer 1

Answer:

P(x) = -5(x² - 12)² + 405

Step-by-step explanation:

P(x) = -5x² + 120x - 315

Factor out -5 from the first two terms

P(x) = -5(x² - 24x) - 315

Complete the square

P(x) = -5(x - 12)² - (-5(-12)²) -315

P(x) = -5(x - 12)² + 720 - 315

P(x) = -5(x - 12)² + 405


Related Questions

whats the awnser i need help

Answers

answer:10

Step-by-step explanation:

the graph show it is 1 hour and shows 10 miles and it continues

Answer:

it should be that the miles are 10 times the amount of hours

Step-by-step explanation:

Considering that to bike 10 miles it took 1 hour and to bike 20 miles it took 2 hours it will continue going like that so the miles will always be 10 times the amount of hours

Solve these for points I got a one in algebra so this would be helpful to my grade

Answers

The solution for each system of equations is given as follows:

1) x = -4, y = -8.

2) x = 5, y = -1.

3) x = -7, y = 2.

4) No solution.

5) x = 2, y = -6.

6) x = -3, y = 4.

How to solve the system of equations?

The system of equations are solved using the elimination method, writing  one variable as a function of another, replacing in the other equation, and then obtaining each variable.

For item 1, we eliminate x, as follows:

x = 12 + 2y.

Hence the solution for y is obtained as follows:

5(12 + 2y) + 3y = -44

60 + 10y + 3y = -44

13y = -104

y = -104/13

y = -8.

Then the solution for x is given as follows:

x = 12 + 2y = 12 + 2(-8) = -4.

For item 2, we have that:

y = 19 - 4x.

Hence:

7x - 2(19 - 4x) = 37

7x - 38 + 8x = 37

15x = 75

x = 5.

Hence the solution for y is of:

y = 19 - 4(5) = -1.

For item 3, we can simplify the second equation by two, hence:

-x + y = 9.

y = 9 + x.

Hence:

3x + 8(9 + x) = -5

3x + 72 + 8x = -5

11x = -77

x = -7.

Hence the solution for y is of:

y = 9 - 7 = 2.

For item 4, we have that:

x = 7 + 3y.

Hence:

2(7 + 3y) - 6y = 12

14 + 6y - 6y = 12

0y = -2. (no solution, division by zero).

For item 5, we have that:

y = -2 - 2x.

Hence:

5x + 3(-2 - 2x) = -8

5x - 6 - 6x = -8

-x = -2

x = 2.

Hence the solution for y is of:

y = -2 - 2(2)

y = -6.

For item 6, we simplify the second equation by two, hence:

2x + y = -2

y = -2 - 2x.

Replacing on the first equation, we have that:

2x + 5(-2 - 2x) = 14.

2x - 10 - 10x = 14

-8x = 24

8x = -24

x = -3.

Hence the solution for y is obtained as follows:

y = -2 - 2(-3)

y = -2 + 6

y = 4.

More can be learned about a system of equations at https://brainly.com/question/24342899

#SPJ1

use substitution to solve each system of equations

2. y= 4x+5
2x+y=17

6. 3x +4y= -3
x+2y= -1

8. -1=2x - y
8x-4y=-4

10. y= -4x + 11
3x + y=9

15. -5x+4y=20
10x-8y= -40

Answers

I think it's answer this .

Can some one help me with this question its hard :( down below ill give brainliest
and plz explain

Answers

x*x is x^2, because the ^2 simply means that the x is multiplying by itself

(Ex. if you had x^3, you would have x*x*x, or if you had x^4, you would have x*x*x*x and it goes the other way around as well, meaning x*x*x*x*x would be x^5)

Answer:

B. x²

Step-by-step explanation:

A number/variable multiplied by itself would be a power, in this case to the second power.

For example:

x*x*x = x³

At the toy store, 4 toy cars cost $3.84. How much does it cost to buy 20 toy cars?

A. $20.20

B. $17.20

C. $19.20

D. $21.20

Whoever gets the correct answer will get a crown!!!

Answers

Step-by-step explanation:

To answer this, we need to find the scale factor which is to find how much one individual car is worth.

So we need to divide 3.84 and 4.

3.84 ÷ 4 = 0.96

So each car is $0.96.

To find 20 toy cars, we need to multiply 0.96 and 20.

The answer is:

$19.20

the answer is C. Since you already know 4 is 3.84(and 4x5=20) so you multiply 3.85x5=19.20

upper and lower bounds question

Answers

The upper bound and lower bound of a using the equation will result to

upper bound value 136015.499

lower bound value 136014.500

How to find the upper bound and lower bound values

Evaluating the given expression a = b + 2c

where

b = 15 to 2 significant figures

c = 68 000 to 2 significant figures

solving for a

a = b + 2c

a = 15 + 2(68000)

a = 136015

The bound values

upper bond value is the largest possible vale of a

upper bond value = 136015.499

lower bound value is the lowest possible value of a

lower bound value = 136014.500

Learn more about bound values at:

https://brainly.com/question/26155120

#SPJ1

Find the measure of the missing angle.

Answers

Answer:

its 79 k(kkkkkkkkkkkkkkkkk

Answer:

79 i think

Step-by-step explanation:

Please help me on this :/

Answers

Answer

8. b

9.C

10.a

11.a

12. c

13. b

brainliest pls <3

This is algebra 2, please help.

Answers

The vertex and axis of symmetry of the graph is shown in image.

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Now,

Since, The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Hence, The points corresponds to x = - 2 and - 4 are;

For x = - 2;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-2 + 6)² - 5

⇒ f (x) = 1/4 (4)² - 5

⇒ f (x) = 4 - 5

⇒ f (x) = - 1

For x = - 4;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-4 + 6)² - 5

⇒ f (x) = 1/4 (2)² - 5

⇒ f (x) = 1 - 5

⇒ f (x) = - 4

Thus, The points are;

⇒ (- 2, - 1) , (- 4, - 4)

And, The vertex of the function is,

⇒ ( - 6, - 5 )

And, The axis of symmetry of the graph is,

⇒ x = - 6

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ1

Help please Or else I will give You A holy SLAP

Answers

Answer:

z = 450 - 135

z + 135 = 450

Step-by-step explanation:

Han's house is 450 meters from school. Lin's house is 135 meters closer than Han's house from school. So,

450 - 135 = 315 <-- equation to look for

Lin's house is 315 meters from school.

What is the x-coordinate of the solution to the system shown?

3x - y = 6
3x + y = 34

Answers

The x-coordinate of the solution of the system of equations is x = 20/3

What is the x-coordinate of the solution?

Here we have a system of equations below:

3x - y = 6

3x + y = 34

And we want to find the x-cordinate of the solution, so we need to solve this for x.

We can use the elimination method, you can see that if we add both equations we will get:

(3x - y) + (3x + y) = 6 + 34

6x = 40

x = 40/6

We can simplify that fraction to get:

x = 20/3

That is the x-coordinate of the solution.

Learn more about systems of equations:

https://brainly.com/question/13729904

#SPJ1

How do I do this and show work

Answers

We are given the expression:

[tex]\frac{\sqrt{2} }{3} = -\frac{2}{3} Sin\theta[/tex]

[tex]\sqrt{2}} = -2 Sin\theta[/tex]                                           [multiplying both sides by 3]

[tex]Sin\theta = \frac{\sqrt{2}}{-2}[/tex]                                                [Dividing both sides by -2]

[tex]Sin\theta = \frac{-1}{\sqrt{2}}[/tex]

which means:

[tex]\theta = Sin^{-1}(\frac{-1}{\sqrt{2}} )[/tex]

[tex]\theta = -Sin^{-1}(\frac{1}{\sqrt{2}} )[/tex]

θ = -45°                                                    [because [tex]Sin^{-1}(\frac{1}{\sqrt{2}})[/tex] = 45°]

Hence, the answer is -45° OR (360-45) = 315°

In the diagram below, PQ is parallel to MN. If PQ, is 22 more than MP, PO=12, and MN=12, find the length of MP. Figures are not necessarily drawn to scale. State your answer in the simplest radical form, if necessary.

Answers

The measure of the length MP is equal to 6.

What are similar triangles?

Two triangles are similar triangles if they have the same corresponding angle measures and proportional side lengths.

Given is a triangle ΔOMN.

Now, ΔOMN and ΔOPQ are similar. This means that the side lengths are proportional to each other. We can write -

OP/OM = PQ/MN

12/OM = PQ/MN

12/(OP + PM) = PQ/MN

It is given that -

PQ = MP + 2

12/(OP + PM) = (MP + 2)/MN

12MN = (MP + 2)(OP + PM)

12 x 12 = (MP + 2)(MP + 12)

(MP)² + 12MP + 2MP + 24 = 144

(MP)² + 14(MP) - 120 = 0

Let MP = x, then we can write -

x² + 14x - 120 = 0

(x + 20)(x - 6) = 0

(x + 20) = 0   and    (x - 6) = 0

x = - 20   and   x = 6

x = 6      {Lengths cannot be negative}

Therefore, the measure of the length MP is equal to 6.

To solve more questions on similar triangles, visit the link below -

https://brainly.com/question/14926756

#SPJ1

On Melissa's 6th birthday, she gets a $2000 CD that earns 7% interest compounded quarterly. If the CD matures on her 13th birthday, how much money will be available?​

Answers

Answer:

[tex]A\simeq3250.83[/tex]

Step-by-step explanation:

The amount formula in compound interest is:

[tex]A=P(1+\frac{r}{n} )^{nt}[/tex]

where:

P = principal amount

r = annual interest

n = number of compounding periods

t = number of years

We already know that:

P = $2000

[tex]r = 7\% = \frac{7\%}{100\%}=0.07[/tex]

t = 7 (number of years from 6th to 13th bday)

n = 4 (quarterly in a year)

Then,

[tex]A=2000(1+\frac{0.07}{4} )^{(4)(7)}\\\\A=2000(1+\frac{0.07}{4} )^{28}\\\\A=3250.825792\\\\A\simeq3250.83[/tex]

HELP BRAINLIEST FOR FASTEST AND CORRECT NO NEED TO EXPLAIN

Answers

Answer:

The answer is 48

Step-by-step explanation:

Answer:

48 students

4*12=48

I need to know the steps in order to solve this math problem....Please briefly describe the steps

Answers

a) A function w(t) to represent the amount of water in the pool using the two functions is w(t) = -3t + 5.

b) The pool will leak out the water when w(t)=0.

c) It will take 1.67 hours to leak out all the water from the pool.

d) Yes, functions f(t) and d(t) will intersect on the graphs when the pool stops leaking all the water out.

e) The domain of the functions  f(t), d(t) and w(t) are 0 ≤ t ≤ 1.67.

What are functions?

A relation between a collection of inputs and outputs is known as a function. A function is, to put it simply, a relationship between inputs in which each input is connected to precisely one output.

Subtract the amount flowing into the pool by the amount being drained out the pool to get the amount of water in the pool .

The given functions are -

Flowing: f(t) = t² + 8t + 9.

Draining: d(t) = t² + 11t + 4.

The amount of water in the pool is -

w(t) = f(t) - d(t)

w(t) = t² + 8t + 9 - t² - 11t - 4

w(t) = -3t + 5.

Therefore, the function obtained is w(t) = -3t + 5.

When the condition is w(t) = 0 then, the pool will have leaked all the water.

Plugging in the values -

-3t + 5 = 0.

3t = 5

t = 1.67.

Therefore, the pool will leak all the water in 1.67 hours.

Functions f(t) and d(t) intersect on the graph when all the water of the pool has been leaked. The graph is shown below.

The domain of a function is the set that contains all input values of the function. The input is the time in the given situation, so -

Time cannot be negative, hence t ≥ 0.

When all the water has been drained, everything stops, hence t ≤ 1.67.

Therefore, the domain of the function is 0 ≤ t ≤ 1.67.

To learn more about function from the given link

https://brainly.com/question/22340031

#SPJ1

Explain how I do this please and thank you!

Answers

Answer:

Step-by-step explanation:

You need to add both of the angles you already know (1 and 2). If you add angle 1 and angle 2 you get 74. This means m < J K M would be 74°.

Answer:

74 degrees

Step-by-step explanation:

You have to add angles 1 and 2

35 +39=74

Therefore, 74 is the answer

Ben wants to buy a binder and some penicals from the school store.binders coast 2.25 each of the pencials coast 0.75 each.how much will it coasg ben to buy 1 binder and P penicals

Answers

The total cost for Ben to buy 1 binder and P pencils is 2.25 + 0.75 P.

What is Multiplication?

Multiplication of two numbers is defined as the addition of one of the number repeatedly until the times of the other number.

a × b means that a is added to itself b times or b is added to itself a times.

Cost of a binder = 2.25

Cost of a pencil = 0.75

We have to find the total cost for Ben to buy 1 binder and P pencils.

Cost of 1 binder = 2.25

Cost of P pencils = 0.75 × P = 0.75 P

Total cost of 1 binder and P pencils = 2.25 + 0.75 P

Hence the total cost for Ben to buy 1 binder and P pencils is 2.25 + 0.75 P.

To learn more about Multiplication, click on the link :

https://brainly.com/question/29558206

#SPJ1

( NO LINKS ) How many edges does this prism have? *

A. 4
B. 8
C. 12

Answers

Answer:

C. 12

Step-by-step explanation:

B: 8 is the correct answer.

Ellie ha been training for the Cedar Ridge Off-Road Race. The firt week he trained, he ran 3 day and took the ame two route each day: 2. 5 mile on a path in the wood in the morning and a longer route at the park in the afternoon. By the end of the week, Ellie had run a total of 24 mile. Which equation can you ue to find how many mile, x, Ellie ran each afternoon

Answers

The Distance that Ellie ran each evening is 16.5 miles for a entirety week.

How to find the number of miles?

We can use the following equation to find how many miles, x, Ellie ran each afternoon:

x + 2.5(3) = 24

Here, x represents the number of miles Ellie ran each afternoon, 2.5 represents the number of miles she ran each morning, and 3 represents the number of days she trained. The total number of miles she ran, 24, is on the right side of the equation.

To solve for x, we can start by simplifying the left side of the equation:

x + 7.5 = 24

Then, we can subtract 7.5 from both sides:

x = 16.5

So, Ellie ran 16.5 miles each afternoon.

To know more on equation at:

brainly.com/question/2972832

#SPJ4

A Chemistry book is moved 2 meters to the left and then 1 meter to the right. What is its displacement?

Answers

Answer:

1 meter to the Left

Step-by-step explanation:

Displacement is the distance between the start and ending points

By having it at first 2 meters to the left, then to move it back 1 meter to the right, you are subtracting from the initial movemnet to the left.

(2-1) = 1 meter to the Left

6. 175 is ___% of 125
7. ___is 120% of 720

Answers

Answer:

6.  175/125=x/100

Cross products  equal 125x=17500

Solve for x and you get 140%

7.  20% of 720 is 144.  You need to find 120% so add the full 720 (100%) to the 144 and you get 864 (120%)

Step-by-step explanation:

Answer:

6. 140%    7. 864

Step-by-step explanation:

Step for #1:

1.) 175 ÷ 125 = 1.4

2.) 1.0=100   0.4=40

3.) 1.4 = 140%

Answer; 140%

Step for #2:

1.) 120% × 720 = ?

2.) 120 x 720 = 86,400

3.) 86,400 ÷ 100 = 864

Answer; 864

What is the Value of P? 9=p÷9

Answers

Answer:

p = 81

Step-by-step explanation:

9 = [tex]\frac{p}{9}[/tex]  Multiply both sides by 9

9(9) = [tex]\frac{p}{9}[/tex][tex](\frac{9}{1})[/tex]  another name for 9  is [tex]\frac{9}{1}[/tex]

81 = p

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

Name the property that i hown by each equation. A. 6a 4 = 4 6a
B. 30 60 = 15(2 4)
C. 3(8x 4) = 3(4 8x)
D. 4(6a) = (4 · 6)a

Answers

A. Commutative property of addition

B. Distributive property

C. Commutative property of addition

D. Associative property of multiplication

Commutative property of addition: The commutative property of addition says that a change in the order of the numbers being added does not affect the sum. We define a commutative property of addition as adding the numbers in any order that will give the same answer.  

                                    a + b =b + a

        Here, a and b is whole numbers, integers or decimals, or even fractions.

Distributive property: According to this property, multiplying the summation of two or more addends by a number will give the same result as multiplying each addend individually by the number and then adding the products together. In other words, according to the distributive property, an expression of form A (B + C) can be solved as A (B+ C) = AB + AC.Associative property of multiplication:  The associative property of multiplication is defined as that while multiplying three numbers, regardless of the way the numbers are grouped, the end result will always be the same.

Read more about the distributive property:

https://brainly.com/question/2807928

#SPJ4

The complete question is:

Name the property that is shown by each equation.

A. 6a + 4 = 4 + 6a

B. 30 + 60 = 15(2 + 4)

C. 3(8x + 4) = 3(4 + 8x)

D. 4(6a) = (4 · 6)a

Left Riemann sum approximation Question...

Answers

The left Riemman sum approximation for f(x) = x^5, between x = 0 and x = 5, considering 5 intervals, is given as follows:

5.3248.

How to obtain the Riemman sum approximation?

First we must obtain the Delta value, which is the difference between the bounds of the integral, divided by the number of integrals, thus:

[tex]\Delta_x = \frac{b - a}{n} = \frac{2 - 0}{5} = 0.4[/tex]

Then the values of x at which the numeric values are calculated are obtained as follows:

[tex]x_i = a + \Delta_x(i - 1)[/tex]

Thus the values of x are of:

[tex]x_1 = 0[/tex].[tex]x_2 = 0.4[/tex][tex]x_3 = 0.8[/tex][tex]x_4 = 1.2[/tex][tex]x_5 = 1.6[/tex]

The numeric values are given as follows:

f(0) = 0^5 = 0.f(0.4) = 0.4^5 = 0.01024.f(0.8) = 0.8^5 = 0.32768.f(1.2) = 1.2^5 = 2.48832.f(1.6) = 1.6^5 = 10.48576.

Then the Riemann sum approximation for the integral is given as follows:

[tex]\sum_{i = 1}^{n} \Delta_x f(x_i)[/tex]

Thus:

0.4(0 + 0.01024 + 0.32768 + 2.48832 + 10.48576) = 5.3248.

More can be learned about Riemann sum approximation at https://brainly.com/question/7229305

#SPJ1

A hot air balloon is cruising at an altitude of 120 m above ground when it begins its descent the balloon descends at a rate of 4.5 m per minute explain how you would set up the equation to model when the balloon will reach an altitude of 75 m above ground then solve the equation and check your solution

Answers

The equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.

What is an equation?

An equation is a mathematical statement that is made up of two expressions connected by an equal sign. For example, 3x – 5 = 16 is an equation.

The balloon will reach an altitude of 75 meters above the ground.

Now, 120-75 =45 meters

Let t be the time to descends 45 meters

So, 120 - 4.5t= 75

= -4.5 t = 75-120

= -4.5t = -45

= t = -45/(-4.5)

= t = 10 minutes

Hence, the equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.

Learn more about equation at:https://brainly.com/question/22688504

#SPJ1

How can -6 1/3 be expressed as the sum of it's integer and fractional parts?
I'm giving 20 points for this one

Answers

Answer:

bottom left: -6 + (-1/3)

Step-by-step explanation:

hope this helps :)

It’s -6 + (-1/3) I think :)

Help me please?!!!!!!!!!

Answers

I think it’s the last one but I’m not sure

Answer:

Last option: f(x) = [tex]\sqrt[5]{\frac{x}{7} }[/tex]

Hope this helps!

pls help with question image is linked

Answers

The kilogram of fruits sold each day are 135 kg, 110 kg and 70 kg

How to determine the amount sold each day

From the question, we have the following parameters that can be used in our computation:

Day 2 = Day 1 - 25

Day 3 = 2/7 * (Day 1 + Day 2)

Total weights = 315

Next, we use the following representations

x = Day 1, y = Day 2 and z = Day 3

So, we have the following equations

y = x - 25

z = 2/7(x + y)

x + y + z = 315

Substitute y = x - 25 in z = 2/7(x + y) and x + y + z = 315

z = 2/7(x + x - 25) = 2/7(2x - 25)

x + y + z = 315 ⇒ x + x - 25 + z = 315

So, we have

z = 2/7(2x - 25)

2x + z = 340

Substitute z = 2/7(2x - 25) in 2x + z = 340

2x + 2/7(2x - 25) = 340

So, we have

7x + 2x - 25 = 1190

Evaluate the like terms

9x = 1215

Divide by 9

x = 135

So, we have

y = x - 25 = 135 - 25 = 110

z = 2/7(x + y) = 2/7 *(135 + 110) = 70

Hence, the amounts are 135 kg, 110 kg and 70 kg

Read more about equations at

https://brainly.com/question/2972832

#SPJ1

Other Questions
Find the product: 0.054 x 0.3 = ? OA. 0.162 ( B. 0.62. O c. 0.0162 O D. 0.00162 The linear impulse delivered by the hit of a boxer is 194 N s during the 0.416 s of contact. What is the magnitude of the average force exerted on the glove by the other boxer? Answer in units of N. I already got the answers for these but I wanted to check them. Im supposed to find the area and use 3.14 for pi. Thanks. The six departments of a company consisting of 22, 32, 18, 16, 10, and 12 employees have an equal monthly salary of P7200, P7600, P6900, P8200, P7800 and P7400 respectively. What is the mean monthly salary of all the employees of the company? What happens to the amount of nutrients needed as a cell increases in volume? What logical security concept ensures that all computers in a Windows Server environment adhere to the same policies Is it -Claim-CounterClaim-Rebuttal In Purple Hibiscus, Adichie characterizes ____ as _______ in order to ___________. For example when ___________ (events from the pages before your text evidence), _____________ writes, ___________ (##). This shows repeat your claim because ___________. Copy from your notes what you thought was so interesting/ why you liked/ hated this piece of text evidence. ILLL GIVE YOU SO MANY POINTS (50 IF YOU ANSWER CORRECTLY AND MARK YOU BRAINLIEST BUT IF YOU DONT I WILL FLAG YOUWhat is the probability that a point chosen at random in the given figure will be inside the larger triangle and outside the smaller triangle? Enter your answer, as a fraction in simplest form, in the box. P(inside larger triangle and outside smaller triangle) = help.pls it is urgent. Unit 5: Systems of Equations & InequalitiesHomework 3: Solving Systems by Elimination (Day 1) Which types of salts produce SO2 gas on reacting with acids? Arturo has 9 cups of dog food he gives his dog 1/3 cup of food at each meal how many meals does Arturo have for his dog What are the two most common types of economic systems in South and Southeast Asia?A.command economies and market economiesB.mixed economies and developing economiesC.command economies and traditional economiesD.mixed economies and traditional economiesPlease select the best answer from the choices providedABCD What happens to molecules when they move faster? Solve the inequality n - 4/7> - 2/3 When given a set of hypothetical ethical dilemmas, MBA students scored as high on unethical behavior as Multiple choice question. convicts in prison. doctors. liberal arts students. lawyers. find the L.C.M of 10,12,15 by division method Find the volume of the prism The chart above compares credit card offers. What is the most significant drawback to Credit Card 1 relative to the other cards? (1 point)Higher interest rateLow limitNo rewardsSecured credit