what is the moment of inertia of the object starting from rest if it has a final velocity of 5.5 m/s? express the moment of inertia as a multiple of mr2 , where m is the mass of the object and r is its radius.

Answers

Answer 1

The moment of inertia of an object starting from rest and reaching a final velocity of 5.5 m/s depends on the object's mass, shape, and distribution of mass.

The moment of inertia can be expressed as a multiple of mr², where m is the mass of the object and r is its radius. This is known as the moment of inertia for a solid sphere or cylinder, which have a uniform mass distribution. For example, the moment of inertia for a solid sphere is 2/5mr², while the moment of inertia for a solid cylinder rotating about its central axis is 1/2mr².

To know more about moment of inertia , here

brainly.com/question/15246709

#SPJ4


Related Questions

upiter is about five times as far from the sun as earth. therefore, the strength of sunlight at jupiter is about as strong as it is at earth. a. one-twenty-fifth b. one-fifth c. five times d. twenty-five times

Answers

Jupiter is about five times as far from the sun as earth. Therefore, the strength of sunlight at Jupiter is: about one-twenty-fifth as strong as it is at earth. Option (a) is the correct answer.

How is the strength of sunlight at Jupiter compared to that at Earth?

Jupiter is located at a distance of about 5.2 astronomical units from the sun. An astronomical unit (AU) is a unit of measurement that is used to calculate distances in space. It is the mean distance between the Earth and the Sun (149.6 million kilometers or 93 million miles).

So, Jupiter is approximately five times further from the Sun than the Earth. Due to this, the sunlight at Jupiter is much weaker than the sunlight at Earth. The strength of sunlight at Jupiter is about one-twenty-fifth as strong as it is at Earth.

To know more about "Astronomical unit" refer here:

https://brainly.com/question/30393278#

#SPJ11

if the temperature of a gas increases the pressure

Answers

If the temperature of a gas increases, the pressure of the gas will also increase, provided that the volume and the amount of the gas remain constant.

This is known as Gay-Lussac's law or the pressure-temperature law. The law states that the pressure of a fixed amount of gas is directly proportional to its absolute temperature, assuming that the volume is kept constant.

The reason for this behavior is that when the temperature of a gas increases, the average kinetic energy of its molecules also increases, which causes the molecules to move faster and collide with the walls of the container more frequently and with more force.As a result, the pressure exerted by the gas on the walls of the container also increases.

Conversely, if the temperature of the gas decreases, the pressure will also decrease, assuming that the volume and the amount of the gas remain constant.

For more details about temperature click here:

https://brainly.com/question/11464844#

#SPJ11

an rl circuit is connected to a voltage source. if we connected a capacitor in parallel with the rl circuit, and increase the capacitor size from 0 to infinity. what will happens to power factor?

Answers

An RL circuit is connected to a voltage source. If we connect a capacitor in parallel with the RL circuit, and increase the capacitor size from 0 to infinity, the power factor will increase.

What is power factor?

The power factor is the cosine of the phase angle between the current and voltage in the AC circuit. It refers to the ratio of active power to apparent power, and it is expressed as a decimal or a percentage. A high power factor implies that the circuit has an efficient use of power, whereas a low power factor implies that the circuit has a wasteful use of power.

What is RL circuit?

In an RL circuit, the voltage source is connected in series with a resistor and an inductor. This circuit provides a low-pass filter, which is utilized in many applications such as power supplies, voltage regulators, and audio amplifiers.

What happens when a capacitor is connected in parallel with an RL circuit?

When a capacitor is connected in parallel with an RL circuit, the circuit is referred to as an RLC circuit. The addition of the capacitor creates a second reactive element, which changes the overall impedance of the circuit. The impedance of the capacitor is negative, whereas that of the inductor is positive. Therefore, the total impedance of the circuit can be zero, positive, or negative, depending on the values of the components and the frequency of the signal.

What happens to power factor when we increase the capacitor size from 0 to infinity?

When we increase the capacitor size from 0 to infinity, the impedance of the capacitor approaches zero, whereas that of the inductor approaches infinity. Hence, the total impedance of the circuit approaches infinity. At this point, the circuit is purely resistive, and the power factor is unity (1).

Therefore, the power factor increases as the capacitor size increases from 0 to infinity.

Here you can learn more about RL circuit

https://brainly.com/question/29554839#

#SPJ11  

A block of wood is pushed against a relaxed spring to compress it 0.080 m. The spring constant of the spring is . Calculate the work W done by the block on the sprin

Answers

To calculate the work done by the block on the spring, we can use the formula:

W = (1/2) k x²

where W is the work done, k is the spring constant, and x is the displacement of the spring from its relaxed position.

In this case, we are given that the spring is compressed by 0.080 m,

so x = 0.080 m. We are also given the spring constant,

which we will assume is given in units of N/m.

Let's call the spring constant k.

Plugging in these values into the formula, we get:

W = (1/2) k x²

W = (1/2) (k) (0.080 m)²

W = 0.000256 k J

So the work done by the block on the spring is equal to 0.000256 times the spring constant, in units of joules.

Note that the work done by the block on the spring is equal in magnitude but opposite in sign to the work done by the spring on the block.

This is because the work-energy principle tells us that the net work done on an object is equal to its change in kinetic energy. In this case, the block is initially at rest, so its initial kinetic energy is zero.

Therefore, the work done by the block on the spring is equal in magnitude but opposite in sign to the work done by the spring on the block, which causes the block to gain potential energy in the spring.

To know more about work done , visit :

https://brainly.com/question/13662169

#SPJ1

When a block on a spring is compressed, the work done is calculated using the formula W = (1/2) kx2.

How to calculate the work W done by the block on the spring?

The work done W by the block on the spring can be calculated using the formula:

W = (1/2) kx^2

where k is the spring-constant, where x is the displacement of the spring from its given equilibrium-position.

Given that the spring is compressed 0.080 m and the spring-constant k is,

we can calculate the work done as follows:

W = (1/2) kx^2

W = (1/2)( )(0.080)^2

W = 0.08 J

Therefore, the work done by the block on the spring is 0.08 J.

To learn more about Work done, visit: https://brainly.com/question/25573309

#SPJ1

1. when a neutral metal sphere is charged by contact with a positively charged glass rod, the sphere a) gaining electrons b) gaining protons c) losing electrons d) losing protons 2. a glass rod is given a positive charge by rubbing

Answers

1. When a neutral metal sphere is charged by contact with a positively charged glass rod, the sphere loses electrons.

2. A glass rod is given a positive charge by rubbing it with a silk cloth.

The process of charging by contact occurs when a charged object is placed in contact with a neutral object, causing the neutral object to become charged. In this case, a positively charged glass rod is brought into contact with a neutral metal sphere, causing electrons to move from the sphere to the rod. As a result, the metal sphere loses electrons and becomes positively charged. On the other hand, a glass rod is given a positive charge by rubbing it with a silk cloth. This is known as charging by friction, and it occurs when electrons are transferred from one object to another as a result of friction between the two objects. In this case, electrons are transferred from the silk cloth to the glass rod, causing the rod to become positively charged.

Know more about electrons

https://brainly.com/question/860094

#SPJ11

What are contaminants

Answers

Contaminants are substances or agents that are present in a material or environment, frequently in unwanted or hazardous proportions, and which may harm the environment, and human health.

What is Chemical contaminants?

They include pollutants that are released from industrial operations, agricultural practices, or human activities, such as pesticides, heavy metals, volatile organic compounds (VOCs), and polychlorinated biphenyls (PCBs).

Explain Radiological contaminants.

They include pollutants that are released from industrial operations, agricultural practices, or human activities, such as pesticides, heavy metals, volatile organic compounds (VOCs), and polychlorinated biphenyls (PCBs).

to know more about contaminants here:

brainly.com/question/24324754

#SPJ9

An object with mass m is attached to the end of a spring with spring constant k, the object is displaced a distance d from equilibrium and released.
What is the speed v of the mass when it returns to the equilibrium position?

Answers

As the mass moves back towards its equilibrium point, its speed is zero.

The motion of the mass attached to the spring can be described using the equation of motion:

[tex]m(d^2x/dt^2) = -kx[/tex]

where x is the displacement of the mass from its equilibrium position, t is time, m is the mass of the object, and k is the spring constant.

We can solve this differential equation to obtain the displacement x as a function of time:

x(t) = A cos(wt) + B sin(wt)

where A and B are constants that depend on the initial conditions of the system, and w is the angular frequency of the oscillation:

w = sqrt(k/m)

To find the speed of the mass when it returns to the equilibrium position, we need to find the velocity v at that point. The velocity is the derivative of the displacement with respect to time:

v(t) = -Aw sin(wt) + Bw cos(wt)

At the equilibrium position, the displacement x is zero, so we have:

x(0) = A = d

v(0) = Bw = 0

Therefore, the displacement of the mass from its equilibrium position is:

x(t) = d cos(wt)

And the velocity of the mass at the equilibrium position is:

v(0) = -dw sin(0) + 0 = 0

v = 0.

Learn more about equilibrium here:

https://brainly.com/question/30807709

#SPJ1

The phenomenon of pressure waves emanating from the bullet, causing damage remote from its path, is known as: A. capitation. B. cavitation. C. congruent.

Answers

The phenomenon of pressure waves emanating from the bullet, causing damage remote from its path, is known as B. cavitation.

Cavitation occurs when a bullet passes through a medium, like air or water, at high velocity, causing the medium to compress and expand rapidly. The rapid compression and expansion create a series of shock waves that can cause damage beyond the path of the bullet itself. Cavitation can cause damage to objects as well as tissue and organs, as the shock waves cause significant disruption. The effects of cavitation can be seen in other forms of high-velocity projectiles, such as missiles. Cavitation can also be used in underwater applications to create shock waves that can be used to clear debris or even kill marine life.



In summary, cavitation is the phenomenon of pressure waves emanating from a bullet, causing damage remote from its path. This phenomenon can cause considerable damage beyond the path of the bullet, as well as having practical applications in underwater engineering. Therefore the correct option is B

Know more about cavitation here:

https://brainly.com/question/20713735

#SPJ11  

what is the mass of the page, if 500pages of the book is 2.5kg in total mass?
Kg:



mg:​

Answers

The mass of a single page of the book in kilogram and gram are is 0.005 kg and  5 grams respectively.

What is the mass of the page?

Mass is a dimensionless quantity representing the amount of matter in a particle or object.

Given that, 500 pages of the book is 2.5kg in total mass.

To find the mass of a single page, we need to divide the total mass of the book by the number of pages.

In this case, we have:

mass of 500 pages = 2.5 kg

Dividing both sides by 500, we get:

mass of 1 page = (2.5 kg) / 500

mass of 1 page = (2.5 kg) / 500

mass of 1 page = 0.005 kg

Converting kilogram to gram, multiply the mass by 1000.

mass of 1 page = 0.005 × 1000g

mass of 1 page = 5 gram

Therefore, the mass of a single page is 0.005 kg or 5 grams.

Learn more about mass here: https://brainly.com/question/19694949

#SPJ1

a car accelerates uniformly from rest and reaches a speed of 22.5 m/s in 8.95 s. (a) if the diameter of a tire is 58.6 cm, find the number of revolutions the tire makes during this motion, assuming that no slipping occurs. (b) what is the final angular speed of a tire in revolutions per second?

Answers

The number of revolutions the tire makes during this motion, assuming that no slipping occurs is 54 and the final angular speed of a tire in revolutions per second is 12.2 revolutions per second.

Given Data

Initial speed (u) = 0, Final speed (v) = 22.5 m/s, Time (t) = 8.95 s, Diameter of tire (d) = 58.6 cm = 0.586 m, Radius of tire (r) = d/2 = 0.293 m(a)

Number of revolutions the tire makes during this motion: The circumference of the tire is given as:

Circumference = πd = 3.14 x 0.586 = 1.84 m

Since there is no slipping, the distance covered by the car in 8.95 s is given by: d = ut + 1/2 at²,

Where acceleration (a) = (v - u)/t = 22.5/8.95 = 2.51 m/s²

Therefore, d = 0 x 8.95 + 1/2 x 2.51 x (8.95)² = 100 m

The number of revolutions of the tire during the motion can be given by the ratio of the distance covered by the circumference of the tire.

Revolutions = Distance covered/Circumference = 100/1.84 = 54.35 or 54 revolutions (approx.)

(b) The final angular speed of a tire in revolutions per second:

We can use the following formula to find the angular speed of the tire:

v = ωr

Where, v = final velocity, ω = angular velocity, and r = radius of the tire

So, ω = v/r = 22.5/0.293 = 76.8 rad/s

Number of revolutions per second = 76.8/2π = 12.23 or 12.2 revolutions per second (approx.)

Thus, the number of revolutions the tire makes during this motion, assuming that no slipping occurs is 54 and the final angular speed of a tire in revolutions per second is 12.2 revolutions per second.

To know more about angular speed, refer here:

https://brainly.com/question/29058152#

#SPJ11

A hot air balloon is hovering at a height of 52 m above the ground a penny is dropped from the balloon assume no air resistance how long does it take the penny to hit the ground?

Answers

Explanation:

We can use the kinematic equation for free-fall motion to find the time it takes for the penny to hit the ground:

h = 1/2 * g * t^2

where h is the height of the hot air balloon (52 m), g is the acceleration due to gravity (9.81 m/s^2), and t is the time it takes for the penny to hit the ground (which we want to find).

Solving for t, we get:

t = sqrt(2h/g)

Substituting the given values, we get:

t = sqrt(2 * 52 m / 9.81 m/s^2)

t = sqrt(10.5871 s^2)

t ≈ 3.26 seconds (rounded to two decimal places)

Therefore, it takes approximately 3.26 seconds for the penny to hit the ground.

A charged particle moves in some area and does not experience any magnetic force. We can conclude that:a. There is no magnetic field in this areab. There is no magnetic field in the area or there is magnetic field whose lines are parallel to particle's velocity.c. There is no magnetic field, or magnetic field is perpendiculer to particle's velocity.d. There is magnetic field parallel to particle's velocitye. There is magnetic field perpendicular to particle's velocity

Answers

No magnetic field, a magnetic field perpendicular to the particle's motion, a magnetic field parallel to the particle's velocity, or none at all.

When there is no magnetic force experienced by a charged particle travelling in a magnetic field?

So, if a charged particle in a magnetic field experiences no force, it is either at rest or travelling parallel to the magnetic field.

What circumstances must exist for a particle to feel force in a magnetic field?

A charged particle will always experience a force from the electric field of magnitude F equals q, E, F=qE. Only if a charged particle is travelling in tandem with the magnetic force will it experience its force.

To know more about magnetic force visit:-

https://brainly.com/question/3160109

#SPJ1

sort the following characteristics based on the type of unconventional hydrocarbon reserve they are associated with.

Answers

The classification is as follows, Tar Sand has following four characteristics:

associated with sandstone

very viscous bitumen

impermeable source

rock open pit mines

Shale Oil has the following two characteristics:

kerogen transformed into oil

extracted by hydrofracturing

Tar Sands and Shale Oil are two types of unconventional hydrocarbon reserves. Tar Sands are composed of sandstone, which contains very viscous bitumen that cannot flow freely due to its high viscosity, making it an impermeable source. This means that the bitumen cannot be extracted through traditional oil drilling methods and must instead be extracted using open-pit mining techniques.

On the other hand, Shale Oil is formed by the transformation of kerogen into oil and can be extracted through a process called hydrofracturing, which involves injecting fluids into the rock to create fractures that allow oil to flow more freely. Both types of unconventional hydrocarbons are significant energy resources, but they have environmental concerns associated with their extraction and use.

To know more about hydrocarbons, here

brainly.com/question/30927346

#SPJ4

--The complete question is, Sort the following characteristics based on the type of unconventional hydrocarbon reserve they are associated with. Items (6 items)

associated with sandstone

very viscous bitumen

impermeable source

rock open pit mines

kerogen transformed into oil

extracted by hydrofracturing--

3. the density of a block of wood is 0.73 g/cm3. its mass is 653 g. we tie the block to the bottom of a swimming pool using a single strand of string so that the block is entirely submerged. the block is trying to float to the surface, but the string holds it underwater. find the tension in the string.

Answers

Calculate the buoyant force acting on the block, which is equal to the weight of water displaced, using Archimedes' principle. The block's weight less the buoyant force equals the tension in the string.

To calculate the buoyant force, we need to determine the volume of water displaced by the block. The volume of the block is equal to its mass divided by its density, so we have: Volume of block = mass / density = 653 g / 0.73 g/cm3 = 894.5 cm3 Since the block is completely submerged, the volume of water displaced is also 894.5 cm3. The weight of this volume of water is: Weight of water = density of water x volume of water x acceleration due to gravity

= 1 g/cm3 x 894.5 cm3 x 9.81 m/s2

= 8,756.75 g ,Thus, the buoyant force acting on the block is 8,756.75 g or 8.75675 N. Since the block is trying to float to the surface, the buoyant force acts upwards and the tension in the string acts downwards. Therefore, the tension in the string is: Tension in string = weight of block - buoyant force

= 653 g x 9.81 m/s2 - 8.75675 N

= 6,263.63 N - 8.75675 N

= 6,254.87 N , Therefore, the tension in the string is approximately.

learn more about density here:

https://brainly.com/question/15164682

#SPJ4

One end of a metal rod is placed over a flame during an investigation. A thermometer is touching the opposite end of the metal rod. Which BEST describes what is happening during this investigation?
A. Convection carries heat to the thermometer.
B. Radiant energy warms the thermometer.
C. Mechanical energy from the flame carries heat to the thermometer.
D. Heat from the flame is conducted through the metal rod to the thermometer.

Answers

The correct answer is (a), as the thermometer receives heat from tradition. Conventional heat transfer involves the movement of large numbers of molecules, therefore heat will pass from the heating potential portion to the opposing portion of the thermometer.

The heated end of such an iron rod causes its atoms to vibrate more quickly when it is placed in a flame. With their nearby atoms, these atoms vibrate.

Free electrons that are able to float through the metal jiggle and exchange energy by slamming against atoms and other electrons.

The metal of the rod directly above it receives the electron transport. This portion of the rod has a higher thermal energy content, making it hotter. Dispersion, conduction, nonlinear thermal, and evaporative cooling are a few of the several types of heat transmission methods.

To know more about potential click here

brainly.com/question/9605409

#SPJ4

1. Describe the work done as positive, negative or no work

cable is attached to a bucket and the force of tension is used to pull the bucket out of a well.


2. Describe the work done as positive, negative or no work

A busy spider hangs motionless from a silk thread, supported by the tension in the thread.


3. Describe the work done as positive, negative or no work

Rusty Nales uses a hammer to exert an applied force upon a stubborn nail to drive it into the wall

Answers

Positive work is done when an object is moved in a positive direction. When an object is moving in the same direction as the force being applied, this is considered positive work. As an illustration, an object falling to the ground does so in the direction of gravity.

The work is referred to be positive work done since gravity is pushing downward in the direction of the falling object. Every force used to move an object in a particular direction constitutes work. We distinguish between positive and negative work done based on whether an object moves in the direction of the force or away from it. Work performed is considered to be 0 if there is absolutely no displacement. It is crucial to keep in mind that whereas force and displacement are both vector concepts, work is a scalar quantity.

Learn more about positive work here:

https://brainly.com/question/10063455

#SPJ4

Kim and Julio go to a raceway to watch Julio's older brother, Raul, compete. Raul's car
covers the 2.5 km in 12 seconds, reaching a speed of 180 km/h. Use the equation below
to determine the rate of acceleration of Raul's car.
In this equation, a is acceleration, v is the final velocity, v; is the initial velocity, and
t is time. (Hint: The initial velocity is 0 km/h.)
What is the acceleration of Raul's car?
a =
(Vy-vi)
t

Answers

Explanation:

U=0

V=180 km/h

T=12 sec

A=(v-u)÷t

=(180-0)÷12

=180÷12

=15km/h

Hence, the acceleration of the car is 15km/h

Io has the most volcanic activity in the Solar System because
a. it is continually being bombarded with material in Saturn's E Ring.
b. it is one of the largest moons and its interior is heated by radioactive decays.
c. of gravitational friction caused by the moon Enceladus.
d. its interior is tidally heated as it orbits around Jupiter.
e. the ice on the surface creates a large pressure on the water below.

Answers

Io has the most volcanic activity in the Solar System because its interior is tidally heated as it orbits around Jupiter. The correct answer is Option D.

What is Io?

Io is one of the four largest moons of Jupiter, which is the fifth planet from the Sun in our Solar System. Io has the most volcanic activity in the Solar System.

What causes Io's volcanic activity?

Io's interior is tidally heated as it orbits around Jupiter. Tidal heating occurs due to the gravitational forces of the planet Jupiter and other moons around Io. The gravitational tug and pull of these celestial bodies causes friction within Io, which then produces intense heat, enough to melt the rock and lead to volcanic eruptions.

As a result of this tidal heating, Io is the most volcanically active object in our Solar System with over 400 active volcanoes on its surface. Its volcanic activity is also what gives Io its unique appearance, with colorful, sulfur-rich terrain.

What are the other moons of Jupiter?

Jupiter has four largest moons that are known as Galilean Moons. These moons are named after the astronomer Galileo Galilei who discovered them in 1610. The four Galilean Moons are Io, Europa, Ganymede, and Callisto.

Learn more about Tidal heating here: https://brainly.com/question/13132459

#SPJ11

describe the characteristics of the various kinds of interstellar gas (hii regions, neutral hydrogen clouds, ultra-hot gas clouds, and molecular clouds)

Answers

Interstellar gas is the gas that fills the areas between stars in a galaxy. There are different kinds of interstellar gases. The characteristics of the different kinds of interstellar gas are given below:

HII Regions: An HII region is a region of hydrogen gas that has been ionized. This ionization is usually caused by high-energy ultraviolet light from hot stars. HII regions typically contain about 90% hydrogen and 10% helium, with trace amounts of other elements. Neutral hydrogen clouds: Neutral hydrogen clouds are regions of space that contain mostly molecular hydrogen. These clouds are very cold, typically around -260°C, and have very low densities. Neutral hydrogen clouds are often found in the outer regions of galaxies. Ultra-hot gas clouds: Ultra-hot gas clouds are regions of space that are extremely hot and have very high densities. These clouds are often found around black holes or other highly energetic objects. Ultra-hot gas clouds are typically composed of ionized hydrogen and helium, along with trace amounts of other elements.

Molecular clouds: Molecular clouds are regions of space that contain large amounts of molecular hydrogen. These clouds are typically very cold, with temperatures around -250°C. They are also very dense, with densities that can be thousands of times greater than the density of the interstellar medium. Molecular clouds are important because they are the birthplaces of stars. When a molecular cloud collapses, it can form a protostar, which will eventually become a main-sequence star.

Learn more about Interstellar gas at: brainly.com/question/13034266

#SPJ11

One of the characteristics of ocean water that causes ocean currents is salinity. Differences in salinity can generate movement in the ocean because the amount of dissolved salt in ocean water correlates to–how quickly it evaporates.its ability to conduct electricity.the latitude where it is found.the density of the water.

Answers

"One of the characteristics of ocean water that causes ocean currents is salinity. Differences in salinity can generate movement in the ocean because the amount of dissolved salt in ocean water correlates to the density of the water."

The water molecules in the ocean increase as they warm up. This growth provides more space for storage, which salt and other materials like calcium can fit into. So, as warmer water contains more salt and other particles than cold water, it may have a higher salinity. In order to connect salt water concentration to ocean currents, salt water is more concentrated at higher salinities.

When the salinity is high enough, the water will settle, resulting in a convection circulation. This indicates that the density, salinity, and temperature of the ocean water can actually cause a current's normal flow to reverse, allowing cold water to layer on top of warm water if the latter has enough salt content.

To know more about salinity:

https://brainly.com/question/2752734

#SPJ4

what is the final velocity (in m/s) of a hoop that rolls without slipping down a 6.50-m-high hill, starting from rest?

Answers

Answer:

Approximately [tex]7.99\; {\rm m\cdot s^{-1}}[/tex].

(Assuming that [tex]g = 9.81\; {\rm N \cdot kg^{-1}}[/tex] and that the thickness of the loop is negligible.)

Explanation:

Let [tex]m[/tex] denote the mass of the hoop, and let [tex]r[/tex] denote its radius.

Under the assumptions, the moment of inertia of this hoop would be:

[tex]\displaystyle I = m\, r^{2}[/tex].

Let [tex]v[/tex] denote the linear velocity of the hoop at the bottom of the hill. The linear kinetic energy of the hoop would be:

[tex]\displaystyle \frac{1}{2}\, m\, v^{2}[/tex].

Since the hoop is rolling without slipping, its angular velocity would be [tex]\omega = v / r[/tex]. The rotational kinetic energy of the hoop would be:

[tex]\begin{aligned}\frac{1}{2}\, I\, \omega^{2} &= \frac{1}{2}\, (m\, r^{2})\, \left(\frac{v}{r}\right)^{2} \\ &= \frac{1}{2}\, \frac{m\, r^{2}\, v^{2}}{r^{2}} \\ &= \frac{1}{2}\, m\, v^{2}\end{aligned}[/tex].

The total kinetic energy of the hoop (linear and rotational) would be:

[tex]\begin{aligned}& \frac{1}{2}\, m\, v^{2} + \frac{1}{2}\, I\, \omega^{2} \\ =\; & \frac{1}{2}\, m\, v^{2} + \frac{1}{2}\, m\, v^{2} \\ =\; & m\, v^{2} \end{aligned}[/tex].

Assuming that total mechanical energy is conserved. Change in the Kinetic energy that the loop has gained would be the opposite of the change in the gravitational potential energy (GPE):

[tex]\begin{aligned}(\text{change in GPE}) &= m\, g\, \Delta h\end{aligned}[/tex],

Where:

[tex]g = 9.81\; {\rm N\cdot kg^{-1}}[/tex] by assumption, and[tex]\Delta h = (-6.50)\; {\rm m}[/tex] is the change in the height of the hoop.

By the conservation of energy:

[tex](\text{change in KE}) + (\text{change in GPE}) = 0[/tex].

[tex]m\, v^{2} + m\, g\, \Delta h = 0[/tex].

Solve for [tex]v[/tex]:

[tex]\begin{aligned}m\, v^{2} &= m\, g\, (-\Delta h)\end{aligned}[/tex].

[tex]\begin{aligned}v &= \sqrt{g\, (-\Delta h)} \\ &= \sqrt{(9.81)\, (-(-6.50))}\; {\rm m\cdot s^{-1}} \\ &\approx 7.99\; {\rm m\cdot s^{-1}}\end{aligned}[/tex].

In other words, the velocity of the loop would be approximately [tex]7.99\; {\rm m\cdot s^{-1}}[/tex] at the bottom of the hill.

during which phase of the moon do we see the entire lighted side of the moon? responses new moon new moon waning gibbous waning gibbous full moon full moon first quarter

Answers

The entire lighted side of the moon is visible during the Full Moon phase. The other phases of the moon are the New Moon, the Waning Gibbous, and the First Quarter.

for more questions related to the moon, refer here:

https://brainly.com/question/13538936#

#SPJ11

iron-60 is formed during supernovae (exploding stars). it decays into cobalt-60 with a half-life of 2.6 million years. suppose astronomers look at a supernova remnant and find that 71% of the iron-60 has decayed. how many years ago did the star explode?

Answers

The star exploded approximately: 3.3 million years ago.

We can use the radioactive decay equation to solve this problem, which is:
N = N₀ (1/2)^(t/t₁/₂)
where N is the current amount of the radioactive substance, N₀ is the initial amount, t is the time elapsed since the decay started, and t₁/₂ is the half-life of the substance.

Let's assume that the initial amount of iron-60 was 100 units, and that 71% of it has decayed. Then the current amount of iron-60 is:
N = 100 - 0.71(100) = 29
Substituting these values into the decay equation, we get:
29 = 100 (1/2)^(t/2.6×10^6)

Dividing both sides by 100 and taking the logarithm of both sides, we get:
log(0.29) = (t/2.6×10^6) log(1/2)

Solving for t, we get:
t = -2.6×10^6 × (log(0.29) / log(1/2)) ≈ 3.3 million years

To know more about "Radioactive decay" refer here:

https://brainly.com/question/1770619#

#SPJ11

you have designed and constructed a solenoid to produce a magnetic field equal in magnitude to that of the earth (5.0 10-5 t). if your solenoid has 550 turns and is 30 cm long, determine the current you must use in order to obtain a magnetic field of the desired magnitude.

Answers

The current that must be used in order to obtain a magnetic field of the desired magnitude is 40.9 µA.

When designing and constructing a solenoid to produce a magnetic field that is equal in magnitude to that of the earth (5.0 x 10^-5 T), the current required to obtain the desired magnitude of the magnetic field must be determined. The solenoid has 550 turns and is 30 cm long. To determine the current required, the equation for the magnetic field produced by a solenoid is used.

The equation for the magnetic field produced by a solenoid is as follows: B = (μ₀ * n * I) / L

where B is the magnetic field, μ₀ is the permeability of free space, n is the number of turns per unit length (in this case, per meter), I is the current, and L is the length of the solenoid.

In this problem, the values of B, n, and L are known. B = 5.0 x 10^-5

Tn = 550 turns / 0.30 m = 1833.33 turns/mL = 0.30 m

Substituting the known values into the equation and solving for I gives:

I = (B * L) / (μ₀ * n) = (5.0 x 10^-5 T * 0.30 m) / (4π x 10^-7 Tm/A * 1833.33 turns/m)

I = 0.0000409 A = 40.9 µA

Therefore, the current required to obtain a magnetic field of the desired magnitude is 40.9 µA.

For more such questions on Magnetic field.

https://brainly.com/question/23096032#

#SPJ11

A star of spectral type O lives approximately how long on the main sequence? A) 1,000 years. B) 10,000 years. C) 10 million years. D) 100 million years

Answers

1,000,000 years from now, (a) is the right response. Let's say you spot two stars belonging to the identical spectral class that are main-sequence stars. By something like a factor of 100, Star 1 seems to be brighter than Star 2 in terms of visual brightness.

Which O-type star is the closest?

Only an estimation of these stars' distances may be made by astronomers: Zeta () Ophiuchi, the nearest O-type star, is located around 370 light-years distant, whereas Gamma2 (2) Velorum, the nearest Wolf-Rayet star, is located upwards of 1,000 light-years away.

How quickly a star burns through its nuclear fuel determines how long it will last. With enough fuel to last for approximately five billion years, our sun, that is in numerous respects an ordinary type of star, has indeed been existing for about five billion years.

To know more about nuclear click here

brainly.com/question/18187269

#SPJ4

what physics factor contributes to the accuracy of a fired bullet

Answers

The speed at which the bullet leaves the barrel of the firearm is an important factor in determining accuracy.

What is Velocity?

Velocity is a term used in physics to describe the speed and direction of an object's motion. More specifically, it is the rate at which an object changes its position in a particular direction over time. Velocity is a vector quantity, which means that it has both magnitude (the speed of the object) and direction.

Spin rate: Bullets are designed to spin as they travel through the air, which stabilizes them and reduces the effect of wind and other environmental factors. The rate of spin is influenced by the rifling of the barrel and the bullet's shape and weight.

Bullet weight and shape: The weight and shape of the bullet also affect its trajectory and accuracy. A heavier bullet will generally be more stable in flight and less affected by wind, while a more streamlined shape will reduce air resistance and maintain velocity over longer distances.

Barrel quality and length: The quality of the barrel and its length can also affect accuracy. A high-quality barrel with a smooth bore and consistent rifling will produce more

Learn more about Velocity from the given link

https://brainly.com/question/24445340

#SPJ1

what is the gravitational force between the earth and the moon if they are 3.84x100000000m apart? The mass of the earth is 5.98x1000000000000000000000000 and the moons mass is 7.35x10000000000000000000000

Answers

Answer:

1.98 × 10^20 Newtons.

Explanation:

To calculate the gravitational force between the Earth and the Moon, we can use Newton's law of gravitation:

F = G * (m1 * m2) / r^2

where F is the gravitational force, G is the gravitational constant (6.6743 × 10^-11 N m^2/kg^2), m1 and m2 are the masses of the Earth and Moon respectively, and r is the distance between the centers of mass of the Earth and Moon.

Plugging in the given values, we get:

F = (6.6743 × 10^-11 N m^2/kg^2) * ((5.98 × 10^24 kg) * (7.35 × 10^22 kg)) / (3.84 × 10^8 m)^2

Simplifying this expression, we get:

F = 1.98 × 10^20 N

Therefore, the gravitational force between the Earth and the Moon is approximately 1.98 × 10^20 Newtons.

Answer:

We can use the formula for gravitational force:

F = G * (m1 * m2) / d^2

where:

G = gravitational constant = 6.67430 × 10^-11 m^3 kg^-1 s^-2

m1 and m2 are the masses of the two objects in kilograms

d is the distance between their centers in meters

F is the gravitational force in Newtons

Plugging in the values:

F = 6.67430 × 10^-11 * ((5.98x10^24) * (7.35x10^22)) / (3.84x10^8)^2

F = 1.99x10^20 N

Therefore, the gravitational force between the earth and the moon is approximately 1.99x10^20 Newtons.

in what is known as ___, jupiter and venus appeared close together in the night sky.

Answers

In what is known as conjunction, Jupiter and Venus appeared close together in the night sky.

Inside Los Angeles Jupiter and Venus appear to be passing each other extremely closely in the night sky during a conjunction.

Each planet reflects a different quantity of light. Because of their makeup and atmosphere, certain planets are unable to reflect a sizable amount of light. Yet, Venus is surrounded by incredibly thick clouds of gases and sulfuric acid. These clouds reflect light because sunlight easily bounces off of them. Venus' surface reflects around 75% of the sunlight that strikes it.

Venus is also extremely visible due to its proximity to Earth. The fact that it is somewhat close to the Sun (although Mercury is closest) and quite visible makes it in an ideal position for reflecting sunlight towards the earth.

To know more about  Jupiter

https://brainly.com/question/20984718

#SPJ4

Hannah heats a beaker of water using a burner, as shown in the diagram.

Which statement best describes the movement of water molecules in Hannah's beaker, represented by the arrows in the diagram?


Water molecules move slower near the bottom of the beaker where they are hotter, but then move faster as they cool and rise due to conduction.

Water molecules move faster near the bottom of the water where they are hotter, but then move slower as they cool and rise due to radiation.

Water molecules move slower near the bottom of the beaker where they are hotter, but then move faster as they cool and rise due to convection.

Water molecules move faster near the bottom of the beaker where they are hotter, but then move slower as they cool and rise due to convection.

Answers

Water molecules travel more quickly when they are hotter, close to the bottom of the beaker, but they slow down as they cool and rise due to convection.

What transpires when water droplets are heated?

The water molecules spread out more and travel more quickly when the water is heated. Due to this, hot water is less dense than water at ambient temperature. Since heated water is less dense than room-temperature water, it floats on it.

How does a hob placed below a container of water heat it up?

Moving downward and towards the heat source is the cold water from the edges. Additionally heated, this water raises, and water from the sides moves downward. This procedure keeps going until the water is heated throughout.

To know more about molecules visit:-

https://brainly.com/question/19922822

#SPJ1

a generator consists of a rectangular coil 84 cm by 1.5 m , spinning in a 0.14-t magnetic field.if it's to produce a 60- hz alternating emf with peak value 6.3 kv , how many turns must it have?

Answers

The generator needs to have 560 turns in order to produce a 60 Hz alternating EMF with a peak value of 6.3 kV.

EMF stands for electromotive force, and it is the voltage created by a power source such as a battery or generator. Voltage is generated by an EMF, which causes a current to flow in a circuit. When the magnetic flux through a wire loop changes, an EMF is generated in the coil according to Faraday's law. The magnitude of the EMF is proportional to the rate at which the flux changes.The formula for calculating EMF is

EMF = dϕ / dt

where dϕ is the change in magnetic flux and dt is the change in time.

The generator must generate a 60 Hz alternating EMF with a peak value of 6.3 kV using a rectangular coil that is 84 cm by 1.5 m and spins in a 0.14 T magnetic field. according to the question. Let us use the equation to solve for N, the number of turns required:

EMF = NBAf

where N is the number of turns, B is the magnetic field in tesla, A is the area of the coil in m², f is the frequency in Hz

EMF = Peak voltage √2 = 6.3kV√2 = 8915.5 V

Area of the coil, A = l × w = 84 × 1.5 = 126 m²

Frequency, f = 60 Hz

Magnetic field, B = 0.14

TN = EMF / (BAf) = 8915.5 / (0.14 × 126 × 60) ≈ 560 turns

Therefore, In order to produce 60 Hz alternating emf with peak value 6.3 KV, a generator consisting of a rectangular coil 84 cm by 1.5 m, spinning in a 0.14-t magnetic field must have 560 turns

Learn more about magnetic fields, turns, emf at: https://brainly.com/question/15282712

#SPJ11

Other Questions
How to calculate Standard Error of the Y intercept and standard error of the slope, given the table below, without the SE coefficient given. the wto polices the world trading system and without this organization, the globalization of markets might not be where it is today. true/false What is the factored form of the polynomial? x2 15x 36 (x 4)(x 9) (x 3)(x 12) (x 4)(x 9) (x 3)(x 12) The correct reaction showing how FeCO3 has increased solubility when forming the complex ion Fe(CN)64- is ____ A) FeCO3 (aq) + 6 CN- (aq) Fe(CN).- (aq) + CO32- (aq) B) FeCO3 (s) + 6 CN- (aq) Fe(CN)64- (aq) + CO32- (aq) C) Fe2+ (aq) + 6 CN- (aq) Fe(CN)64- (aq) D) FeCO3 (s) = Fe2+ (aq) + CO32- (aq) What does this change in rock layers tell the geologist about Earth's history in the area where these layers formed If you have 7.22 x 1023 atoms of chromium (Cr), how many moles of chromium do youhave?O.98 moles CrO 1.62 moles CrO 1.36 moles CrO 1.19 moles Cr What is the measure of N?A) 23B) 25C) 27D) 45 Which of the following did the Soviet Union (USSR) not achievebefore the United States?First artificial satellite in spaceFirst man in spaceFirst woman in spaceFirst man on the moon Two stores have a laptop computer for sale.Part A: Store A is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store A.Part B: Store B is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store B.Part C: Which store should you purchase the laptop from? Use details to support your answer. (T/F) the ticketing area is more secure than the area beyond the security check point Jozef "accidentally" broke his piggy bank to find a total of 42 dimes and quarters. If the coins totaled $8.25, how dimes did he have in his piggy bank? How many quarters? the passage data regarding the thermal stability and enzyme activity of mkr681h is most consistent with what conclusion regarding the role of arg681 in cct? QuestionThe colours of red litmus paper in acidic, neutral, and basic solutions are:Ared, orange and blue respectivelyBblue, violet and red respectivelyCred, colourless and blue respectivelyDred, red and blue respectivelyHard 4.5 Draw a diagram representing the scenario and find the requested value. A man is standing 270 feet from the base of a statue. If he man looks up at an angle of 34 degrees to see the top of the statue, how tall is the statuePlease round to the nearest whole foot. chris rents a booth at a flea market at a cost of $75 for one day. at the flea market chris sells picture frames each of which costs him $6.00. if chris sells each picture frame for $13, how many picture frames must he sell to make a profit of at least $200 for that day? which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ?