Which one of the following is a strong electrolyte?A Carbon disulfideB Ammonium hydroxideC Sodium chlorideD Water

Both hydrogen peroxide and water are made from hydrogen and oxygen but they are different compounds with distinct properties and uses. Additional oxygen atom in hydrogen peroxide gives it its distinct chemical and physical properties, which are different from water.

Both hydrogen peroxide (H2O2) and water (H2O) are made from hydrogen and oxygen but they are different compounds with distinct properties and uses.

Primary  difference between hydrogen peroxide and water is their chemical structure. Hydrogen peroxide has an additional oxygen atom when compared to water and this makes its chemical and physical properties different from that of water.

Hydrogen peroxide is a clear, colorless liquid with bitter taste and slight odor. It is a powerful oxidizing agent, which implies that it readily reacts with other substances including metals, organic compounds and other chemicals. Water is a clear, colorless liquid with no taste or odor. It is a stable compound that does not readily react with other substances.

To know more about hydrogen peroxide, refer

https://brainly.com/question/25566753

#SPJ1

Yes, it is possible to speed up a slow reaction without increasing the temperature or increasing the concentration of reactants by using a catalyst.

A slow reaction can be sped up which can be done by providing an alternative reaction pathway with a lower activation energy. This is known as catalyzing the reaction, and it is done by adding a catalyst which acts as an intermediate in the reaction pathway, thus reducing the activation energy and enabling the reaction to occur at a faster rate.

Catalysts can be in the form of enzymes, such as those found in organisms, or chemical catalysts, such as the acids used in acid-catalyzed reactions. These catalysts speed up reactions by providing an alternative pathway to form the product with a lower activation energy than the non-catalyzed reaction. In other words, they provide an alternate way to get to the product faster. Catalysts may be in the form of a solid, liquid, or gas and can also be homogeneous or heterogeneous.

In summary, it is possible to speed up a slow reaction without increasing the temperature or increasing the concentration of reactants by providing an alternative reaction pathway with a lower activation energy using a catalyst.

For more such questions on Catalysts.

https://brainly.com/question/864515#

#SPJ11

If you add 5 ml of 0.5 M NaOH solution to 20 ml each of buffer B (with a pH of 4.03) and buffer C, the buffer whose pH will change the least is buffer B.

What is a buffer?

A buffer is a solution that resists changes in pH when acid or alkali is added. A buffer solution is a solution that contains a weak acid and its corresponding weak base or a weak base and its corresponding weak acid.

The Henderson-Hasselbalch equation can be used to calculate the pH of a buffer solution before and after adding a strong base or acid.

The equation is pH = pKa + log ([A-]/[HA])

where:pKa is the dissociation constant for the acid[A-] is the conjugate base of the acid when a command (such as NaOH) is added to a buffer solution, the base reacts with the weak acid to form the conjugate base of the acid and water. The addition of the conjugate base of the acid causes the pH of the solution to rising.

When an acid (such as HCl) is added to a buffer solution, the acid reacts with the weak base to form the conjugate acid of the base and water. The addition of the conjugate acid of the base causes the pH of the solution to decrease. Based on the above equation, pH change will be minimum in Buffer B. Therefore, the buffer whose pH will change the least is buffer B.

#SPJ11

to learn more about buffer : https://brainly.com/question/24262133

The electron transport chain (ETC) is a series of membrane-bound proteins that transfer electrons from electron donors (such as NADH and FADH₂) to electron acceptors (such as oxygen) through a series of redox reactions.

The ETC plays a critical role in aerobic respiration and is responsible for generating a proton gradient across the mitochondrial inner membrane, which is used to generate ATP through the process of oxidative phosphorylation.

Therefore, the event that takes place in the electron transport chain is the harnessing of energy from redox reactions to generate a proton gradient. This occurs as electrons are passed along the ETC and are used to pump protons (H⁺) from the matrix into the intermembrane space. This creates a proton gradient that is used by ATP synthase to generate ATP from ADP and Pi.

The other events mentioned, such as the breakdown of an acetyl group to carbon dioxide and the breakdown of glucose into six carbon dioxide molecules, occur earlier in cellular respiration during glycolysis and the citric acid cycle. Substrate-level phosphorylation, on the other hand, occurs during glycolysis and the citric acid cycle and involves the direct transfer of a phosphate group from a substrate molecule to ADP to generate ATP.

To learn more about electron  refer to:

brainly.com/question/28977387

#SPJ4

No color change would occur; it would not be clear when the equivalence point was reached. Option A

In titration, an indicator is a substance that is used to signal the endpoint of the titration by changing color. The use of an indicator is important in titration as it helps to determine when the reaction is complete.

During a titration, a solution of known concentration, called the titrant, is added to a solution of unknown concentration, called the analyte, until the reaction is complete. The point at which the reaction is complete is called the endpoint. At the endpoint, the stoichiometric amount of titrant has reacted with the analyte, and no more titrant is required to complete the reaction.

Learn more about equivalence point:https://brainly.com/question/29999744

#SPJ1

The final concentration of the solution after the dilution is: 0.425 M.

Dilution is a process that occurs when a solution is weakened by adding more solvent to it.

The formula for dilution is: (C1V1) = (C2V2),
where, C1 is the initial concentration of the solution,
V1 is the initial volume of the solution,
C2 is the final concentration of the solution, and
V2 is the final volume of the solution.

The values of V1 and V2 are often equal for simple dilutions.

Let's solve the problem now:

To know more about "Concentration" refer here:

https://brainly.com/question/4184101#

#SPJ11

The electrons that are used in the light reactions of photosynthesis are provided by water (H2O), so the correct answer is (c) H2O.

During the light reactions, light energy is absorbed by the photosystems in the thylakoid membranes of chloroplasts, and this energy is used to split water molecules into oxygen gas (O2), protons (H+), and electrons (e-). The electrons are then used to power the electron transport chain, ultimately leading to the generation of ATP and NADPH, which are used in the Calvin cycle to fix carbon dioxide (CO2) into organic molecules.

The light reactions are located in the thylakoid membrane of the chloroplast, which is also where the pigments (chlorophyll a and b) are located. When a photon of light hits a chlorophyll molecule, it excites the electron to a higher energy level, kicking off a series of reactions that eventually leads to the production of ATP and NADPH. The energy from these molecules is then used to drive the reactions of the Calvin cycle, which produce glucose, sucrose, and other sugars. So, light is the source of energy for photosynthesis to occur. Hence, light provides the electrons that are used in the light reactions. Option C.

for more such question on light reactions

https://brainly.com/question/27957921

#SPJ11

The correct option is pH > 7. For the titration of a frail corrosive with a solid base, the pH bend is at first acidic and has a fundamental comparability point (pH > 7).

The motivation behind a solid corrosive solid base titration is to decide the grouping of the acidic arrangement by titrating it with an essential arrangement of known focus, or the other way around until neutralization happens. As both the corrosive and base areas of strength are (upsides of Ka and Kb), the two of them will completely separate, and that implies every one of the particles of corrosive or base will totally different particles.

At the comparability point, equivalent measures of H+ and Gracious particles will join to frame H2O, bringing about a pH of 7.0 (neutral). The pH at the identicalness point for this titration will continuously be 7.0, note that this is valid just for titrations of a solid corrosive with a solid base.

Likewise, the anion (negative particle) made from the separation of the corrosive joins with the cation (positive particle) made from the separation of the base to make a salt. In this way, the response between a solid corrosive and a solid base will bring about water and salt.

to know more about acids click here:

https://brainly.com/question/25148363

#SPJ4

The ranking of the given carboxylic acids in order of increasing acid strength is as follows: B < A < D < C.

The reason for this trend is that electron-withdrawing fluorine atoms in the carboxylic acids increase the acidity of molecule by withdrawing electron density from the carboxyl group, which makes it easier to release a proton. The more electron-withdrawing the substituents, more acidic the carboxylic acid. In this case, compound C has the strongest electron-withdrawing group (CF3), which makes it most acidic of the four. Compound D has a weaker electron-withdrawing group (CHF2), making it less acidic than C but more acidic than B. Therefore, the acid strength of the given carboxylic acids can be ranked as: C > D > A > B.

To know more about carboxylic acids , here

brainly.com/question/31050542

#SPJ4

The solution has a molarity of 0.2108 M. (molar).

Molarity (M), which is determined by dividing the solute's mass in moles by the volume of the solution in litres, is the most often used unit to represent solution concentration: litres of solution/moles of solute equals M.

We need to know how many moles of copper (II) sulphate are dissolved in the solution in order to determine the molarity of the solution.

moles = mass / molar mass

The molar mass of copper (II) sulphate is 159.609 g/mol. The finding is that the solution has the following moles of copper (II) sulphate in it:

moles = 50.5 g / 159.609 g/mol

moles = 0.3162 mol

We can now determine the molarity of the solution using the definition of molarity:

molarity = moles / volume

molarity = 0.3162 mol / 1.5 L

molarity = 0.2108 M

To know more about molarity visit:-

https://brainly.com/question/8732513

#SPJ1

always wear chemical splash goggles for eye protection when working with chemicals.

One or both eyes may be affected by the prevalent condition known as red eye. The blood vessels on the surface of your eye that are enlarged (dilated) as a result of an irritation or infection are the source of the redness associated with red eyes.
Bleach and paint thinner are two of the most popular caustic agents that can irritate skin or seriously injure it. Acidic and alkaline substances can also cause significant injury.Alkali burns harm the cornea by altering pH, ulcerating, proteolyzing, and impairing collagen synthesis. Because they are lipophilic, alkali compounds enter the eye more quickly than acids. The saponification reaction within those cells is caused by the basic substance, which can rapidly deposit within the tissues of the ocular surface.

The lab safety measures to prevent red eye risk are as follows:1) When dealing with chemicals, always wear chemical splash goggles to protect your eyes.
2) Keep chemical interaction off of your skin and eyes.
3) Reduce your exposure to all chemicals.
4) Assume that every substance with undetermined toxicity is extremely toxic.


To know more about Chemical go through:-

https://brainly.com/question/29886197

#SPJ4

Answer: Francium

Explanation: This is because the atomic radius increases from top to bottom in a group, and decreases from left to right across a period. Thus, helium is the smallest element, and francium is the largest.

An H2 molecule only has three unique isotope combinations.

The 3H (or hydrogen-3) isotope is more commonly referred to as tritium than the 2H (or hydrogen-2) isotope. Sometimes, deuterium and tritium are represented by the letters D and T rather than 2H and 3H. Although though this application is widespread, according to the IUPAC, it is not preferred.

Each hydrogen atom in a hydrogen molecule (H2) can either be the 1H isotope (also known as protium) or the 2H isotope (also called deuterium). As a result, each hydrogen atom has two potential isotopes, for a total of 2 2 = 4 possible isotope combinations in an H2 molecule. These four potential pairings are as follows:

Both hydrogen atoms are 1H (H-H)

Both hydrogen atoms are 2H (D-D)

The first hydrogen atom is 1H and the second hydrogen atom is 2H (H-D)

The first hydrogen atom is 2H and the second hydrogen atom is 1H (D-H)

To know more about isotope visit:-

https://brainly.com/question/21536220

#SPJ1

Yes, if the concentration of the substrate is equal to the km, it can be a steady state condition.

In this situation, the rate of the reaction remains constant over time, and the concentration of the enzyme-substrate complex is at a maximum. The steady state is defined as the state in which the rate of formation of the enzyme-substrate complex is equal to the rate of breakdown of the enzyme-substrate complex. This implies that the concentration of the enzyme-substrate complex is not changing over time. Suppose the concentration of the substrate is equal to the Km of the enzyme. In that case, the rate of the reaction is half its maximum rate, and the enzyme-substrate complex's concentration is at its maximum. At this point, the formation of the enzyme-substrate complex equals its breakdown rate, and the reaction remains constant over time. Thus, this is a steady-state condition.

Learn more on km here.https://brainly.com/question/28088374

#SPJ11

Chemoautotrophs use inorganic chemicals as an energy source and carbon dioxide as a carbon source.

Chemoautotrophs are autotrophs that obtain their energy from chemical compounds rather than from sunlight. They generate their own food by using energy from inorganic substances like sulfur, ammonia, or ferrous iron in a process called chemosynthesis.

They are mainly found in harsh environments such as volcanic vents or deep-sea vents, where photosynthesis is not possible because there is no sunlight to drive the reaction.

Energy sources are substances or processes that provide energy for a given system. Chemical, thermal, and electromagnetic energy sources are the most common forms of energy sources.

Carbon is an element that is essential to all life forms. Carbon is a building block of most organic molecules, including carbohydrates, lipids, proteins, and nucleic acids, which are the essential components of life.

A carbon source is an essential element for the growth of living organisms. It is a nutrient that is necessary for the synthesis of organic molecules that make up living organisms, such as carbohydrates, lipids, proteins, and nucleic acids.

Chemoautotrophs use inorganic compounds such as ammonia, sulfur, or ferrous iron as an energy source to produce organic molecules from carbon dioxide and water. As a result, chemoautotrophs are the primary producers of food in ecosystems where photosynthesis is not feasible, and their existence is critical to the survival of other living organisms.

To know more about chemoautotrophs refer here:

https://brainly.com/question/28515929#

#SPJ11

the change in internal energy of the system is -15.5 kJ. Since the value is negative, this indicates that the system lost energy.

The first law of thermodynamics states that the change in internal energy (ΔE) of a system is equal to the heat (q) added to the system minus the work (w) done by the system:

ΔE = q - w

In this case, the system releases 8.8 kJ of heat (q = -8.8 kJ) and has 6.7 kJ of work done on it (w = 6.7 kJ). Plugging these values into the formula above, we get:

ΔE = -8.8 kJ - 6.7 kJ

ΔE = -15.5 kJ

Thermodynamics is the branch of physics that deals with the relationships between heat, energy, and work. It is a fundamental concept in understanding how energy is transferred and transformed in physical systems, from the behavior of atoms and molecules to the macroscopic properties of matter.

Thermodynamics is based on a few fundamental laws, including the first law of thermodynamics (also known as the law of conservation of energy), which states that energy cannot be created or destroyed, only transferred or converted from one form to another. The second law of thermodynamics states that the total entropy of a closed system can only increase over time, and that heat will flow spontaneously from hotter objects to colder ones.

Learn more about Thermodynamics here:

https://brainly.com/question/1368306

#SPJ1

The total pressure exerted by the mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K is approximately 8.36 atm.

The total pressure exerted by a mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K can be calculated using the Ideal Gas Law equation: PV = nRT.

Step 1: Calculate the number of moles (n) for each gas using their molar masses:
- Molar mass of N2 = 28.02 g/mol
- Molar mass of O2 = 32.00 g/mol
n_N2 = 26.35 g / 28.02 g/mol = 0.9405 mol
n_O2 = 30.108 g / 32.00 g/mol = 0.9409 mol
Step 2: Calculate the total number of moles (n_total) for the gas mixture:
n_total = n_N2 + n_O2 = 0.9405 mol + 0.9409 mol = 1.8814 mol
Step 3: Find the value of the gas constant (R) in the appropriate units. Since we want the pressure in atmospheres (atm), we'll use R = 0.0821 L*atm/(mol*K).
Step 4: Plug the values into the Ideal Gas Law equation:
P = nRT / V
P = (1.8814 mol * 0.0821 L*atm/(mol*K) * 298.28 K) / 1.68 L
Step 5: Solve for the pressure (P):
P = 8.3626 atm
So, the total pressure exerted by the mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K is approximately 8.36 atm.

for more such question on pressure

https://brainly.com/question/24719118

#SPJ11

The solution's pH is 2.82 and In a 0.62 M solution, propanoic acid ionisation is 0.24%.

The Ka value for propanoic acid (HC₃H₅O₂) is 1.3 × 10⁻⁵. To calculate the pH and percent ionization of a 0.62M solution of propanoic acid, we can use the following equations:

Ka = [H⁺][C₃H₅O₂⁻]/[HC₃H₅O₂]

percent ionization = [H⁺]/[HC₃H₅O₂] x 100

(a) pH Calculation:

We can assume that the initial concentration of propanoic acid, [HC₃H₅O₂] , is equal to the given concentration of 0.62 M.

Let x be the concentration of [H⁺] and [C₃H₅O₂⁻] that forms upon dissociation of the propanoic acid. Since the propanoic acid is a weak acid, we can assume that the concentration of [H⁺] that forms is much smaller than the initial concentration of [HC₃H₅O₂]. Therefore, we can assume that the concentration of [HC₃H₅O₂] after dissociation is approximately equal to the initial concentration.

Using the Ka expression, we can set up the following equation:

1.3 × 10⁻⁵ = x² / (0.62 - x)

Solving for x using the quadratic formula, we get:

x = 0.0015 M

Therefore, the pH of the solution is:

pH = -log[H+] = -log(0.0015) = 2.82

(b) Percent Ionization Calculation:

The percent ionization can be calculated using the equation:

percent ionization = [H⁺]/[HC₃H₅O₂] x 100

From the previous calculation, we know that [H⁺] = 0.0015 M and [HC₃H₅O₂] = 0.62 M.

percent ionization = (0.0015/0.62) x 100 = 0.24%

Therefore, the percent ionization of propanoic acid in a 0.62 M solution is 0.24%.

To learn more about pH refer to:

brainly.com/question/15289741

#SPJ4

To determine the final temperature of the water, we need to use the principle of conservation of energy. The heat lost by the hotter water will be gained by the cooler water until they reach thermal equilibrium.

We can use the following equation to calculate the final  temperature :

m1c1ΔT1 + m2c2ΔT2 = 0

where m1 and m2 are the masses of the two samples of water, c1 and c2 are their specific heats, and ΔT1 and ΔT2 are the temperature changes.

In this case, m1 = m2 = 100.0 g and c1 = c2 = 4.184 J/g°C (the specific heat of water). ΔT1 = 84.7°C - T (where Tis the final temperature) and ΔT2 = T - 79.6°C.

Substituting these values into the equation, we get:

100.0 g x 4.184 J/g°C x (84.7°C - T) + 100.0 g x 4.184 J/g°C x (T - 79.6°C) = 0

Solving for T, we get:

T = (100.0 g x 4.184 J/g°C x 84.7°C + 100.0 g x 4.184 J/g°C x 79.6°C) / (100.0 g x 4.184 J/g°C x 2)

T = 82.15°C

Therefore, the final temperature of the water is 82.15°C.

To know more about thermal equilibrium, visit:

https://brainly.com/question/29419074

#SPJ1

The transition corresponding to the highest frequency of light emitted is E. n=6 to n=3. This is because the frequency of light emitted is proportional to the difference in energy between the initial and final states.

According to the Bohr model, as the energy of the orbit increases, the radius of the orbit increases, and therefore the energy difference between two adjacent orbits increases. Thus, n=6 to n=3 has the greatest energy difference, and therefore the highest frequency of light emitted.


To better understand this concept, we can consider the relationship between the energy of the orbit and its radius. According to the Bohr model, the energy of an electron in an orbit of radius r is given by: E=-2.18x10^-18/r, where r is measured in meters. Thus, when the radius of the orbit increases, the energy of the orbit increases, and therefore the energy difference between two adjacent orbits increases. As a result, the frequency of light emitted increases.


In conclusion, the transition corresponding to the highest frequency of light emitted is n=6 to n=3. This is because the energy difference between these two orbits is the greatest and therefore the frequency of light emitted is the highest. Therefore the correct option is E

The complete question is :

Consider the Bohr model of the atom Which transition would correspond to the highest frequency of light emitted? Select one:

a. n=1 to n=5

b. n=4 to n=1

c. n=6 to n=10

d. n=2 to n=6

e. n=6 to n=3

Know more about  Bohr model here:

https://brainly.com/question/29400473

#SPJ11

Answer:

Summary – Electrolyte vs Electrolysis

Therefore, the key difference between electrolyte and electrolysis is that electrolyte is a substance that can produce ions, whereas electrolysis is a process in which an electric current is used to drive a chemical reaction.

Explanation: brainliest please

Excessive breakdown of fatty acid may lead to an increase in ketone body formation. The correct option is c.

The Ketone bodies will be produced in the liver cells by the breakdown of the fatty acids. These are released in to the blood after the glycogen stores in the liver have depleted. The Glycogen will stores that will be typically are depleted with the first 24 hours of the fasting.

Ketones are present in the blood and when the glucose level will be lower in the blood. Liver shifts the metabolization process from the carbohydrates to the fatty acids where there is the lack of the glucose. The correct option is c.

To learn more about ketone here

https://brainly.com/question/28426418

#SPJ4

Answer:

Yes

Explanation:

It's boiling point is high

Minerals easily dissolved by the water in a river, such as calcium and magnesium, are then carried in the solution downstream.

What is Minerals?

Minerals are naturally occurring inorganic substances that are solid and have a definite chemical composition and crystal structure. They are formed by geological processes and are typically found in rocks, ores, and mineral deposits. Some examples of minerals include quartz, feldspar, mica, calcite, and magnetite. Minerals have a variety of uses, from being used as building materials to being important components in industrial processes, electronics, and other applications.

Minerals that are easily dissolved by water, such as calcium and magnesium, can dissolve and form ions in a river or other body of water. These ions can then be carried away in the solution as the water flows downstream. This process is called dissolution and is a common way in which minerals are transported by water.

Learn more about Minerals from the given link

https://brainly.com/question/89259

#SPJ1

1. Chlorine is a halogen and has a charge of -1. The chemical formula for chloride ion is Cl⁻.

2. Sodium is an alkali metal and has a charge of +1. The chemical formula for sodium ion is Na⁺.

3. Ammonium ion is a polyatomic ion with a charge of +1. The chemical formula for ammonium ion is NH₄⁺.

4. Beryllium is an alkaline earth metal and has a charge of +2. The chemical formula for beryllium ion is Be²⁺.

5. Nitrite ion is a polyatomic ion with a charge of -1. The chemical formula for nitrite ion is NO₂⁻.

6. Calcium is an alkaline earth metal and has a charge of +2. The chemical formula for calcium ion is Ca²⁺.

7. Oxygen is a nonmetal and typically has a charge of -2. The chemical formula for oxide ion is O²⁻.

8. Bromate ion is a polyatomic ion with a charge of -1. The chemical formula for bromate ion is BrO₃⁻.

9. Phosphate ion is a polyatomic ion with a charge of -3. The chemical formula for phosphate ion is PO₄³⁻.

10. Sulfur is a nonmetal and can have a charge of -2, -1, 0, +2, +4, or +6 depending on the compound. For example, the chemical formula for sulfide ion (S²⁻) is formed when sulfur gains two electrons and has a charge of -2.

To know more about alkaline earth metal , visit:

https://brainly.com/question/12835232

#SPJ1

The pH of the buffer solution that is 0.050 M in benzoic acid (HC7H5O2) and 0.150 M in sodium benzoate (NaC7H5O2) is calculated as 4.68.

pH refers to the concentration of hydrogen ions in any solution and this is the indicator of a solution's acidity or alkalinity

Buffer solution is one that resists changes in pH when small amounts of acid or base are added.

HC7H5O2(aq) + H2O(l) ⇌ H3O+(aq) + C7H5O2-(aq)

Ka = [H3O+][C7H5O2-]/[HC7H5O2]

[HC7H5O2] = 0.050 M

[C7H5O2-] = 0.150 M

H3O+(aq) + C7H5O2-(aq) → HC7H5O2(aq) + H2O(l)

pH = pKa + log([C7H5O2-]/[HC7H5O2])

pKa is negative logarithm of the acid dissociation constant (pKa = -log(Ka)).

pH = -log(6.5×10^-5) + log(0.150/0.050)

= 4.20 + 0.477

pH = 4.68

Therefore, pH of the buffer solution is 4.68.

To know more about pH, refer

https://brainly.com/question/172153

#SPJ1

Answer:

IT IS IRON.

Explanation:

This ion has 24 electrons, so it has experienced a loss of 2 electrons. So, charge on ion is 2+. Also, the element with 26 protons (26 atomic number) is iron (Fe).

As a consequence, 0.75 L or 750 mL of 0.100 M copper(II) chloride solution were created by diluting 150 mL of a 0.500 M solution.

The basic formula for volume is length, breadth, and height, as opposed to length, width, and height for the area of a rectangular shape.

The dilution formula can be used to calculate the volume of the diluted solution: M1V1 = M2V2

To solve for V2, we can rewrite the equations as follows:                                  V2 = (M1V1) / M2

Inputting the values provided yields:

M1 = 0.500 M (the initial concentration), V1 = 150 mL (the initial volume), M2 = 0.100 M (the final concentration)

The starting volume is converted to litres as follows:                                             V1 = 150 mL = 0.150 L

Now that the values have been entered, we can solve for V2:

V2 = (M1V1) / M2

V2 = (0.500 M) x (0.150 L) / 0.100 M

V2 = 0.75 L

To know more about solution visit:-

https://brainly.com/question/30665317

#SPJ1

Answer:

they ate lelo pudina hahahha

Answer:

COOH is the carboxylic acid.