Why antibiotics should not be overused?​

Answers

Answer 1
Taking antibiotics for colds and other viral illnesses doesn't work — and it can create bacteria that are harder to kill.

Taking antibiotics too often or for the wrong reasons can change bacteria so much that antibiotics don't work against them. This is called bacterial resistance or antibiotic resistance. Some bacteria are now resistant to even the most powerful antibiotics available.

Antibiotic resistance is a growing problem. The Centers for Disease Control and Prevention (CDC) calls it "one of the world's most pressing public health problems." It's especially a concern in low-income and developing countries

Related Questions

Can someone please help me

Answers

Answer:

I THINK that the answer is c, but dont hold me to that, let me double check

Explanation:

what is the correct order of stages of the cell cycle, ordered longest to shortest, in mammalian cells in culture ?Cytokinesis, Mitosis, Interphase.Cytokinesis, Interphase, MitosisMitosis, Cytokinesis, InterphaseInterphase, Mitosis, Cytokinesis

Answers

The correct order of stages of the cell cycle, ordered longest to shortest, in mammalian cells in culture is Interphase, Mitosis, Cytokinesis. Interphase, which is the longest stage, is further divided into three phases: G1 (Gap 1), S (Synthesis), and G2 (Gap 2).

During G1, the cell grows and carries out its normal metabolic processes; during S, the DNA replicates; and during G2, the cell grows and prepares for mitosis. Mitosis is the stage in which the cell's nucleus divides into two identical nuclei, and it is followed by cytokinesis, the division of the cytoplasm to form two separate daughter cells.

To learn more about  mammalian cells refer to:

brainly.com/question/13722187

#SPJ4

four muscles that originate on the scapula, wrap around the joint, and fuse to form one large tendon are called the:

Answers

Answer: rotator cuff

Explanation: The four muscles that originate on the scapula, wrap around the joint, and fuse to form one large tendon are called the rotator cuff. These stabilize the shoulder joint and allow the arm to be lifted.

Which of these substances speeds up the absorption of alcohol? a. plain water b. carbonated liquids c. starchy foods d. meat products

Answers

b. Carbonated liquids are known to speed up the absorption of alcohol as they increase the rate at which the alcohol is emptied from the stomach and enters the small intestine where it is absorbed into the bloodstream.

This is because carbonated drinks create more pressure in the stomach, which can cause the pyloric valve to open more frequently, allowing alcohol to be absorbed more quickly. Drinking water or consuming starchy foods or meat products may slow down the absorption of alcohol, but they do not speed it up.

The rate of alcohol absorption can be influenced by various factors, including the presence of food in the stomach, the concentration of alcohol in the drink, the carbonation of the drink, and other factors. Carbonated drinks have been shown to speed up the absorption of alcohol because the carbonation increases the pressure in the stomach, which can cause the pyloric valve to open more frequently. This allows alcohol to be absorbed more quickly into the bloodstream.

know more about alcohol here: https://brainly.com/question/30829120

#SPJ4

targeted therapies are used in patients with a set gene expression pattern. a targeted therapy that prevents the activation of the estrogren receptor in breast cancer would be beneficiail to which type of patient

Answers

Targeted therapies are used in patients with a set gene expression pattern. A targeted therapy that prevents the activation of the estrogen receptor in breast cancer could be beneficial to patients with ER-positive breast cancer.

ER-positive breast cancer is caused by cells that have too many estrogen receptors, which can cause them to grow uncontrollably. The targeted therapy would prevent the estrogen receptor from being activated, thus preventing cell growth. This type of therapy could potentially be used as an alternative to chemotherapy, which can have negative side effects. Additionally, it could be used in combination with other treatments, such as radiation therapy, in order to maximize the efficacy of the treatment. Targeted therapies are an important part of the fight against breast cancer, and the prevention of the activation of the estrogen receptor could be beneficial to many patients.

Know more about Radiation therapy here

https://brainly.com/question/12643512#

#SPJ11

which of the following statements about meiosis is false ? group of answer choices rec8 is a meiotic cohesin that links sister chromatids over their entire length at metaphase i. at anaphase i, sister chromatids remain together. at anaphase i, cohesins are retained in the centromeric region at anaphase ii, non-sister chromatids separate. unlike mitosis, homologous chromosomes pair during meiosis.

Answers

The following statement about meiosis is false is a. rec8 is a meiotic cohesin that links sister chromatids over their entire length at metaphase i.

Rec8 is a meiotic cohesin that links sister chromatids over their entire length until anaphase II. Meiosis is a type of cell division that occurs in sexually reproducing organisms, it's also known as reduction division. It happens only in reproductive cells and lowers the chromosome number by half. It is an essential process in the formation of gametes, such as egg cells and sperm cells. The five important stages of meiosis are prophase, metaphase, anaphase, telophase, cytokinesis.

Meiosis is distinct from mitosis in a variety of ways, one significant distinction is the pairing of homologous chromosomes, which is a critical feature of meiosis but not mitosis. Homologous chromosomes are chromosomes that are similar in shape and carry the same genes in the same order. They are the chromosomes that come from each parent. During metaphase I, homologous chromosomes come together to form a bivalent, which is a paired structure with four chromatids. At anaphase I, the two homologous chromosomes in each bivalent split and migrate to opposite poles and chromatids are separated during meiosis II.

Learn more about meiosis at:

https://brainly.com/question/30125050

#SPJ11

why did geneticists believe, even before direct experimental evidence was obtained, that the genetic code would turn out to be composed of triplet sequences and be nonoverlapping? experimentally, how were these suppositions shown to be correct?

Answers

Geneticists believed that the genetic code would be composed of triplet sequences and be nonoverlapping for several reasons such as combination of amino acids in protein synthesis, indirect evidence from frame-shift mutations and experimental evidence by using synthetic RNA molecules.

Firstly, they knew that the genetic code needed to contain enough information to specify all 20 amino acids used in protein synthesis. With a triplet code, there are 64 possible combinations (4 nucleotide bases raised to the power of 3), which is more than enough to account for the 20 amino acids.

Secondly, Crick, Brenner, and colleagues' work on frame-shift mutations provided indirect evidence for a triplet code. They observed that when one or two nucleotide bases were added or removed from a DNA sequence, the protein produced was often nonfunctional. However, when three bases were added or removed, the protein function could be restored. This indicated that the genetic code was read in groups of three bases, and that adding or removing one or two bases shifted the reading frame, disrupting the protein sequence.

Experimental evidence for the triplet nature and nonoverlapping nature of the genetic code was obtained through the work of Nirenberg and Khorana in the 1960s. They used synthetic RNA molecules with known sequences and observed the resulting amino acids produced during in vitro translation. By testing different RNA sequences, they were able to deduce which triplet codons coded for each amino acid.

Thus, a combination of theoretical considerations, indirect experimental evidence from frame-shift mutations, and direct experimental evidence from in vitro translation experiments led geneticists to conclude that the genetic code was composed of triplet sequences and was nonoverlapping.

For more such questions on Genetic code.

https://brainly.com/question/17306054#

#SPJ11

What effect would el niño most likely have on organisms? a. el niño would cause the extinction of an entire species. b. el niño would cause changes in the genetic makeup of organisms. c. el niño would cause continents to move to different parts of the planet. d. el niño would cause organisms to move in search of food and better conditions.

Answers

The most likely effect of El Niño on organisms is: El Niño would cause organisms to move in search of food and better conditions. Therefore the correct option is option D.

Changes in sea surface temperatures and precipitation patterns brought on by El Nio may have an impact on the quantity and spread of marine organisms like plankton, fish, and marine mammals.

Terrestrial ecosystems, such as grasslands and rainforests, can be impacted by changes in temperature and precipitation, which can have an effect on the distribution and behaviour of land creatures.

In reaction to these changes, organisms may move in search of a suitable environment and food sources. It is crucial to remember that based on the particular ecosystem and the intensity of the El Nio event, the effects of El Nio on organisms can change.

For such more question on organisms:

https://brainly.com/question/17259533

#SPJ11

in prokaryotes, the polymerase can synthesize rna using a dna template, but cannot initiate synthesis accurately. (True or False)

Answers

The given statement "In prokaryotes, the polymerase can synthesize RNA using a DNA template, but cannot initiate synthesis accurately" is True because RNA polymerase is an enzyme that is involved in the transcription process, where it reads the DNA template to make an RNA copy.

This RNA copy is called messenger RNA (mRNA).This enzyme is composed of several subunits, each with a unique function. The most important subunit is the catalytic subunit, which is responsible for the actual polymerization of RNA. The RNA polymerase uses a DNA template to synthesize RNA, as it cannot synthesize RNA de novo.

The RNA polymerase binds to the promoter region of the DNA, which is located at the beginning of the gene being transcribed. Once the RNA polymerase is attached to the promoter, it moves along the DNA template in a 3' to 5' direction. As it moves along, it synthesizes RNA in a 5' to 3' direction.

know more about prokaryotes here

https://brainly.com/question/29119623#

#SPJ11

According to 7th day adventists,all of these are unclean animals EXCEPT?
Shrimp
Rabbit
Catfish
Croppy
Fish

Answers

The Adventists forbid eating pork, rabbit, and shellfish because they are seen as "unclean."

Some "clean" foods, including as fish, chicken, and red meats other than hog, as well as other animal products like eggs and low-fat dairy, are preferred by some Adventists. the chameleon, skink, monitor lizard, wall lizard, and gecko. They are the least clean for you of all the things that travel along the earth. After they have passed away, everyone who touches them becomes filthy until dusk. They include lobster, crab, mussels, oysters, squid, octopus, shrimp/prawns, scallops, mussels, and other shellfish) is unclean. Certain "fin fish" are included in the biblical list of unclean meals because they lack scales (for example, different varieties of tuna; blue fin and yellow fin are clean).

Learn more about varieties here-

https://brainly.com/question/14384289

#SPJ4

in a certain plant, when individuals with blue flowers are crossed with individuals with blue flowers, only blue flowers are produced. plants with red flowers crossed with plants with red flowers sometimes produce only red flowers, although other times they produce either red or blue flowers. when plants with red flowers are crossed with plants with blue flowers, sometimes only red flowers are produced; other times either red or blue flowers are produced. which gene is dominant?

Answers

the asnswer is red, means the red flower gene is dominant.

During electron transport, which serves as a ready source for protons that can be pumped across the membrane? A. O2B. H2O C. ATP D. NADH E. glucose

Answers

During electron transport, NADH serves as a ready source for protons that can be pumped across the membrane. The electron transport chain (ETC) is the primary function of the final step of cellular respiration that leads to the creation of ATP molecules in oxidative phosphorylation.

The NADH and FADH2 molecules that are produced by glycolysis and the Krebs cycle are oxidized, releasing high-energy electrons and H+ ions that are then passed to the electron transport chain. The ETC is located in the inner mitochondrial membrane of eukaryotes and the plasma membrane of prokaryotes. During electron transport, high-energy electrons are passed through a series of electron carriers that are embedded in the membrane.

As the electrons move through the chain, they lose energy, which is used to pump protons out of the mitochondrial matrix and into the intermembrane space. This establishes an electrochemical gradient across the membrane, with a higher concentration of protons in the intermembrane space than in the matrix. The protons then flow back into the matrix through ATP synthase, which uses the energy from their movement to make ATP from ADP and inorganic phosphate.

The NADH and FADH2 molecules that enter the electron transport chain are ultimately oxidized by molecular oxygen (O2), which is the final electron acceptor in the chain. As O2 is reduced to form water (H2O), it also accepts protons that have been pumped across the membrane, allowing the electron transport chain to continue to pump protons and produce ATP.

To learn more about NADH :

https://brainly.com/question/11538586

#SPJ11

Why is DNA replication called semi-conservative? The answer is that each daughter DNA consists of one new helix and one old helix. Explain further.

Answers

Semiconservative replication is called semi-conservative because one of  strands of DNA in each of two copies of DNA is ancient and conserved whereas other is newly produced at the moment of replication.

Why is DNA replication called semi-conservative?

DNA replication is called semiconservative as an existing DNA strand is used to create new strand.

DNA is a double stranded molecule and when DNA is copied, two strand of DNA (old strands) separate and new complementary nucleotides are added  on two separated strands.

This process then creates two identical double stranded DNA molecules. Each DNA molecule contains one strand of original DNA molecule and one newly synthesized strand. Hence, DNA replication is called semiconservative.

To know more about DNA replication, refer

https://brainly.com/question/21265857

#SPJ1

What do we call objects that do not easily allow heat to travel through them?

A; Insulators
B; Idolaters
C; Protectors
D; Transfers

Answers

Answer:

Insulators do not allow heat to pass through them.

Crystal made the following table to compare the different types of faults. What needs to be corrected?
Normal Faults Reverse Faults Strike-slip Faults
Involve dip movements Involve dip movements Invovle horizontal movement
Occur at convergent boundaries Occur at divergent boundaries Occure at transform boundaries
Dip-slip Dip-slip Strike-slip
Reverse faults involve horizontal movement and are strike-slip faults.
Normal faults involve horizontal movement and are strike-slip faults.
Reverse faults occur at transform boundaries and Strike-slip faults occur at divergent boundaries.
Normal faults occur at divergent boundaries and reverse faults occur at convergent boundaries.

Answers

Reverse faults occur at transform boundaries and Strike-slip faults occur at divergent boundaries.

Sudden movement along Earth's fault lines causes earthquakes. The motion releases "elastic strain" energy that has been accumulated inside the form of seismic waves, that travel through the Earth & cause the earth to tremble. A mid-ocean ridge, or underwater mountain system created by plate tectonics, is what is referred to as the Mid-Atlantic Ridge (MAR). The "elastic rebound theory" for earthquakes refers to this steady buildup & release of stress and strain. Reverse faults happen at convergent borders whereas normal faults happen at divergent boundaries.The abrupt elastic rebounding of previously energy stored is what causes most earthquakes. Tectonic plates, which are huge chunks of the lithosphere of the Earth, split away from one another during the geologic process of seafloor spreading.

Learn more about faults

https://brainly.com/question/16906279

#SPJ1

1. what kind of speciation do we normally associate with members from one population being geographically displaced to a new, smaller population?

Answers

The type of speciation we normally associate with members from one population being geographically displaced to a new, smaller population is called allopatric speciation.

Speciation is the process by which one species becomes two different species. Speciation occurs when one species in a population changes so much that it can no longer mate with the other population. This is known as reproductive isolation.Over time, the two populations will become different and will no longer be able to breed, leading to the formation of two different species. Populations that have evolved to become different due to geographical isolation are said to have undergone allopatric speciation.Geographic isolation is a situation where a species is separated from other members of its population by a geographical barrier. This is often the result of a physical barrier such as a mountain range, a river, or a body of water.Over time, the population will evolve to adapt to the unique environment of their new location, leading to the formation of a new species. Populations that have evolved to become different due to geographic isolation are said to have undergone allopatric speciation.Allopatric speciation is the type of speciation that we normally associate with members from one population being geographically displaced to a new, smaller population. This can occur when a species is separated from the rest of the population by a physical barrier such as a mountain range or a body of water. Over time, the population will evolve to adapt to the unique environment of their new location, leading to the formation of a new species.

Learn more about Speciation: https://brainly.com/question/3455977

#SPJ11

Write the adaptations of animals living in aboreal habitet.​

Answers

Answer:

Arboreal animals are very well adapted to staying or hanging on to trees. Many of them have little bodies and clawed or sticky feet. Some of them have prehensile tails that they use to grasp tree branches.

Claws, adhesive pads, flexible ankle joints (such as a squirrel's) that can turn forwards and backwards are all adaptions useful for staying in place. Arboreal primates have hairless fingertips that allow the animal's hand to squeeze the branch between the fingertips to generate friction.

Hope this helps!

Pls mark brainliest

Arboreal locomotion refers to species that live in and move through trees. These animals often possess physical adaptations that aid in this movement. These adaptations may include long limbs, prehensile tail, and claws. Animals that exhibit arboreal locomotion include squirrels, sloths, and monkeys.

a biological reserve that is designed for a single species is an important tool in maintaining biodiversity because a reserve: will not change over time so all the species will be conserved as long as the reserve exists. will generate income when people visit to see the biodiversity protected in the reserve. will generate income when people visit to see the biodiversity protected in the reserve. that is designed for a single species will also protect other species in the reserve.

Answers

A biological reserve that is designed for a single species is an important tool in maintaining biodiversity because a reserve that is designed for a single species will also protect other species in the reserve.

Biological reserves have become more prevalent in recent years as a method of conserving biodiversity. These reserves are specially designed to preserve the living organisms within them, making them a vital component of conservation efforts.

The best response is "a reserve that is designed for a single species will also protect other species in the reserve." Despite the fact that the reserve is designed for a single species, there will be other species in the same region that will be indirectly protected thanks to the reserve. This is due to the fact that if a single species goes extinct or its numbers decline, it will have an impact on the whole ecosystem. Therefore, preserving a single species implies preserving the entire ecosystem.

Learn more about biodiversity:

https://brainly.com/question/11542363

#SPJ11

select the carotenoids that can be converted into vitamin a in the body.

Answers

Carotenoids that can be converted into vitamin A in the body are β-carotene, α-carotene, and β-cryptoxanthin. β-Carotene is the most abundant carotenoid found in many fruits and vegetables, which is converted into vitamin A by the body after being absorbed into the bloodstream.

α-Carotene is a carotenoid found in various vegetables, including carrots, pumpkin, and spinach, that can be converted into vitamin A in the body. Beta-cryptoxanthin is another carotenoid that can be converted into vitamin A in the body.

It is found in various fruits and vegetables, including red peppers, papaya, and oranges, and it is thought to be an important source of vitamin A, particularly in populations with low vitamin A intake.

know more about Carotenoids here

https://brainly.com/question/13631581#

#SPJ11

what is d shape tentacles present contractile vacuoles present trichocysts defence cilia helps movement transverse division

Answers

The description provided seems to be related to the characteristics of a group of organisms known as ciliates.

Ciliates are a diverse group of unicellular eukaryotic organisms that possess hair-like structures called cilia, which are used for movement and feeding. They also have contractile vacuoles for osmoregulation, trichocysts for defense against predators, and transverse division for reproduction.

Additionally, some ciliates have tentacles that can aid in capturing food. The presence of these characteristics distinguishes ciliates from other unicellular organisms such as bacteria and archaea.

To learn more about ciliates, here

https://brainly.com/question/22095567

#SPJ4

These two satellite images show a region on Earth. The image on the left shows the region in 1986, and the image on the right shows the same region in 2000. The human population in the region nearly tripled during this time. Dark green regions are undeveloped areas, while purple regions have been modified for human use.

Which statement is supported by the evidence in the images?
CHOOSE AN ANSWER FROM THE PICTURE

Answers

The human population in the region increased significantly between 1986 and 2000, as evidenced by the expansion of purple regions in the image on the right.

What is human population?

Human population is the total number of people living in a particular area or region. It is a measure of the size and density of a population and is generally expressed as the number of persons per unit area. Human population growth is affected by a variety of factors, such as birth and death rates, migration, economic development, and availability of resources. As population increases, so does the demand for resources, leading to increased competition for resources, increased pollution, and a greater risk of natural disasters. As a result, population growth can have both positive and negative effects on the environment and the quality of life of humans. Population growth is also associated with increased poverty, malnutrition, and other social issues.

To learn more about human population

https://brainly.com/question/24067944

#SPJ1

Why are the questions of philosophy, such as 'who are we?' and 'why are we here?', not considered scientific?​

Answers

C. subjective
because objective would mean not influenced or based on personal views but these questions are subjective and can be considered personal views.
Final answer:

Philosophical questions like 'who are we?' and 'why are we here?' are not deemed scientific because they can't be empirically tested or quantified. Such questions deal with abstract, subjective concepts as opposed to scientific study which seeks measurable and provable results.

Explanation:

The reason why philosophical questions such as 'who are we?' and 'why are we here?' are not considered scientific is because these questions cannot be empirically tested or measured. Science is concerned with examining the natural world through a structured method of observation and experimentation. It seeks answers that can be quantitatively measured and proven.

Philosophical questions, on the other hand, deal with abstract concepts and ideas that could be subjective and differs from person to person. We often use philosophy to dig into these complex questions, pondering the nature of existence, purpose, morality, consciousness, and more. While these questions indeed form a crucial part of human curiosity, they fall outside the scope of the scientific method due to their inherently subjective and unquantifiable nature.

Learn more about Difference between Philosophy and Science here:

https://brainly.com/question/24675602

#SPJ2

if planet y orbits the sun bur does not rotate on its axis at all how long would a daybbe on planet y

Answers

If Planet Y does not rotate on its axis at all, then one day-night cycle on the planet would take as long as one full orbit around the Sun.

This is because the definition of a day is the time it takes for one complete rotation on its axis, and if Planet Y does not rotate on its axis, it does not have a day.

Assuming that Planet Y's orbit around the Sun is circular and has a period of one Earth year (365.25 Earth days), then one day on Planet Y would also be 365.25 Earth days long. Therefore, a year on Planet Y would also be 365.25 Earth days long, and the planet would have one day and one night each year.

What is an orbit?

An orbit is the path that an object takes as it moves around another object due to the influence of gravity. In astronomy, the most common example of an orbit is the path that a planet takes as it revolves around a star. Orbits are governed by the laws of motion, particularly Kepler's laws of planetary motion, which describe how the gravitational force between two objects affects their motion.

To know more about planet, visit:

https://brainly.com/question/14581221

#SPJ1

Complete question is: If Planet Y does not rotate on its axis at all, then one day-night cycle on the planet would take as long as one full orbit around the Sun.

unpacking of chromosomes and the formation of a new nuclear envelope is a characteristic of which stage of mitosis?

Answers

The unpacking of chromosomes and the formation of a new nuclear envelope is a characteristic of the Telophase stage of mitosis.

Telophase is the final stage of mitosis, in which the chromatids or chromosomes move to opposite ends of the cell and two nuclei are formed.Characteristics of the telophase stage of mitosis; The chromosomes are positioned at opposite ends of the cell's polar axis, which extends from the poles to the equator.The chromosomes are now being pulled apart and moved to opposite sides of the cell by spindle fibers.The spindle fibers begin to break down as the chromosomes reach the poles of the cell.

A new nuclear envelope is formed around each of the two sets of chromosomes. Each of these nuclei is similar to the original nucleus in terms of structure and function.The chromosomes begin to unwind, unravel, and become less condensed as they prepare for transcription into RNA to create new protein molecules.The cell division procedure ends in Telophase, which allows the cell to separate into two daughter cells. It's during this process that the nuclear membrane reforms, dividing the two new nuclei into two separate nuclei.

More on mitosis: https://brainly.com/question/17585335

#SPJ11

humans have many uses for water. what types of human activities do you think consume the most water?

Answers

The types of human activities that consume the most water are agriculture and industry.

Water has been an essential element of our everyday lives since time immemorial. People use water in various ways such as for cooking, cleaning, personal hygiene, and drinking. However, humans consume water in several other activities that are crucial to human life, such as agriculture and industry.

Types of human activities that consume the most water:

1. Agriculture: Water is essential for agriculture as it is the primary resource used to irrigate crops. Agricultural activities account for about 70% of water usage in the world. The irrigation system consumes approximately 80% of the water used in agriculture. It is used to irrigate crops, and the majority of this water is lost due to evaporation and runoff.

2. Industry: Industrial activities such as manufacturing, mining, power generation, and chemical production consume a substantial amount of water. In these industries, water is used for cooling, washing, and processing. Industry accounts for approximately 20% of the world's water usage.

3. Domestic use: Domestic use of water encompasses all activities such as washing clothes, cooking, cleaning, and personal hygiene. Domestic use accounts for approximately 10% of the world's water usage. It is estimated that a single individual consumes 80 to 100 gallons of water each day in developed countries.

The above activities consume the most water. Agriculture accounts for 70%, industry accounts for 20%, and domestic use accounts for approximately 10% of the world's water usage.

To learn more about "agriculture" here:

https://brainly.com/question/3632132#

#SPJ11

indicate whether the label identifies a specific or nonspecific form of defense.

Answers

The label identifies a specific or nonspecific form of defense are

Specific form: B-lymphocytes, Antibodies, Cytotoxic T-lymphocytes, and Plasma cellsNonspecific form: Skin, Neutrophils, and Monocytes

What is non-specific immunity?

The nonspecific immunity definition is the immunity you аre born with thаt provides generаlized protection аgаinst pаthogens. This generаlized defense system works аll the time to prevent infection. This is аlso cаlled innаte immunity. It includes:

Physicаl bаrriers, like skin аnd mucous membrаnesChemicаl deterrents, like аntimicrobiаl enzymes in bodily fluids аnd stomаch аcidReflexes, like coughing аnd sneezingCells, like mаcrophаges, bаsophils, аnd nаturаl killer T-cells

Whаt is specific immunity?

Specific immunity, аlso known аs аcquired immunity, is developed аfter the body is exposed to specific pаthogens аs а form of future protection. It is the body's wаy of remembering whаt dаngers exist аnd how to fight them. The following cells help develop аnd retаin specific immunity.

Cytotoxic T-Cells. These cells аre identified by their аntigens.B-cells. They аttаch to а single аntigen.Аntibodies аre Y-shаped proteins thаt constаntly scаn the body for specific invаders.Helper T-Cells. They аre only аctivаted by specific pаthogens.

Your question is incomplete, but most probably your full question can be seen in the attachment.

For more information about specific and nonspecific form refers to the link: https://brainly.com/question/3332699

#SPJ11

These positively charged particles are found in the atomic nucleus:
A. Protons only
B. Electrons only
C. Protons and neutrons
D. Neutrons only

Answers

A. The atomic nucleus contains solely positively charged protons.

In contrast to neutrons, which are neutral particles found in the nucleus with protons, electrons are negatively charged particles that are found in the electron cloud, which is located outside the nucleus.

Atomic nucleusThe fundamental units of matter are called atoms, and they are made up of protons, neutrons, and electrons, three different subatomic particle kinds. In the nucleus, or the center region of an atom, protons are positively charged particles. Protons and neutrons can both be found in the nucleus, however neutrons, which are neutral particles and have no charge, are also present. Electrons are negatively charged particles that are located outside of the nucleus in the electron cloud or the space around it.The number of protons in an atom's nucleus determines its atomic number, which in turn establishes the element that it belongs to.

learn more about atomic nuclei here

https://brainly.com/question/1268608

#SPJ1

in which organism would you expect to find hemolymph? group of answer choices toxoplasma (protist) vampire bat (mammal) meganeura (dragonfly) wood frog (amphibian) schistosoma (flatworm)

Answers

In Meganeura (dragonfly) we could expect to find hemolymph.

Hemolymph is primarily present in invertebrates and not in vertebrates such as mammals, reptiles, or birds.

What is hemolymph?

Hemolymph is a term used to describe the fluid found in the open circulatory system of several invertebrates. Hemolymph, which is a combination of blood and interstitial fluid, has various functions in the body of the invertebrates. This fluid is responsible for transporting nutrients, waste products, and hormones in the body of invertebrates.

Hemolymph also provides support for the invertebrates' internal structures and serves as a cushion against shocks and sudden movements. Hemolymph, unlike blood in mammals, does not transport oxygen. Instead, invertebrates depend on a network of tubes to supply oxygen throughout their bodies.

The circulation of hemolymph through the vessels is influenced by various factors such as contraction of the invertebrate's body muscles and movement of other organs, particularly those that squeeze and stretch the hemolymph vessels.

To know more about Meganeura refer here:

https://brainly.com/question/16015651#

#SPJ11

panthers with teeth that are too short have difficulty capturing prey while panthers with teeth that are too long have difficulty chewing their food

Answers

Answer:

Yes, this is true, but certain panthers with deviations do not survive.

Explanation:

The thing is that the teeth of predatory animals are like hands, and if they are not in good condition, then they cannot use them correctly.

to date, most of our natural antibiotics have been found to be produced by members of what genus? group of answer choices bacillus streptomyces penicillium cephalosporium paenibacillus

Answers

Most of our natural antibiotics have been found to be produced by members of the Streptomyces genus.

What are the natural antibiotics?

To date, most of our natural antibiotics have been found to be produced by members of the genus Streptomyces. Streptomyces is a genus of bacteria that includes many species that produce antibiotics, such as streptomycin, tetracycline, and erythromycin.

These antibiotics have been used to treat a wide range of bacterial infections in humans and animals. Bacillus and Paenibacillus are also genera of bacteria that produce antibiotics, but they are less commonly used in medicine.

Penicillium is a genus of fungi that produces the antibiotic penicillin, while Cephalosporium is a genus of fungi that produces cephalosporin antibiotics. However, most of the natural antibiotics used in medicine today are produced by Streptomyces species.

Learn more about Natural antibiotics here:

https://brainly.com/question/30354329

#SPJ11

Other Questions
which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles. A frog is riding on the top of a cylindrical piece of wood floating in still water. Half of the wood, with a diameter of 4 cm and length 20 cm, is immersed in water. The density of water is 1 gm/cc. a) What is the mass of the wood along with the frog? b) After the frog slowly goes into the water only one third of the wood remains immersed in water. Calculate the mass of the frog. c) Calculate x, the distance between the water level and the center of the circular end of the wooden piece. d) Briefly describe the motion of the wood after the instance the frog moves into the water. Give a rough sketch of x as a function of time. an unknown gas effuses through an opening at a rate 3.16 time slower than nenon gas. estimate the mola mass of this unknown gas. Tom is making birdhouses to sell at a farmers market each birdhouse requires 4.5 feet of wood planks to build and he sells them for $19.75 each if he has no more than 80 feet of planks to make birdhouses how much money can Tom earn at the farmers market. Show your work I know the answer but not the work. Simplify to create an equivalent expression2(-2-4p) + 2(-2p-1) How high would a 8 kg mass need to be lifted to have a potential energy of 400 J? Cmo presentars el escenario y los personajes de tu fbula? a car loan is taken for $23,000 to be paid back in 6 years, with monthly payments of $564. what nominal annual interest rate is being charged in this loan? what is the solubility of strontium sulfate, srso4, in 0.36 m sodium sulfate, na2so4 solution? What must be the mass of a chunck of aluminum that takes 8550 J of engery ti be heated from 50 C to 72 C the layer of cells that selectively allows water and other materials through to the vascular tissue is known as the If something is copyrighted, how can it be used? which of the following was a difference between the british government and the colonial governments in america? group of answer choices women could vote in britain. a larger proportion of men could vote in britain than could vote in the colonies. there was no aristocratic class of nobles in the colonies. the colonies did not have their own governments. The Jones family eats 572 bananas each year. How many do they average eating in one week supercoiling of dna choose one: a. is an energy-independent process that happens spontaneously. b. is unnecessary to fit the dna into the cell. c. occurs only in prokaryotes. d. may be affected by antibiotics.