experiments show that if the chemical reaction takes place at 45 c, the rate of reaction of dinitrogen pentoxide is proportional to its concentration as follows: how long will the reaction take to reduce the concentration of to 50% of its original value? select the correct answer. question 4 options: t

Answers

Answer 1

The long will the reaction will take to reduce the concentration of to the 50% of its original value is 1386 sec. The option A is correct.

The expression is as :

d[N₂O₅] / dt = -0.0005 [N₂O₅]

[N₂O₅] (t) = [N₂O₅] (0) . e^-0.0005t

[N₂O₅](t) = Ce^-0.0005t

The reaction concentration of to the 50% of its original value is 0.5 C

0.5 C = Ce^-0.0005t

By dividing both side by C

0.5 = e^-0.0005t

Now taking the natural logarithm on the both side, we get

ln0.5 = lne^-0.0005t

ln 0.5 = - 0.0005t

t = - 0.693 / - 0.0005

t = 1386 sec

The time taken is 1386 sec. The correct option is A.

To learn more about reaction here

https://brainly.com/question/15709670

#SPJ4

Thus question is incomplete, the complete question is :

Experiments show that if the chemical reaction N2O5→2NO2+1/2O2, takes place at 45°C, the rate of reaction of dinitrogen pentoxide is proportional to its concentration as follows: -d[N2O5]/dt = 0.0005[N2O5] How long will the reaction take to reduce the concentration of N2O5 to 50% of its original value? select the correct answer. question 4 options:

A) t = 1386 sec

B) t = 211 sec

C) t = 2345 sec

D) t = 111 sec


Related Questions

A system releases 8.8 kJ of heat while 6.7 kJ of work is done on it. Calculate ΔE.

Answers

the change in internal energy of the system is -15.5 kJ. Since the value is negative, this indicates that the system lost energy.

The first law of thermodynamics states that the change in internal energy (ΔE) of a system is equal to the heat (q) added to the system minus the work (w) done by the system:

ΔE = q - w

In this case, the system releases 8.8 kJ of heat (q = -8.8 kJ) and has 6.7 kJ of work done on it (w = 6.7 kJ). Plugging these values into the formula above, we get:

ΔE = -8.8 kJ - 6.7 kJ

ΔE = -15.5 kJ

Thermodynamics is the branch of physics that deals with the relationships between heat, energy, and work. It is a fundamental concept in understanding how energy is transferred and transformed in physical systems, from the behavior of atoms and molecules to the macroscopic properties of matter.

Thermodynamics is based on a few fundamental laws, including the first law of thermodynamics (also known as the law of conservation of energy), which states that energy cannot be created or destroyed, only transferred or converted from one form to another. The second law of thermodynamics states that the total entropy of a closed system can only increase over time, and that heat will flow spontaneously from hotter objects to colder ones.

Learn more about Thermodynamics here:

https://brainly.com/question/1368306

#SPJ1

consider combustion of liquid and gaseous ethanol with the stoichiometric amount of air. both enter the combustion chamber at 25 degrees c. which will have a higher adiabatic flame temperature?

Answers

When considering the combustion of liquid and gaseous ethanol with the stoichiometric amount of air, both entering the combustion chamber at 25 degrees Celsius, the adiabatic flame temperature will be higher for gaseous ethanol.


1. Combustion reaction: Ethanol (C2H5OH) reacts with oxygen (O2) in the air to produce carbon dioxide (CO2) and water (H2O).
2. Adiabatic flame temperature: This is the maximum temperature that can be achieved during a combustion process without any heat loss to the surroundings.
3. Enthalpy of vaporization: Liquid ethanol requires additional energy (enthalpy of vaporization) to transition into the gaseous state before combustion can occur.
4. Energy balance: When the combustion of liquid ethanol occurs, the enthalpy of vaporization is first subtracted from the total energy available for combustion, resulting in a lower overall energy release for the combustion reaction.
5. Gaseous ethanol: Since gaseous ethanol is already in the gas phase, it does not require additional energy for vaporization. Thus, the energy available for combustion is higher than in the case of liquid ethanol.
6. Higher adiabatic flame temperature: Due to the higher energy available for combustion in the case of gaseous ethanol, the adiabatic flame temperature is higher when compared to the combustion of liquid ethanol.
In conclusion, the adiabatic flame temperature is higher for gaseous ethanol as compared to liquid ethanol due to the energy required for vaporization in the case of liquid ethanol, which reduces the overall energy available for combustion.

for more such question on combustion

https://brainly.com/question/13251946

#SPJ11

name two substances that undergo melting​

Answers

Answer:

they ate lelo pudina hahahha

is it possible to speed up a slow reaction without increasing the temperature or increasing the concentration reactants?

Answers

Yes, it is possible to speed up a slow reaction without increasing the temperature or increasing the concentration of reactants by using a catalyst.

A slow reaction can be sped up which can be done by providing an alternative reaction pathway with a lower activation energy. This is known as catalyzing the reaction, and it is done by adding a catalyst which acts as an intermediate in the reaction pathway, thus reducing the activation energy and enabling the reaction to occur at a faster rate.

Catalysts can be in the form of enzymes, such as those found in organisms, or chemical catalysts, such as the acids used in acid-catalyzed reactions. These catalysts speed up reactions by providing an alternative pathway to form the product with a lower activation energy than the non-catalyzed reaction. In other words, they provide an alternate way to get to the product faster. Catalysts may be in the form of a solid, liquid, or gas and can also be homogeneous or heterogeneous.

In summary, it is possible to speed up a slow reaction without increasing the temperature or increasing the concentration of reactants by providing an alternative reaction pathway with a lower activation energy using a catalyst.

For more such questions on Catalysts.

https://brainly.com/question/864515#

#SPJ11

which of the following events takes place in the electron transport chain? which of the following events takes place in the electron transport chain? the breakdown of an acetyl group to carbon dioxide the breakdown of glucose into six carbon dioxide molecules substrate-level phosphorylation the harnessing of energy from redox reactions to generate a proton gradient

Answers

The electron transport chain (ETC) is a series of membrane-bound proteins that transfer electrons from electron donors (such as NADH and FADH₂) to electron acceptors (such as oxygen) through a series of redox reactions.

The ETC plays a critical role in aerobic respiration and is responsible for generating a proton gradient across the mitochondrial inner membrane, which is used to generate ATP through the process of oxidative phosphorylation.

Therefore, the event that takes place in the electron transport chain is the harnessing of energy from redox reactions to generate a proton gradient. This occurs as electrons are passed along the ETC and are used to pump protons (H⁺) from the matrix into the intermembrane space. This creates a proton gradient that is used by ATP synthase to generate ATP from ADP and Pi.

The other events mentioned, such as the breakdown of an acetyl group to carbon dioxide and the breakdown of glucose into six carbon dioxide molecules, occur earlier in cellular respiration during glycolysis and the citric acid cycle. Substrate-level phosphorylation, on the other hand, occurs during glycolysis and the citric acid cycle and involves the direct transfer of a phosphate group from a substrate molecule to ADP to generate ATP.

To learn more about electron  refer to:

brainly.com/question/28977387

#SPJ4

What's the answer to red eye rick lab safety breakout?? I need help. Everytime I solve for them I keep getting the wrong answers. I've been trying to solve the second question for almost 2 hours. I'm so frustrated I cant figure it out. ​

Answers

always wear chemical splash goggles for eye protection when working with chemicals.

One or both eyes may be affected by the prevalent condition known as red eye. The blood vessels on the surface of your eye that are enlarged (dilated) as a result of an irritation or infection are the source of the redness associated with red eyes.
Bleach and paint thinner are two of the most popular caustic agents that can irritate skin or seriously injure it. Acidic and alkaline substances can also cause significant injury.Alkali burns harm the cornea by altering pH, ulcerating, proteolyzing, and impairing collagen synthesis. Because they are lipophilic, alkali compounds enter the eye more quickly than acids. The saponification reaction within those cells is caused by the basic substance, which can rapidly deposit within the tissues of the ocular surface.

The lab safety measures to prevent red eye risk are as follows:1) When dealing with chemicals, always wear chemical splash goggles to protect your eyes.
2) Keep chemical interaction off of your skin and eyes.
3) Reduce your exposure to all chemicals.
4) Assume that every substance with undetermined toxicity is extremely toxic.


To know more about Chemical go through:-

https://brainly.com/question/29886197

#SPJ4

if a sample of 0.500 moles of hydrogen sulfide was reacted with excess concentrated sulfuric acid, how many moles of sulfur dioxide would be produced

Answers

If a sample of 0.500 moles of hydrogen sulfide was reacted with excess concentrated sulfuric acid, then 0.500 moles of sulfur dioxide will be produced.

The balanced equation for the reaction of hydrogen sulfide and sulfuric acid is as follows:

H2S + H2SO4 → SO2 + 2H2O

The balanced equation should be used to determine the number of moles of sulfur dioxide produced. It can be seen from the balanced equation that one mole of hydrogen sulfide will produce one mole of sulfur dioxide. Therefore, if 0.500 moles of hydrogen sulfide are reacted with excess sulfuric acid, 0.500 moles of sulfur dioxide will be produced.

An excess reagent is present in a chemical reaction in which the number of moles of one reagent exceeds the number of moles needed to react with another reagent completely. The reaction will stop when the limiting reagent is used up, and any excess reagent will be left over.

Limiting reagent: It is a reactant that is fully consumed during the reaction, restricting the quantity of produced product.

Excess reagent: It is a reactant that is not entirely consumed in a reaction. It is present in an amount greater than necessary to react with the limiting reagent completely.

#SPJ11

Learn more about limiting reagent: What is limiting reagent? https://brainly.com/question/26905271

Consider the Bohr model of the atom Which transition would correspond to the highest frequency of light emitted? Select one: n=1 to n=5 n=4 to n=1 n=6 to n=10 n=2 to n=6 n=6 to n-3

Answers

The transition corresponding to the highest frequency of light emitted is E. n=6 to n=3. This is because the frequency of light emitted is proportional to the difference in energy between the initial and final states.

According to the Bohr model, as the energy of the orbit increases, the radius of the orbit increases, and therefore the energy difference between two adjacent orbits increases. Thus, n=6 to n=3 has the greatest energy difference, and therefore the highest frequency of light emitted.


To better understand this concept, we can consider the relationship between the energy of the orbit and its radius. According to the Bohr model, the energy of an electron in an orbit of radius r is given by: E=-2.18x10^-18/r, where r is measured in meters. Thus, when the radius of the orbit increases, the energy of the orbit increases, and therefore the energy difference between two adjacent orbits increases. As a result, the frequency of light emitted increases.


In conclusion, the transition corresponding to the highest frequency of light emitted is n=6 to n=3. This is because the energy difference between these two orbits is the greatest and therefore the frequency of light emitted is the highest. Therefore the correct option is E


The complete question is :

Consider the Bohr model of the atom Which transition would correspond to the highest frequency of light emitted? Select one:

a. n=1 to n=5

b. n=4 to n=1

c. n=6 to n=10

d. n=2 to n=6

e. n=6 to n=3

Know more about  Bohr model here:

https://brainly.com/question/29400473

#SPJ11

What Is The Relative PH At The Equivalence Point Of The Titration Of A Weak Acid With A Strong Base? a. pH > 7 b. pH = 7 c. pH < 7

Answers

The correct option is pH > 7. For the titration of a frail corrosive with a solid base, the pH bend is at first acidic and has a fundamental comparability point (pH > 7).

The motivation behind a solid corrosive solid base titration is to decide the grouping of the acidic arrangement by titrating it with an essential arrangement of known focus, or the other way around until neutralization happens. As both the corrosive and base areas of strength are (upsides of Ka and Kb), the two of them will completely separate, and that implies every one of the particles of corrosive or base will totally different particles.

At the comparability point, equivalent measures of H+ and Gracious particles will join to frame H2O, bringing about a pH of 7.0 (neutral). The pH at the identicalness point for this titration will continuously be 7.0, note that this is valid just for titrations of a solid corrosive with a solid base.

Likewise, the anion (negative particle) made from the separation of the corrosive joins with the cation (positive particle) made from the separation of the base to make a salt. In this way, the response between a solid corrosive and a solid base will bring about water and salt.

to know more about acids click here:

https://brainly.com/question/25148363

#SPJ4

If you create 1.5 liters of solution using 50.5 grams of copper (II) sulfate, what is the molarity of the solution? SHOW ALL WORK!​

Answers

The solution has a molarity of 0.2108 M. (molar).

How can I determine molarity?

Molarity (M), which is determined by dividing the solute's mass in moles by the volume of the solution in litres, is the most often used unit to represent solution concentration: litres of solution/moles of solute equals M.

We need to know how many moles of copper (II) sulphate are dissolved in the solution in order to determine the molarity of the solution.

moles = mass / molar mass

The molar mass of copper (II) sulphate is 159.609 g/mol. The finding is that the solution has the following moles of copper (II) sulphate in it:

moles = 50.5 g / 159.609 g/mol

moles = 0.3162 mol

We can now determine the molarity of the solution using the definition of molarity:

molarity = moles / volume

molarity = 0.3162 mol / 1.5 L

molarity = 0.2108 M

To know more about molarity visit:-

https://brainly.com/question/8732513

#SPJ1

A mystery compound is a liquid with a boiling point of 50 degrees Celsius. Is it like likely to be an ionic compound? Why or why not.

Answers

Answer:

Yes

Explanation:

It's boiling point is high

5.0 Mol Al reacts with 6.0 mol O2 to form Al2O3. How many moles of Al2O3 form when 6.0 mol O2 are used up?

Answers

4 moles of [tex]Al_2O_3[/tex] form when 6.0 mol [tex]O_2[/tex] are used up where 5.0 Mol Al reacts with 6.0 mol oxygen ([tex]O_2[/tex]) to form [tex]Al_2O_3[/tex].

Given the number of moles of Al = 5

Moles of [tex]O_2[/tex] = 6

The reaction is : [tex]4Al + 3O_2 --- > 2Al_2O_3[/tex]

Initially, 4 moles of Aluminum is used to react with 3 moles of Oxygen to form 2 moles of aluminum trioxide ([tex]Al_2O_3[/tex]).

According to the question we have more than enough moles of aluminum to react with oxygen to form aluminum oxide.

The mole ratio of Oxygen to aluminum trioxide = 3 : 2

then when all 6 moles of oxygen is used up to produce [tex]Al_2O_3[/tex] such that:

moles of [tex]Al_2O_3[/tex] used = 2 * 6/3 = 4 moles

To learn more about moles click here https://brainly.com/question/26416088

#SPJ1

HELPPPPPPP
Minerals easily dissolved by the water in a river, such as calcium and magnesium, are then carried in the solution __________.

Answers

Minerals easily dissolved by the water in a river, such as calcium and magnesium, are then carried in the solution downstream.

What is Minerals?

Minerals are naturally occurring inorganic substances that are solid and have a definite chemical composition and crystal structure. They are formed by geological processes and are typically found in rocks, ores, and mineral deposits. Some examples of minerals include quartz, feldspar, mica, calcite, and magnetite. Minerals have a variety of uses, from being used as building materials to being important components in industrial processes, electronics, and other applications.

Minerals that are easily dissolved by water, such as calcium and magnesium, can dissolve and form ions in a river or other body of water. These ions can then be carried away in the solution as the water flows downstream. This process is called dissolution and is a common way in which minerals are transported by water.

Learn more about Minerals from the given link

https://brainly.com/question/89259

#SPJ1

how many molecules of ammonia are produced when 100 grams of nitrogen reacts with 100 grams of hydrogen

Answers

When 100 grams of nitrogen reacts with 100 grams of hydrogen, the number of molecules of ammonia produced can be calculated as follows: Step-by-step explanation:

According to the balanced chemical equation:N2 + 3H2 → 2NH3The ratio of nitrogen to ammonia produced is 1:2. Therefore, if 1 mole of nitrogen reacts, it produces 2 moles of ammonia. Hence, the number of moles of nitrogen and hydrogen can be calculated as follows:100 g of nitrogen = 100/28 g/mol = 3.57 mol100 g of hydrogen = 100/2 g/mol = 50 mol Since the reaction requires 3 moles of hydrogen to react with 1 mole of nitrogen, only 1/3 of the hydrogen will be used.

Hence, the limiting reactant is nitrogen, which means that all the nitrogen will be consumed in the reaction, and the number of moles of ammonia produced will be equal to the number of moles of nitrogen used, i.e., 3.57 moles. Therefore, the number of molecules of ammonia produced can be calculated using the Avogadro's number, which is 6.022 × 1023 molecules per mole. Hence, the number of molecules of ammonia produced is:3.57 mol NH3 × 6.022 × 1023 molecules/mol = 2.15 × 1024 molecules of ammonia.

Learn more about ammonia production at: brainly.com/question/30622216

#SPJ11

Calculate the pH of a buffer solution that is 0.050 M in benzoic acid (HC7H5O2) and 0.150 M in sodium benzoate (NaC7H5O2). For benzoic acid, Ka = 6.5*10^-5. Thank you :)

Answers

The pH of the buffer solution that is 0.050 M in benzoic acid (HC7H5O2) and 0.150 M in sodium benzoate (NaC7H5O2) is calculated as 4.68.

What is meant by pH?

pH refers to the concentration of hydrogen ions in any solution and this is the indicator of a solution's acidity or alkalinity

Buffer solution is one that resists changes in pH when small amounts of acid or base are added.

HC7H5O2(aq) + H2O(l) ⇌ H3O+(aq) + C7H5O2-(aq)

Ka = [H3O+][C7H5O2-]/[HC7H5O2]

[HC7H5O2] = 0.050 M

[C7H5O2-] = 0.150 M

H3O+(aq) + C7H5O2-(aq) → HC7H5O2(aq) + H2O(l)

pH = pKa + log([C7H5O2-]/[HC7H5O2])

pKa is negative logarithm of the acid dissociation constant (pKa = -log(Ka)).

pH = -log(6.5×10^-5) + log(0.150/0.050)

= 4.20 + 0.477

pH = 4.68

Therefore, pH of the buffer solution is 4.68.

To know more about pH, refer

https://brainly.com/question/172153

#SPJ1

1. what is the ph of a solution after 400.0 ml of 0.200 m hydrochloric acid, hcl, has been titrated with 0 ml, 320.0 ml, and 500.0 ml of 0.250 m sodium hydroxide, naoh?

Answers

The pH of a solution after 400.0 ml of 0.200 m hydrochloric acid, HCl, has been titrated with 0 ml, 320.0 ml, and 500.0 ml of 0.250 m sodium hydroxide, NaOH is 1.63.

The equation for the reaction is-

HCl + NaOH → NaCl + H₂O

Since, the number of moles of HCl is less than NaOH. Therefore, HCl is limiting, and the excess of NaOH is reacted with H₂O,

NaOH → Na+ + OH-

Here, mole of HCl = 0.4 × 0.2 = 0.08 mol

For NaOH added: 0.08 mol HCl requires 0.08 mol of NaOH for complete neutralization

0.08 - 0.08 = 0 mol of NaOH is left after the reaction with 320.0 mL

0.08 - 0.125 = -0.045 mol of NaOH left, which is not possible.

Hence, NaOH is completely reacted with 500.0 mL of HCl.

The concentration of HCl is 0.2 m, and the number of moles of HCl is 0.08 mol. Thus, 0.08 ÷ 0.4 = 0.2 M, the concentration of HCl remaining.

Then,0.125 mol of NaOH reacts with 0.08 mol of HCl.

Therefore, the moles of NaOH left with 320.0 mL = 0.125 - 0.08 = 0.045

The moles of NaOH remaining after 500 mL of HCl are reacted with NaOH = 0 mol. Thus, we can add up the moles of NaOH added to the total, which is 0.125 + 0.045 + 0 = 0.17 moles.

The concentration of NaOH is 0.25 M, and the volume of NaOH is 0.17 L, which yields 0.0425 moles of NaOH.

So, OH- concentration = moles of NaOH/total volume= 0.0425 / (0.4 + 0.32 + 0.5) L= 0.0425 / 1.22 L= 0.0348 M
pH = 14 - pOH = 14 - (- log 0.0348)= 14 + 1.46= 1.63

Therefore, the  pH is 1.63.

To learn more about "sodium hydroxide", visit:  https://brainly.com/question/23857994

#SPJ11

a strip of copper metal is riveted to a strip of aluminum. the two metals are then heated. what happens?

Answers

To translate a temperature change into mechanical displacement, a bimetallic strip is employed. Two strips of various metals that expand at various rates when heated make up the strip.

When the strip is heated, what happens?

The metal that has a larger thermal expansion will bend more when the bimetallic strip is heated. As a result, they budge in the direction of the less thermally expanding metal.

What is the name of the strip used in fire alarms, which is formed of two different metals linked back to back?

Full response: To translate a temperature change into mechanical displacement, a bimetallic strip is employed. The strip is made of two strips of various metals, typically steel and copper, or occasionally steel, that expand at various rates when heated.

To know more about temperature visit:-

brainly.com/question/29072206

#SPJ1


If a 100.0 g sample of water at 84.7°C is added to a 100.0 g sample of water at 79.6°C, determine the final temperature of the water. Assume no heat is lost to the surroundings.

Answer Question 17 kJ

Answers

To determine the final temperature of the water, we need to use the principle of conservation of energy. The heat lost by the hotter water will be gained by the cooler water until they reach thermal equilibrium.

We can use the following equation to calculate the final  temperature :

m1c1ΔT1 + m2c2ΔT2 = 0

where m1 and m2 are the masses of the two samples of water, c1 and c2 are their specific heats, and ΔT1 and ΔT2 are the temperature changes.

In this case, m1 = m2 = 100.0 g and c1 = c2 = 4.184 J/g°C (the specific heat of water). ΔT1 = 84.7°C - T (where Tis the final temperature) and ΔT2 = T - 79.6°C.

Substituting these values into the equation, we get:

100.0 g x 4.184 J/g°C x (84.7°C - T) + 100.0 g x 4.184 J/g°C x (T - 79.6°C) = 0

Solving for T, we get:

T = (100.0 g x 4.184 J/g°C x 84.7°C + 100.0 g x 4.184 J/g°C x 79.6°C) / (100.0 g x 4.184 J/g°C x 2)

T = 82.15°C

Therefore, the final temperature of the water is 82.15°C.

To know more about thermal equilibrium, visit:

https://brainly.com/question/29419074

#SPJ1

if you add 5 ml of 0.5 m naoh solution to 20 ml each of buffer b (with a ph of 4.03) and buffer c, which buffers ph would change the least?

Answers

If you add 5 ml of 0.5 M NaOH solution to 20 ml each of buffer B (with a pH of 4.03) and buffer C, the buffer whose pH will change the least is buffer B.

What is a buffer?

A buffer is a solution that resists changes in pH when acid or alkali is added. A buffer solution is a solution that contains a weak acid and its corresponding weak base or a weak base and its corresponding weak acid.

The Henderson-Hasselbalch equation can be used to calculate the pH of a buffer solution before and after adding a strong base or acid.

The equation is pH = pKa + log ([A-]/[HA])

where:pKa is the dissociation constant for the acid[A-] is the conjugate base of the acid when a command (such as NaOH) is added to a buffer solution, the base reacts with the weak acid to form the conjugate base of the acid and water. The addition of the conjugate base of the acid causes the pH of the solution to rising.

When an acid (such as HCl) is added to a buffer solution, the acid reacts with the weak base to form the conjugate acid of the base and water. The addition of the conjugate acid of the base causes the pH of the solution to decrease. Based on the above equation, pH change will be minimum in Buffer B. Therefore, the buffer whose pH will change the least is buffer B.

#SPJ11

to learn more about buffer : https://brainly.com/question/24262133

What would you see when titrating if an indicator was not added? - no color change would occur; it would not be clear when the equivalence point was reached
- a color change would still occur; it would not be clear when the equivalence point was reached - a color change would still occur, the equivalence point would still be identifiable
- no color change would occur; the equivalence point would still be identifiable

Answers

No color change would occur; it would not be clear when the equivalence point was reached. Option A

What is the use of indicator in titration?

In titration, an indicator is a substance that is used to signal the endpoint of the titration by changing color. The use of an indicator is important in titration as it helps to determine when the reaction is complete.

During a titration, a solution of known concentration, called the titrant, is added to a solution of unknown concentration, called the analyte, until the reaction is complete. The point at which the reaction is complete is called the endpoint. At the endpoint, the stoichiometric amount of titrant has reacted with the analyte, and no more titrant is required to complete the reaction.

Learn more about equivalence point:https://brainly.com/question/29999744

#SPJ1

a solution has an initial concentration of acid ha of 1.4 m. if the equilibrium hydronium ion concentration is 0.12 m, what is the percent ionization of the acid? give your answer with two significant figures

Answers

The percent ionization of the acid whose initial concentration is 1.4 M and equilibrium hydronium ion concentration is 0.12 M is 8.6%.

The percent ionization of the acid can be defined as the ratio of the concentration of H⁺ ions present in the solution after the reaction to the initial concentration of acid present in the solution.

Mathematically, it can be given as:

% ionization of acid = ([H⁺]/[HA]₀) × 100

Where [H⁺] is the concentration of hydronium ions present in the solution, and [HA]₀ is the initial concentration of the acid present in the solution.

From the question, the initial concentration of acid ha is 1.4 M, and the equilibrium hydronium ion concentration is 0.12 M.

Using the above formula,

% ionization of acid = ([H+]/[HA]0) × 100

% ionization of acid = (0.12/1.4) × 100

% ionization of acid = 8.57%

Therefore, the percent ionization of the acid rounded to two significant figures is 8.6%.

To know more about percent ionization, refer here:

https://brainly.com/question/29651327#

#SPJ11

a solution of a monoprotic acid was titrated with naoh, what is the molar ratio of the acid to the base?

Answers

When a monoprotic acid is titrated with sodium hydroxide (NaOH), the molar ratio of the acid to the base is 1:1.

This means that for every mole of acid in the solution, one mole of NaOH is required to completely neutralize it. During the titration process, the acid and the base react in a 1:1 stoichiometric ratio. The endpoint of titration occurs when all of the acid has reacted with the base, and the pH of the solution has reached a neutral value of 7. This molar ratio is important for calculating concentration of the acid or base in a solution, as well as for determining the equilibrium constants of acid-base reactions.

To know more about monoprotic acid, here

brainly.com/question/30430366

#SPJ4

what is the total pressure (in atm) exerted by a mixture of 26.35 g n2 and 30.108 g o2 in a 1.68 l vessel at 298.28 k?

Answers

The total pressure exerted by the mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K is approximately 8.36 atm.

The total pressure exerted by a mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K can be calculated using the Ideal Gas Law equation: PV = nRT.

Step 1: Calculate the number of moles (n) for each gas using their molar masses:
- Molar mass of N2 = 28.02 g/mol
- Molar mass of O2 = 32.00 g/mol
n_N2 = 26.35 g / 28.02 g/mol = 0.9405 mol
n_O2 = 30.108 g / 32.00 g/mol = 0.9409 mol
Step 2: Calculate the total number of moles (n_total) for the gas mixture:
n_total = n_N2 + n_O2 = 0.9405 mol + 0.9409 mol = 1.8814 mol
Step 3: Find the value of the gas constant (R) in the appropriate units. Since we want the pressure in atmospheres (atm), we'll use R = 0.0821 L*atm/(mol*K).
Step 4: Plug the values into the Ideal Gas Law equation:
P = nRT / V
P = (1.8814 mol * 0.0821 L*atm/(mol*K) * 298.28 K) / 1.68 L
Step 5: Solve for the pressure (P):
P = 8.3626 atm
So, the total pressure exerted by the mixture of 26.35 g N2 and 30.108 g O2 in a 1.68 L vessel at 298.28 K is approximately 8.36 atm.

for more such question on pressure

https://brainly.com/question/24719118

#SPJ11

what does it mean when we say that a molecule is polar?

Answers

When we say that a molecule is polar, it means that the molecule has a net dipole moment due to the presence of polar bonds.

A polar molecule has an unequal distribution of electron density, leading to regions with partial positive and partial negative charges.
Polar molecules are formed when there is a significant electronegativity difference between the atoms involved in the bond.

Electronegativity is the ability of an atom to attract electrons towards itself. When two atoms with different electronegativities form a bond, the more electronegative atom will pull the electrons closer to itself, creating a partial negative charge. The less electronegative atom will have a partial positive charge.
1. Identify the atoms involved in the bond.
2. Determine the electronegativity values of these atoms.
3. Calculate the difference in electronegativity between the atoms.
4. If the electronegativity difference is significant (generally greater than 0.5), the bond will be polar.
5. Assess the molecule's overall shape to determine if the polar bonds result in a net dipole moment. If they do, the molecule is polar.
In summary, a polar molecule is one with an unequal distribution of electron density, resulting in regions with partial positive and partial negative charges due to the presence of polar bonds and the molecule's shape.

These molecules often exhibit properties like having a higher boiling point and being more soluble in polar solvents than nonpolar molecules.

for more such question on polar

https://brainly.com/question/17118815

#SPJ11

What volume of 0.100 M CuCl2 solution results from the dilution of 150 mL of a 0.500 M solution?

Answers

As a consequence, 0.75 L or 750 mL of 0.100 M copper(II) chloride solution were created by diluting 150 mL of a 0.500 M solution.

How is volume volume calculated?

The basic formula for volume is length, breadth, and height, as opposed to length, width, and height for the area of a rectangular shape.

The dilution formula can be used to calculate the volume of the diluted solution: M1V1 = M2V2

To solve for V2, we can rewrite the equations as follows:                                  V2 = (M1V1) / M2

Inputting the values provided yields:

M1 = 0.500 M (the initial concentration), V1 = 150 mL (the initial volume), M2 = 0.100 M (the final concentration)

The starting volume is converted to litres as follows:                                             V1 = 150 mL = 0.150 L

Now that the values have been entered, we can solve for V2:

V2 = (M1V1) / M2

V2 = (0.500 M) x (0.150 L) / 0.100 M

V2 = 0.75 L

To know more about solution visit:-

https://brainly.com/question/30665317

#SPJ1

Two answers max please || Which of the following scenarios would involve a student following a process that is different from the complete scientific process?

A student builds a circuit based on a drawing to learn how a circuit is built.
A student changes the number of light bulbs that are in a circuit to see how it changes the brightness of the bulb.
A student changes the size of the wire to determine how it changes the brightness of the light bulb.
A student changes the brightness of the bulb when they change the number of batteries.

Answers

The scenario where a student follows a process that is different from the complete scientific process is the first option, where a student builds a circuit based on a drawing to learn how a circuit is built.

Why is the student's process regarded different from the complete scientific process?

This is because the scientific process involves making observations, developing a hypothesis, testing the hypothesis through experimentation, and drawing conclusions based on the results.

Building a circuit based on a drawing does not involve any of these steps and is more focused on understanding the mechanics of building a circuit.

Learn about scientific process here https://brainly.com/question/8496898

#SPJ1

Pls help me with this question pls!!!!

Answers

Both hydrogen peroxide and water are made from hydrogen and oxygen but they are different compounds with distinct properties and uses. Additional oxygen atom in hydrogen peroxide gives it its distinct chemical and physical properties, which are different from water.

What makes compound H2O2 and H2O different?

Both hydrogen peroxide (H2O2) and water (H2O) are made from hydrogen and oxygen but they are different compounds with distinct properties and uses.

Primary  difference between hydrogen peroxide and water is their chemical structure. Hydrogen peroxide has an additional oxygen atom when compared to water and this makes its chemical and physical properties different from that of water.

Hydrogen peroxide is a clear, colorless liquid with bitter taste and slight odor. It is a powerful oxidizing agent, which implies that it readily reacts with other substances including metals, organic compounds and other chemicals. Water is a clear, colorless liquid with no taste or odor. It is a stable compound that does not readily react with other substances.

To know more about hydrogen peroxide, refer

https://brainly.com/question/25566753

#SPJ1

if a metal reacts with liquid water, is it more or less reactive than hydrogen?

Answers

If a metal reacts with liquid water, it is more reactive than hydrogen.

This is because the reaction between a metal and water involves the metal atoms losing electrons to form positive ions and hydrogen gas being produced. The reactivity of a metal is determined by its ability to lose electrons, and the more easily a metal can lose electrons, the more reactive it is.

Hydrogen is not a metal and does not react with water in the same way as metals, so it is not an appropriate comparison for metal reactivity with water.

Hydrogen atom is the simplest and the most abundant element in the universe. It consists of a single proton at its nucleus and a single electron in its only orbital. The electron in a hydrogen atom can exist in various energy levels, and the energy difference between these levels corresponds to the absorption or emission of a photon of light.

To know more about hydrogen atom here

https://brainly.com/question/29695801

#SPJ4

Gen Chem 2, really need help with this

Answers

From the information that we have in the question, we can see that the [H3O]^+ of the solution is 0.0631 M

What is the pOH?

The pOH is a measure of the hydroxide ion (OH-) concentration in a solution, similar to how the pH is a measure of the hydrogen ion (H+) concentration. It is defined as the negative logarithm (base 10) of the hydroxide ion concentration.

Like pH, pOH is commonly used in analytical chemistry, biology, and environmental science to characterize and measure the properties of aqueous solutions.

We know that;

pH = 14 - pOH

pH = 14 - 12.8

pH = 1.2

[H3O]^+ = Antilog(-pH)

= Antilog (-1.2)

= 0.0631 M

Learn more about pOH:https://brainly.com/question/17144456

#SPJ1

chemoautotrophs use ___ as an energy source and ___ as a carbon source.

Answers

Chemoautotrophs use inorganic chemicals as an energy source and carbon dioxide as a carbon source.

What is a Chemoautotroph?

Chemoautotrophs are autotrophs that obtain their energy from chemical compounds rather than from sunlight. They generate their own food by using energy from inorganic substances like sulfur, ammonia, or ferrous iron in a process called chemosynthesis.

They are mainly found in harsh environments such as volcanic vents or deep-sea vents, where photosynthesis is not possible because there is no sunlight to drive the reaction.

What is an energy source?

Energy sources are substances or processes that provide energy for a given system. Chemical, thermal, and electromagnetic energy sources are the most common forms of energy sources.

What is carbon?

Carbon is an element that is essential to all life forms. Carbon is a building block of most organic molecules, including carbohydrates, lipids, proteins, and nucleic acids, which are the essential components of life.

What is a carbon source?

A carbon source is an essential element for the growth of living organisms. It is a nutrient that is necessary for the synthesis of organic molecules that make up living organisms, such as carbohydrates, lipids, proteins, and nucleic acids.

Chemoautotrophs use inorganic compounds such as ammonia, sulfur, or ferrous iron as an energy source to produce organic molecules from carbon dioxide and water. As a result, chemoautotrophs are the primary producers of food in ecosystems where photosynthesis is not feasible, and their existence is critical to the survival of other living organisms.

To know more about chemoautotrophs refer here:

https://brainly.com/question/28515929#

#SPJ11

Other Questions
One problem that may result when a nation imports more than it exports is? 2. (07.03)What is the value of y in the equation 2(4y - 1) = 6? (4 points)O00010608 a customer cannot refer another customer a customer can refer either only one customer or no customers at all a customer can refer many customers a customer must refer many customers all of the above How did Sojourner Truth used Direct statement, Ethical appeal, and Ethos during her speech to the American Equal Rights Association? Please help What is an earthquake? big scientific paragraph.. 1A: Which sentence accurately states the author's purpose in using the photograph ofHenrietta Lacks to introduce the interview?* 1 pointSilver begins his interview with the photograph of Henrietta Lacks in order toO emphasize the human elementof the story as well as introduce Skloot's book, TheImmortal Life of Henrietta Lacks.Silver introduces his interview with the photograph of Henrietta Lacks in order toOhighlight the seriousness of the disease that took her life as well as affirm the impactof her donation on medical research.Silver begins his interview with the photograph of Henrietta Lacks in order to informOhis audience that shewas an African-American woman as well as suggest that thiswas the reason her cells were taken withoutpermission.Silver introduces his interview with the photograph of Henrietta Lacks in order tofocus his conversation withSkloot as well as highlight the author's intentions inwriting her book, The Immortal Life of Henrietta Lacks. Among the various international trade agreements, the North American Free Trade Agreement represents the highest level of integration across individual nations.False or True a debate: private school is better than public school FDA advisers recommended approval of a vaccine for people over 60 to prevent which illness? A HPV B Tuberculosis C RSV through the fourteen points, outlining his goals for peacetime negotiations following world war i, president woodrow wilson hoped to Francine inherited $5,000 and plans to deposit the money in an account that compounds the interest monthly. If she can get 6% interest, the formula to calculate the amount of money in her account after t years is given by: t A 12 5000(1.005) How long will it take for her money to grow to $7,500? the altitude of a triangle is increasing at a rate of 3 centimeters/minute while the area of the triangle is increasing at a rate of 1 square centimeters/minute. at what rate is the base of the triangle changing when the altitude is 10 centimeters and the area is 94 square centimeters? a resource or capability can be classified as a core competency that can be a source for a sustainable competitive advantage if: a. it is different and better than the way a competitor is executing the same capability. b. it is the same as the capabilities offered by competitors. c. other companies use a different capability to accomplish the same goal. d. it can be purchased through outsourcing. Write an equation that the hanger diagram models. How can you use hanger diagram to find the value of X? a silent mutation would cause: group of answer choices a change in the conformation of a protein the inhibition of translation no change in the amino acid sequence of a protein the inhibition of transcription Write the formula for the conjugate acid of each of the following bases.A) C2H5NH2B) C6H5NH2C)HPO4^2-D) HCO3^- Grade 7 question, would appreciate help A company produces and sells solar panels for $520. The company's daily profit, P(x), can be modeled by the function P(x) = 6x2 + 180x + 1,000, where x is the number of $5 price increases for each solar panel. Use the graph to answer the questions. Graph of function p of x equals negative 6 x squared plus 180 x plus 1,000. The graph has the x-axis labeled as number of price increases, and the y-axis labeled as profit. The curve begins at (0, 1000), increases to the vertex at about (15, 2350), and decreases through about (35, 0). Can someone please help me ASAP its due today!! I will give brainliest if its done correctly what answers applies to "fine print"