The histograms show the number of cell phone sales during the store's operating hours for three days. Drag each statement to the box next to the histogram that it describes.

Ca(OH)2 in an aqueous solution with a pH of 11.67 has a concentration of 2.50 x 10(-3) M.

The calcium hydroxide aqueous solution has a pH of 11.03. Two moles of hydroxide ions are created from one mole of an aqueous solution of calcium hydroxide.

The pH of a solution can be related to the concentration of hydroxide ions ([OH-]) through the equation: pH + pOH = 14

We can rearrange this equation to solve for [OH-]: [OH-] = 10^(-pOH)

Thus: Ca(OH)2 → Ca^2+ + 2 OH-

Since the molar ratio of Ca(OH)2 to [OH-] is 1:2, the concentration of hydroxide ions in the saturated solution can be calculated as follows:

[OH-] = 2 x [Ca(OH)2]

Now we can use the pH value given in the problem to calculate the pOH:

pOH = 14 - pH

pOH = 14 - 11.67

pOH = 2.33

Substituting this value into the equation for [OH-]:

[OH-] = 10^(-pOH)

[OH-] = 10^(-2.33)

[OH-] = 5.01 x 10^(-3) M

In order to get the concentration of the solution, we can apply the equation for the concentration of hydroxide ions in a saturated solution of Ca(OH)2:

[Ca(OH)2] = [OH-] / 2

[Ca(OH)2] = 5.01 x 10^(-3) M / 2

[Ca(OH)2] = 2.50 x 10^(-3) M

To know more about concentration visit:-

https://brainly.com/question/29276511

#SPJ1

The empirical formula of a novel compound is CH2O if an analysis of a 0.5998g sample reveals that it contains the following masses of elements: carbon (0.1.565g), hydrogen (0.02627g), and oxygen (0.4170g).

You need to be aware of a compound's molar mass in order to ascertain its molecular formula. You can then decide which multiple of the empirical formula corresponds to the right molecular formula. 12.0g of carbon, 3.0g of hydrogen, and 8.0g of oxygen make up a compound in a 23.0g sample.

In a hydrocarbon, carbon makes up 92.3% of the mass and hydrogen makes up 7.7%.

To know more about empirical formula visit:-

https://brainly.com/question/14044066

#SPJ1

Answer: Na2CO3(aq) + CuCl2(aq) → 2 NaCl(aq) + CuCO3(s).

Explanation:

Answer:

1. To determine the number of moles of copper in 5.00 grams of copper wire, we need to use the molar mass of copper. The molar mass of copper is 63.55 g/mol. We can use the following conversion factor:

1 mol Cu = 63.55 g Cu

Using this conversion factor, we can calculate the number of moles of copper:

5.00 g Cu × (1 mol Cu / 63.55 g Cu) = 0.0787 mol Cu

Therefore, there are 0.0787 moles of copper in 5.00 grams of copper wire.

2. To determine the number of moles of glycine molecules in 28.35 grams of glycine, we need to use the molar mass of glycine. The molar mass of glycine is 75.07 g/mol. We can use the following conversion factor:

1 mol glycine = 75.07 g glycine

Using this conversion factor, we can calculate the number of moles of glycine molecules:

28.35 g glycine × (1 mol glycine / 75.07 g glycine) = 0.3778 mol glycine

Therefore, there are 0.3778 moles of glycine molecules in 28.35 grams of glycine.

3. a. To determine the mass of the daily dietary allowance of vitamin C in grams, we can use the following conversion factor:

1 mol C6H8O6 = 176.12 g C6H8O6

Using this conversion factor, we can calculate the mass of the allowance:

1.42 × 10^-4 mol C6H8O6 × (176.12 g C6H8O6 / 1 mol C6H8O6) = 0.0248 g

Therefore, the mass of the daily dietary allowance of vitamin C for children aged 4-8 years is 0.0248 grams.

b. To determine the number of moles of carbon in 1.42 × 10^-4 mol of C6H8O6, we can use the molar mass of carbon. The molar mass of carbon is 12.01 g/mol. There are 6 carbons in each molecule of C6H8O6, so we can use the following conversion factor:

6 mol C / 1 mol C6H8O6

Using this conversion factor, we can calculate the number of moles of carbon:

1.42 × 10^-4 mol C6H8O6 × (6 mol C / 1 mol C6H8O6) = 8.52 × 10^-4 mol C

Therefore, there are 8.52 × 10^-4 moles of carbon in 1.42 × 10^-4 mol of C6H8O6.

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

We need to use the mole ratio and in this case the mole ratio of the MgCl2 to the chloride ions is 1:2

In chemistry, a mole ratio is the ratio of the amounts, in moles, of any two compounds or elements involved in a chemical reaction. It is determined by the coefficients of the balanced chemical equation for the reaction.

Mole ratios can be used in stoichiometric calculations to determine the amount of one substance that is required to react with a given amount of another substance, or to calculate the amount of product that will be formed from a given amount of reactant.

Learn more about mole ratio:https://brainly.com/question/15288923

#SPJ1

Determining the underlying cause of the mutant form of the enzyme would require a combination of genetic, molecular, and biochemical techniques to identify any differences.

The mutation may have resulted from an insertion of extra DNA sequence in the gene encoding the enzyme. This could occur due to a replication error or as a result of exposure to mutagens.

To distinguish this from other possibilities, one could sequence the DNA of the normal and mutant forms of the enzyme to identify the differences.

Learn more about enzyme:https://brainly.com/question/14953274

#SPJ1

0.5 moles of [tex]H_{2[/tex][tex]O_{2}[/tex] produces 8 grams of [tex]O_{2}[/tex].

What is Moles?

Mole is a unit of measurement used in chemistry to express the amount of a substance. It is defined as the amount of a substance that contains the same number of entities (such as atoms, molecules, or ions) as there are atoms in 12 grams of carbon-12. This number is known as Avogadro's number.

To use dimensional analysis, we need to set up the given equation in terms of units. We can use the molar mass of[tex]H_{2}[/tex][tex]O_{2}[/tex] and [tex]O_{2}[/tex] to convert between moles and grams:

2[tex]H_{2}[/tex]O2 → 2[tex]H_{2}[/tex] + [tex]O_{2}[/tex]

The balanced equation shows that 2 moles of [tex]H_{2}[/tex][tex]O_{2}[/tex] produce 1 mole of [tex]O_{2}[/tex]. We can use this ratio to convert between moles of [tex]H_{2}[/tex][tex]O_{2}[/tex]and moles of[tex]O_{2}[/tex].

0.5 moles of [tex]H_{2}[/tex]O2 x (1 mole of [tex]O_{2}[/tex] / 2 moles of[tex]H_{2}[/tex][tex]O_{2}[/tex]) = 0.25 moles of [tex]O_{2}[/tex]

Now we can use the molar mass of [tex]O_{2}[/tex] to convert moles to grams:

0.25 moles of [tex]O_{2}[/tex] x (32 g of [tex]O_{2}[/tex] / 1 mole of [tex]O_{2}[/tex]) = 8 g of [tex]O_{2}[/tex]

Learn more about Moles from the given link

brainly.com/question/15356425

#SPJ1

Answer:the concetraion of chrolune decrease

Explanation:because the chrolune not stable

The solution has a pH of around 5.93.

When a weak acid or a weak base is applied in modest amounts, buffer solutions withstand the pH shift. A buffer made of a weak acid and its salt is an example of which is an acetic acid and sodium acetate solution (CH3COOH + CH3COONa).

The weak acid is then partially dissociated in water, resulting in the conjugate base and hydrogen ions:

CH3COOH + H2O ⇌ H3O+ + CH3COO-

The acid dissociation constant, Ka, which is what this reaction's equilibrium constant is, is as follows:

Ka = [H3O+][CH3COO-]/[CH3COOH]

The Henderson-Hasselbalch equation may be used to determine the pH of a solution:

pH = pKa + log([A-]/[HA])

To begin with, we must figure out how much CH3COOH is present in the solution:

moles of CH3COOH = M x V = 0.15 mol/L x 0.050 L = 0.0075 mol

mass of CH3COOH = moles x molar mass = 0.0075 mol x 60.05 g/mol = 0.450 g

After adding sodium acetate, the solution's residual CH3COOH will be:

0.450 g - 1.00 g

= -0.55 g

The amount of sodium acetate supplied may be used to determine the CH3COO- concentration:

moles of CH3COO-=1.00g/82.03 g/mol

=0.0122 mol

The concentration of CH3COO- in the solution will be:

0.0122 mol/0.050 L=0.244 M

The Henderson-Hasselbalch equation may now be used to determine the pH of the solution:

pH = pKa + log([A-]/[HA])

pKa = -log(Ka) = -log(1.75 x 10⁻⁵) = 4.756

[A-]/[HA] = [CH3COO-]/[CH3COOH]

= 0.244 M / 0.0075 M = 32.53

pH = 4.756 + log(32.53)

= 5.93

To know more about solution visit:-

https://brainly.com/question/22695394

#SPJ1

Answer: To perform the conversions, we can use the following conversion factors:

1 atm = 760 mmHg

1 atm = 101.325 kPa

1 atm = 14.696 psi

1 atm = 101325 Pa

1 Torr = 1/760 atm

1 Pa = 1/101325 atm

Using these conversion factors, we can perform the conversions as follows:

958.5 mmHg = 958.5/760 atm = 1.2625 atm (rounded to 4 decimal places)

2.325 atm = 2.325 x 760 Torr = 1767 Torr (rounded to the nearest whole number)

444.4 kPa = 444.4/101.325 atm = 4.3817 atm (rounded to 4 decimal places)

1427.2 mmHg = 1427.2/760 atm = 1.8789 atm

= 1.8789 x 101325 Pa = 190694.87 Pa (rounded to 2 decimal places)

Therefore, the conversions are:

958.5 mmHg = 1.2625 atm

2.325 atm = 1767 Torr

444.4 kPa = 4.3817 atm

1427.2 mmHg = 190694.87 Pa

The conversions is given as: 958.5 mmHg=1.26 atm, 2.325 atm=1767.9 Torr, 444.4 kPa=4.381 atm and 1427.2 mmHg= 190237.2 Pa

Conversions refer to the process of changing a quantity or value from one unit of measurement to another. It involves converting the numerical value while maintaining the same physical quantity.

1 atm = 760 mmHg (Torr)

1 atm = 101.325 kPa

1 mmHg (Torr) = 133.322 Pa

Converting 958.5 mmHg to atm:

958.5 mmHg × (1 atm / 760 mmHg) = 1.26 atm

Converting 2.325 atm to Torr:

2.325 atm ×(760 mmHg / 1 atm) = 1767.9 Torr

Converting 444.4 kPa to atm:

444.4 kPa × (1 atm / 101.325 kPa) = 4.381 atm

Converting 1427.2 mmHg to Pa:

1427.2 mmHg × (133.322 Pa / 1 mmHg) = 190237.2 Pa

To know more about conversions, here:

https://brainly.com/question/33338623

#SPJ6

Answer:

False. Magnets do not need to touch in order to be affected by magnetic force. Magnetic force is a non-contact force that can act on objects that are some distance apart. The strength of the force depends on the distance between the magnets and their magnetic properties.

The standard change in Gibbs free energy for the reaction at 25 °C is 278.0 kJ/mol  for the given enthalpy of reaction .

The Gibbs free energy (or Gibbs energy as the preferred name; symbol G) is a thermodynamic potential that can be used to calculate the maximum amount of non-volume expansion work that a thermodynamically closed system can perform at constant temperature and pressure. It also serves as a prerequisite for processes like chemical reactions that may place under these conditions. The Gibbs free energy is denoted by the symbol G(p,T) = U+pV-TS = H-TS, where p denotes pressure, T denotes temperature, U denotes internal energy, V denotes volume, H denotes enthalpy, and S denotes entropy.

A thermodynamic quantity equal to a system's entire heat content. It is equivalent to the system's internal energy plus the product of pressure and volume.

According to the table, the standard Gibbs free energy of formation values are;

Fe₂O₃ (s) = -822.1 kJ/mol

Al₂O₃ (s) = -1675.2 kJ/mol

Al (s) = -1477.7 kJ/mol

Fe (s) = 0 kJ/mol

The reaction is:

Fe₂O₃ (s) + 2 Al (s) → Al₂O₃ (s) + 2 Fe (s).

Therefore, the standard change in Gibbs free energy for the reaction at 25 °C is:

AG = -822.1 kJ/mol + (2 x -1477.7 kJ/mol) - (-1675.2 kJ/mol) - (2 x 0 kJ/mol) = 278.0 kJ/mol

To know more about Gibbs free energy ,visit ;

https://brainly.com/question/20358734

#SPJ1

At 273 K and 1 atm, the helium gas's volume is [tex]4.33 * 10^{-23} L[/tex] .

The volume of a gas can be calculated using the Ideal Gas Law, which states that PV = nRT,

where V is the gas's volume, n is its moles in existence, R is the ideal gas constant (8.314 J/mol K), T is the gas's temperature in Kelvin, and P is the gas's atmospheric pressure.

Given that the number of moles of the gas is 1.505 x 10-23 and the temperature is 273 K (0°C), we can rearrange the equation to solve for V:

[tex]V = \frac{nRT}{P}\\[/tex]

[tex]V = \frac{(1.505 * 10^{-23})(8.314 J/mol-K)(273 K)}{(1 atm)}[/tex]

[tex]V = 4.33 * 10^{-23} L[/tex]

Therefore, the volume of the helium gas at 273 K and 1 atm is [tex]4.33 * 10^{-23} L[/tex]

learn more about  helium gas Refer:brainly.com/question/13645498

#SPJ1

Answer:

Hept

Explanation:

Non- 9 C9

Dec- 10 C10

Eth- 2 C2

Hepth- 7 C7

So the answer is D, because it idicates a molecule with 7 carbon atoms.

Hopefully this helps! :)

The pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celcius and a volume of 4 liters would be 12.27 atm.

For an ideal gas:

PV = nRT

Where:

In this case, n = 2 mole, v = 4 liters, and R = 0.08206

T = 27 + 273.15 = 300.15 K

Now we can plug in the values:

P(4) = (2)(0.08206)(300.15)

P = (2)(0.08206)(300.15) / 4

P = 12.27 atm

Therefore, the pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celsius and a volume of 4 liters is 12.27 atm.

More on ideal gas can be found here: https://brainly.com/question/28257995

#SPJ1

The answer to your question is D) An invasive species is not native to the ecosystem and causes harm.

Invasive species of plants and animals typically tend to overtake an ecosystem that they do not naturally occur in. Due to this, it causes the resources within the ecosystem to diminish which ultimately harms other species that naturally occur in said ecosystem.

As the conductivity of a 0.1 M acid solution at 298 K depends on the acid's strength, a specific Ka value cannot be determined.

We may utilize the following relationship between Ka and the level of ionization to estimate the Ka value that would produce the maximum conductivity for a 0.1 M acid solution at 298 K:

α²/(1-α) = Ka/[H+]

α²/(1-α) = Ka/0.1

1²/(1-1) = Ka/0.1\sKa = 0

Given that only strong acids completely breakdown into ions in solution, it follows that the acid would need to be strong with a Ka value significantly greater than zero in order to conduct electricity most effectively.

To learn more about conductivity of acid visit:

brainly.com/question/28721140

#SPJ1

Two solid potassium (K) combine with two liquid water (H2O) molecules to generate two aqueous potassium hydroxide (KOH) and one gaseous hydrogen (H2) molecule. For this reaction, the chemical equation is balanced as follows:

2K(s) + 2H2O(l) → 2KOH(aq) + H2(g)

The chemical reaction between potassium and water is depicted in this equation. Two liquid water (H2O) molecules and two solid potassium (K) atoms serve as the reactants.

The reaction moves from the left to the right, as shown by the arrow sign, which also denotes its direction.

In the reaction, hydrogen gas and potassium hydroxide are created when potassium atoms interact with water molecules.

Two molecules of aqueous potassium hydroxide (KOH) and one molecule of gaseous hydrogen (H2) are the reaction's end products.

According to the correctly balanced chemical equation, two potassium atoms and two water molecules combine to form two molecules of potassium hydroxide and one hydrogen gas molecule.

learn more about potassium hydroxide here

https://brainly.com/question/28330489

#SPJ1

Martha needs to use 0.294 liters or 294 milliliters of the 1.25 M H₂SO4 solution to obtain 36 grams of H₂SO4.

What is Chemical Reaction?

In a chemical reaction, the atoms and molecules of the reactants are rearranged to form new compounds or products. Chemical reactions involve the breaking and forming of chemical bonds between atoms and molecules, which involves the absorption or release of energy.

We can use the formula:

to find the volume of the 1.25 M H₂SO4 solution that contains 36 grams of H₂SO4.

First, we need to calculate the number of moles of H₂SO4 in 36 grams:

molar mass of H₂SO4 = 2 x atomic mass of H + atomic mass of S + 4 x atomic mass of O

= 2 x 1.008 + 32.06 + 4 x 16.00

= 98.08 g/mol

moles of H₂SO4 = mass / molar mass

= 36 g / 98.08 g/mol

= 0.3675 mol

Now we can use the formula above to solve for the volume of the solution:

1.25 M = 0.3675 mol / volume (in liters)

volume (in liters) = 0.3675 mol / 1.25 M

= 0.294 L

= 294 mL

Learn more about  Chemical Reaction from given link

https://brainly.com/question/25769000

#SPJ1

Answer: The formula for nitrous acid is HNO2, not nitric acid (HNO3).

a. To find the number of moles of HNO2, we need to divide the number of atoms by Avogadro's number (6.022 x 10^23 atoms per mole):

moles = 8.8 x 10^22 atoms / 6.022 x 10^23 atoms/mol

moles = 0.146 mol HNO2

b. To find the mass of HNO2, we need to multiply the number of moles by the molar mass. The molar mass of HNO2 is:

1(1.008) + 1(14.01) + 2(15.99) = 63.01 g/mol

mass = 0.146 mol x 63.01 g/mol

mass = 9.20 g HNO2

Explanation:

The empirical formula for the compound containing 37.5% carbon, 12.6% hydrogen, and 49.9% oxygen is CH₄O

The following data were obtained from the question:

From the above data, we can obtain the empirical formula for the compound as shown below:

Divide by their molar mass

C = 37.5 / 12 = 3.125

H = 12.6 / 1 = 12.6

O = 49.9 / 16 = 3.119

Divide by the smallest

C = 3.125 / 3.119 = 1

H = 12.6 / 3.119 = 4

O = 3.119 / 3.119 = 1

Thus, we can conclude that the empirical formula is CH₄O

Learn more about empirical formula:

https://brainly.com/question/29153210

#SPJ1

The balanced chemical equation for the reaction between hydrochloric acid (HCI) and sodium hydroxide (NaOH) is:

HCI + NaOH -> NaCl + H2O

From the equation, we can see that 1 mole of HCI reacts with 1 mole of NaOH to produce 1 mole of NaCl and 1 mole of water.

First, let's calculate the number of moles of HCI in 250 mL of 0.25 M solution:

Molarity (M) = moles of solute / volume of solution (L)

0.25 M = moles of HCI / 0.25 L

moles of HCI = 0.25 L x 0.25 M = 0.0625 moles

Since 1 mole of NaOH reacts with 1 mole of HCI, we will need 0.0625 moles of NaOH to neutralize the HCI.

Now, let's calculate the volume of 0.9 M NaOH solution needed to provide 0.0625 moles of NaOH:

Molarity (M) = moles of solute / volume of solution (L)

0.9 M = 0.0625 moles of NaOH / volume of NaOH solution (L)

volume of NaOH solution (L) = 0.0625 moles / 0.9 M = 0.0694 L = 69.44 mL

Therefore, 69.44 mL of 0.9 M NaOH solution would be required to titrate 250 mL of 0.25 M HCI solution.

The helium sample would occupy a volume of 11.12 L if the pressure is reduced to 5.15 atm while maintaining the temperature at 20 °C.

According to Boyle's Law, gas volume grows as pressure lowers. According to Charles' Law, a gas expands in volume as its temperature rises. Moreover, Avogadro's Law states that as gas concentration rises, so does its volume.

The relationship between pressure, volume, and temperature of a gas is given by the ideal gas law:

PV = nRT

where P is the pressure of the gas, V is its volume, n is the number of moles of gas present, R is the gas constant, and T is the temperature of the gas in kelvins.

Assuming that the number of moles and the temperature of the gas remain constant, we can use the ideal gas law to solve for the new volume of the gas when the pressure is reduced:

P1V1 = P2V2

where P1 is the initial pressure, V1 is the initial volume, P2 is the final pressure, and V2 is the final volume.

Substituting the given values:

P1 = 5.79 atm

V1 = 9.89 L

P2 = 5.15 atm

T = 20 + 273.15 = 293.15 K (converting Celsius to Kelvin)

We can solve for V2:

P1V1 = P2V2

(5.79 atm)(9.89 L) = (5.15 atm)V2

V2 = (5.79 atm)(9.89 L) / (5.15 atm)

V2 = 11.12 L

To know more about temperature visit:-

brainly.com/question/29072206

#SPJ1

If the reaction's measured product has impurities that increase its mass over what it would be if it were pure, higher percent yields than 100% are attainable.

Because the real yield is frequently lower than the theoretical value, percent yield is typically lower than 100%. This may be due to incomplete or conflicting reactions or sample loss during recovery.

It implies that interest rates will increase further, yields will increase, and bond prices would decline as a result. So, it is likely that the bond market will continue to see unusually high levels of volatility in the near future.

To know more about percent yields visit:-

brainly.com/question/12704041

#SPJ1

Answer:

B subtract

Explanation:

they are pulling away from one another so a and c are out of the question then that leaves you with b or d but we're not dividing anything. soooo we're left with B.

Answer:

The change in pH is 0.04.

Answer: Oxygen

Explanation: Its found on the periodic table as an element.

Answer:

Constructive interference is when two waves interact causing larger waves because the crest will meet a crest or a trough will meet a trough which adds the waves together changing the size of the amplitude.

Destructive interference is when two waves interact causing smaller waves because the crest will meet a trough or a trough will meet a crest which subtracts the waves together changing the size of the amplitude.